Merge pull request #12236 from liamwhite/cpu-refactor
core: refactor emulated cpu core activation
This commit is contained in:
commit
8a79dd2d6c
|
@ -3,4 +3,4 @@
|
|||
|
||||
[codespell]
|
||||
skip = ./.git,./build,./dist,./Doxyfile,./externals,./LICENSES,./src/android/app/src/main/res
|
||||
ignore-words-list = aci,allright,ba,canonicalizations,deques,froms,hda,inout,lod,masia,nam,nax,nce,nd,optin,pullrequests,pullrequest,te,transfered,unstall,uscaled,vas,zink
|
||||
ignore-words-list = aci,allright,ba,canonicalizations,deques,fpr,froms,hda,inout,lod,masia,nam,nax,nce,nd,optin,pullrequests,pullrequest,te,transfered,unstall,uscaled,vas,zink
|
||||
|
|
|
@ -4,6 +4,8 @@
|
|||
add_library(core STATIC
|
||||
arm/arm_interface.h
|
||||
arm/arm_interface.cpp
|
||||
arm/debug.cpp
|
||||
arm/debug.h
|
||||
arm/exclusive_monitor.cpp
|
||||
arm/exclusive_monitor.h
|
||||
arm/symbols.cpp
|
||||
|
|
|
@ -1,231 +1,32 @@
|
|||
// SPDX-FileCopyrightText: Copyright 2018 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
#include <map>
|
||||
#include <optional>
|
||||
|
||||
#include "common/bit_field.h"
|
||||
#include "common/common_types.h"
|
||||
#include "common/demangle.h"
|
||||
#include "common/logging/log.h"
|
||||
#include "core/arm/arm_interface.h"
|
||||
#include "core/arm/symbols.h"
|
||||
#include "core/arm/debug.h"
|
||||
#include "core/core.h"
|
||||
#include "core/debugger/debugger.h"
|
||||
#include "core/hle/kernel/k_process.h"
|
||||
#include "core/hle/kernel/k_thread.h"
|
||||
#include "core/hle/kernel/svc.h"
|
||||
#include "core/loader/loader.h"
|
||||
#include "core/memory.h"
|
||||
|
||||
namespace Core {
|
||||
|
||||
constexpr u64 SEGMENT_BASE = 0x7100000000ull;
|
||||
void ArmInterface::LogBacktrace(const Kernel::KProcess* process) const {
|
||||
Kernel::Svc::ThreadContext ctx;
|
||||
this->GetContext(ctx);
|
||||
|
||||
std::vector<ARM_Interface::BacktraceEntry> ARM_Interface::GetBacktraceFromContext(
|
||||
Core::System& system, const ARM_Interface::ThreadContext32& ctx) {
|
||||
std::vector<BacktraceEntry> out;
|
||||
auto& memory = system.ApplicationMemory();
|
||||
|
||||
const auto& reg = ctx.cpu_registers;
|
||||
u32 pc = reg[15], lr = reg[14], fp = reg[11];
|
||||
out.push_back({"", 0, pc, 0, ""});
|
||||
|
||||
// fp (= r11) points to the last frame record.
|
||||
// Frame records are two words long:
|
||||
// fp+0 : pointer to previous frame record
|
||||
// fp+4 : value of lr for frame
|
||||
for (size_t i = 0; i < 256; i++) {
|
||||
out.push_back({"", 0, lr, 0, ""});
|
||||
if (!fp || (fp % 4 != 0) || !memory.IsValidVirtualAddressRange(fp, 8)) {
|
||||
break;
|
||||
}
|
||||
lr = memory.Read32(fp + 4);
|
||||
fp = memory.Read32(fp);
|
||||
}
|
||||
|
||||
SymbolicateBacktrace(system, out);
|
||||
|
||||
return out;
|
||||
}
|
||||
|
||||
std::vector<ARM_Interface::BacktraceEntry> ARM_Interface::GetBacktraceFromContext(
|
||||
Core::System& system, const ARM_Interface::ThreadContext64& ctx) {
|
||||
std::vector<BacktraceEntry> out;
|
||||
auto& memory = system.ApplicationMemory();
|
||||
|
||||
const auto& reg = ctx.cpu_registers;
|
||||
u64 pc = ctx.pc, lr = reg[30], fp = reg[29];
|
||||
|
||||
out.push_back({"", 0, pc, 0, ""});
|
||||
|
||||
// fp (= x29) points to the previous frame record.
|
||||
// Frame records are two words long:
|
||||
// fp+0 : pointer to previous frame record
|
||||
// fp+8 : value of lr for frame
|
||||
for (size_t i = 0; i < 256; i++) {
|
||||
out.push_back({"", 0, lr, 0, ""});
|
||||
if (!fp || (fp % 4 != 0) || !memory.IsValidVirtualAddressRange(fp, 16)) {
|
||||
break;
|
||||
}
|
||||
lr = memory.Read64(fp + 8);
|
||||
fp = memory.Read64(fp);
|
||||
}
|
||||
|
||||
SymbolicateBacktrace(system, out);
|
||||
|
||||
return out;
|
||||
}
|
||||
|
||||
void ARM_Interface::SymbolicateBacktrace(Core::System& system, std::vector<BacktraceEntry>& out) {
|
||||
std::map<VAddr, std::string> modules;
|
||||
auto& loader{system.GetAppLoader()};
|
||||
if (loader.ReadNSOModules(modules) != Loader::ResultStatus::Success) {
|
||||
return;
|
||||
}
|
||||
|
||||
std::map<std::string, Symbols::Symbols> symbols;
|
||||
for (const auto& module : modules) {
|
||||
symbols.insert_or_assign(module.second,
|
||||
Symbols::GetSymbols(module.first, system.ApplicationMemory(),
|
||||
system.ApplicationProcess()->Is64Bit()));
|
||||
}
|
||||
|
||||
for (auto& entry : out) {
|
||||
VAddr base = 0;
|
||||
for (auto iter = modules.rbegin(); iter != modules.rend(); ++iter) {
|
||||
const auto& module{*iter};
|
||||
if (entry.original_address >= module.first) {
|
||||
entry.module = module.second;
|
||||
base = module.first;
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
entry.offset = entry.original_address - base;
|
||||
entry.address = SEGMENT_BASE + entry.offset;
|
||||
|
||||
if (entry.module.empty()) {
|
||||
entry.module = "unknown";
|
||||
}
|
||||
|
||||
const auto symbol_set = symbols.find(entry.module);
|
||||
if (symbol_set != symbols.end()) {
|
||||
const auto symbol = Symbols::GetSymbolName(symbol_set->second, entry.offset);
|
||||
if (symbol) {
|
||||
entry.name = Common::DemangleSymbol(*symbol);
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
std::vector<ARM_Interface::BacktraceEntry> ARM_Interface::GetBacktrace() const {
|
||||
if (GetArchitecture() == Architecture::Aarch64) {
|
||||
ThreadContext64 ctx;
|
||||
SaveContext(ctx);
|
||||
return GetBacktraceFromContext(system, ctx);
|
||||
} else {
|
||||
ThreadContext32 ctx;
|
||||
SaveContext(ctx);
|
||||
return GetBacktraceFromContext(system, ctx);
|
||||
}
|
||||
}
|
||||
|
||||
void ARM_Interface::LogBacktrace() const {
|
||||
const VAddr sp = GetSP();
|
||||
const VAddr pc = GetPC();
|
||||
LOG_ERROR(Core_ARM, "Backtrace, sp={:016X}, pc={:016X}", sp, pc);
|
||||
LOG_ERROR(Core_ARM, "Backtrace, sp={:016X}, pc={:016X}", ctx.sp, ctx.pc);
|
||||
LOG_ERROR(Core_ARM, "{:20}{:20}{:20}{:20}{}", "Module Name", "Address", "Original Address",
|
||||
"Offset", "Symbol");
|
||||
LOG_ERROR(Core_ARM, "");
|
||||
const auto backtrace = GetBacktrace();
|
||||
const auto backtrace = GetBacktraceFromContext(process, ctx);
|
||||
for (const auto& entry : backtrace) {
|
||||
LOG_ERROR(Core_ARM, "{:20}{:016X} {:016X} {:016X} {}", entry.module, entry.address,
|
||||
entry.original_address, entry.offset, entry.name);
|
||||
}
|
||||
}
|
||||
|
||||
void ARM_Interface::Run() {
|
||||
using Kernel::StepState;
|
||||
using Kernel::SuspendType;
|
||||
|
||||
while (true) {
|
||||
Kernel::KThread* current_thread{Kernel::GetCurrentThreadPointer(system.Kernel())};
|
||||
HaltReason hr{};
|
||||
|
||||
// If the thread is scheduled for termination, exit the thread.
|
||||
if (current_thread->HasDpc()) {
|
||||
if (current_thread->IsTerminationRequested()) {
|
||||
current_thread->Exit();
|
||||
UNREACHABLE();
|
||||
}
|
||||
}
|
||||
|
||||
// Notify the debugger and go to sleep if a step was performed
|
||||
// and this thread has been scheduled again.
|
||||
if (current_thread->GetStepState() == StepState::StepPerformed) {
|
||||
system.GetDebugger().NotifyThreadStopped(current_thread);
|
||||
current_thread->RequestSuspend(SuspendType::Debug);
|
||||
break;
|
||||
}
|
||||
|
||||
// Otherwise, run the thread.
|
||||
system.EnterCPUProfile();
|
||||
if (current_thread->GetStepState() == StepState::StepPending) {
|
||||
hr = StepJit();
|
||||
|
||||
if (True(hr & HaltReason::StepThread)) {
|
||||
current_thread->SetStepState(StepState::StepPerformed);
|
||||
}
|
||||
} else {
|
||||
hr = RunJit();
|
||||
}
|
||||
system.ExitCPUProfile();
|
||||
|
||||
// Notify the debugger and go to sleep if a breakpoint was hit,
|
||||
// or if the thread is unable to continue for any reason.
|
||||
if (True(hr & HaltReason::InstructionBreakpoint) || True(hr & HaltReason::PrefetchAbort)) {
|
||||
if (!True(hr & HaltReason::PrefetchAbort)) {
|
||||
RewindBreakpointInstruction();
|
||||
}
|
||||
if (system.DebuggerEnabled()) {
|
||||
system.GetDebugger().NotifyThreadStopped(current_thread);
|
||||
} else {
|
||||
LogBacktrace();
|
||||
}
|
||||
current_thread->RequestSuspend(SuspendType::Debug);
|
||||
break;
|
||||
}
|
||||
|
||||
// Notify the debugger and go to sleep if a watchpoint was hit.
|
||||
if (True(hr & HaltReason::DataAbort)) {
|
||||
if (system.DebuggerEnabled()) {
|
||||
system.GetDebugger().NotifyThreadWatchpoint(current_thread, *HaltedWatchpoint());
|
||||
} else {
|
||||
LogBacktrace();
|
||||
}
|
||||
current_thread->RequestSuspend(SuspendType::Debug);
|
||||
break;
|
||||
}
|
||||
|
||||
// Handle syscalls and scheduling (this may change the current thread/core)
|
||||
if (True(hr & HaltReason::SupervisorCall)) {
|
||||
Kernel::Svc::Call(system, GetSvcNumber());
|
||||
break;
|
||||
}
|
||||
if (True(hr & HaltReason::BreakLoop) || !uses_wall_clock) {
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
void ARM_Interface::LoadWatchpointArray(const WatchpointArray* wp) {
|
||||
watchpoints = wp;
|
||||
}
|
||||
|
||||
const Kernel::DebugWatchpoint* ARM_Interface::MatchingWatchpoint(
|
||||
const Kernel::DebugWatchpoint* ArmInterface::MatchingWatchpoint(
|
||||
u64 addr, u64 size, Kernel::DebugWatchpointType access_type) const {
|
||||
if (!watchpoints) {
|
||||
if (!m_watchpoints) {
|
||||
return nullptr;
|
||||
}
|
||||
|
||||
|
@ -233,7 +34,7 @@ const Kernel::DebugWatchpoint* ARM_Interface::MatchingWatchpoint(
|
|||
const u64 end_address{addr + size};
|
||||
|
||||
for (size_t i = 0; i < Core::Hardware::NUM_WATCHPOINTS; i++) {
|
||||
const auto& watch{(*watchpoints)[i]};
|
||||
const auto& watch{(*m_watchpoints)[i]};
|
||||
|
||||
if (end_address <= GetInteger(watch.start_address)) {
|
||||
continue;
|
||||
|
|
|
@ -12,20 +12,20 @@
|
|||
#include "common/common_types.h"
|
||||
#include "core/hardware_properties.h"
|
||||
|
||||
#include "core/hle/kernel/svc_types.h"
|
||||
|
||||
namespace Common {
|
||||
struct PageTable;
|
||||
}
|
||||
|
||||
namespace Kernel {
|
||||
enum class VMAPermission : u8;
|
||||
enum class DebugWatchpointType : u8;
|
||||
struct DebugWatchpoint;
|
||||
class KThread;
|
||||
class KProcess;
|
||||
} // namespace Kernel
|
||||
|
||||
namespace Core {
|
||||
class System;
|
||||
class CPUInterruptHandler;
|
||||
|
||||
using WatchpointArray = std::array<Kernel::DebugWatchpoint, Core::Hardware::NUM_WATCHPOINTS>;
|
||||
|
||||
// NOTE: these values match the HaltReason enum in Dynarmic
|
||||
|
@ -40,197 +40,74 @@ enum class HaltReason : u64 {
|
|||
DECLARE_ENUM_FLAG_OPERATORS(HaltReason);
|
||||
|
||||
enum class Architecture {
|
||||
Aarch32,
|
||||
Aarch64,
|
||||
AArch64,
|
||||
AArch32,
|
||||
};
|
||||
|
||||
/// Generic ARMv8 CPU interface
|
||||
class ARM_Interface {
|
||||
class ArmInterface {
|
||||
public:
|
||||
YUZU_NON_COPYABLE(ARM_Interface);
|
||||
YUZU_NON_MOVEABLE(ARM_Interface);
|
||||
YUZU_NON_COPYABLE(ArmInterface);
|
||||
YUZU_NON_MOVEABLE(ArmInterface);
|
||||
|
||||
explicit ARM_Interface(System& system_, bool uses_wall_clock_)
|
||||
: system{system_}, uses_wall_clock{uses_wall_clock_} {}
|
||||
virtual ~ARM_Interface() = default;
|
||||
explicit ArmInterface(bool uses_wall_clock) : m_uses_wall_clock{uses_wall_clock} {}
|
||||
virtual ~ArmInterface() = default;
|
||||
|
||||
struct ThreadContext32 {
|
||||
std::array<u32, 16> cpu_registers{};
|
||||
std::array<u32, 64> extension_registers{};
|
||||
u32 cpsr{};
|
||||
u32 fpscr{};
|
||||
u32 fpexc{};
|
||||
u32 tpidr{};
|
||||
};
|
||||
// Internally within the kernel, it expects the AArch32 version of the
|
||||
// thread context to be 344 bytes in size.
|
||||
static_assert(sizeof(ThreadContext32) == 0x150);
|
||||
|
||||
struct ThreadContext64 {
|
||||
std::array<u64, 31> cpu_registers{};
|
||||
u64 sp{};
|
||||
u64 pc{};
|
||||
u32 pstate{};
|
||||
std::array<u8, 4> padding{};
|
||||
std::array<u128, 32> vector_registers{};
|
||||
u32 fpcr{};
|
||||
u32 fpsr{};
|
||||
u64 tpidr{};
|
||||
};
|
||||
// Internally within the kernel, it expects the AArch64 version of the
|
||||
// thread context to be 800 bytes in size.
|
||||
static_assert(sizeof(ThreadContext64) == 0x320);
|
||||
|
||||
/// Perform any backend-specific initialization.
|
||||
// Perform any backend-specific initialization.
|
||||
virtual void Initialize() {}
|
||||
|
||||
/// Runs the CPU until an event happens
|
||||
void Run();
|
||||
// Runs the CPU until an event happens.
|
||||
virtual HaltReason RunThread(Kernel::KThread* thread) = 0;
|
||||
|
||||
/// Clear all instruction cache
|
||||
// Runs the CPU for one instruction or until an event happens.
|
||||
virtual HaltReason StepThread(Kernel::KThread* thread) = 0;
|
||||
|
||||
// Admits a backend-specific mechanism to lock the thread context.
|
||||
virtual void LockThread(Kernel::KThread* thread) {}
|
||||
virtual void UnlockThread(Kernel::KThread* thread) {}
|
||||
|
||||
// Clear the entire instruction cache for this CPU.
|
||||
virtual void ClearInstructionCache() = 0;
|
||||
|
||||
/**
|
||||
* Clear instruction cache range
|
||||
* @param addr Start address of the cache range to clear
|
||||
* @param size Size of the cache range to clear, starting at addr
|
||||
*/
|
||||
// Clear a range of the instruction cache for this CPU.
|
||||
virtual void InvalidateCacheRange(u64 addr, std::size_t size) = 0;
|
||||
|
||||
/**
|
||||
* Notifies CPU emulation that the current page table has changed.
|
||||
* @param new_page_table The new page table.
|
||||
* @param new_address_space_size_in_bits The new usable size of the address space in bits.
|
||||
* This can be either 32, 36, or 39 on official software.
|
||||
*/
|
||||
virtual void PageTableChanged(Common::PageTable& new_page_table,
|
||||
std::size_t new_address_space_size_in_bits) = 0;
|
||||
|
||||
/**
|
||||
* Set the Program Counter to an address
|
||||
* @param addr Address to set PC to
|
||||
*/
|
||||
virtual void SetPC(u64 addr) = 0;
|
||||
|
||||
/*
|
||||
* Get the current Program Counter
|
||||
* @return Returns current PC
|
||||
*/
|
||||
virtual u64 GetPC() const = 0;
|
||||
|
||||
/**
|
||||
* Get the current Stack Pointer
|
||||
* @return Returns current SP
|
||||
*/
|
||||
virtual u64 GetSP() const = 0;
|
||||
|
||||
/**
|
||||
* Get an ARM register
|
||||
* @param index Register index
|
||||
* @return Returns the value in the register
|
||||
*/
|
||||
virtual u64 GetReg(int index) const = 0;
|
||||
|
||||
/**
|
||||
* Set an ARM register
|
||||
* @param index Register index
|
||||
* @param value Value to set register to
|
||||
*/
|
||||
virtual void SetReg(int index, u64 value) = 0;
|
||||
|
||||
/**
|
||||
* Gets the value of a specified vector register.
|
||||
*
|
||||
* @param index The index of the vector register.
|
||||
* @return the value within the vector register.
|
||||
*/
|
||||
virtual u128 GetVectorReg(int index) const = 0;
|
||||
|
||||
/**
|
||||
* Sets a given value into a vector register.
|
||||
*
|
||||
* @param index The index of the vector register.
|
||||
* @param value The new value to place in the register.
|
||||
*/
|
||||
virtual void SetVectorReg(int index, u128 value) = 0;
|
||||
|
||||
/**
|
||||
* Get the current PSTATE register
|
||||
* @return Returns the value of the PSTATE register
|
||||
*/
|
||||
virtual u32 GetPSTATE() const = 0;
|
||||
|
||||
/**
|
||||
* Set the current PSTATE register
|
||||
* @param pstate Value to set PSTATE to
|
||||
*/
|
||||
virtual void SetPSTATE(u32 pstate) = 0;
|
||||
|
||||
virtual u64 GetTlsAddress() const = 0;
|
||||
|
||||
virtual void SetTlsAddress(u64 address) = 0;
|
||||
|
||||
/**
|
||||
* Gets the value within the TPIDR_EL0 (read/write software thread ID) register.
|
||||
*
|
||||
* @return the value within the register.
|
||||
*/
|
||||
virtual u64 GetTPIDR_EL0() const = 0;
|
||||
|
||||
/**
|
||||
* Sets a new value within the TPIDR_EL0 (read/write software thread ID) register.
|
||||
*
|
||||
* @param value The new value to place in the register.
|
||||
*/
|
||||
virtual void SetTPIDR_EL0(u64 value) = 0;
|
||||
|
||||
// Get the current architecture.
|
||||
// This returns AArch64 when PSTATE.nRW == 0 and AArch32 when PSTATE.nRW == 1.
|
||||
virtual Architecture GetArchitecture() const = 0;
|
||||
virtual void SaveContext(ThreadContext32& ctx) const = 0;
|
||||
virtual void SaveContext(ThreadContext64& ctx) const = 0;
|
||||
virtual void LoadContext(const ThreadContext32& ctx) = 0;
|
||||
virtual void LoadContext(const ThreadContext64& ctx) = 0;
|
||||
void LoadWatchpointArray(const WatchpointArray* wp);
|
||||
|
||||
/// Clears the exclusive monitor's state.
|
||||
virtual void ClearExclusiveState() = 0;
|
||||
// Context accessors.
|
||||
// These should not be called if the CPU is running.
|
||||
virtual void GetContext(Kernel::Svc::ThreadContext& ctx) const = 0;
|
||||
virtual void SetContext(const Kernel::Svc::ThreadContext& ctx) = 0;
|
||||
virtual void SetTpidrroEl0(u64 value) = 0;
|
||||
|
||||
/// Signal an interrupt and ask the core to halt as soon as possible.
|
||||
virtual void SignalInterrupt() = 0;
|
||||
virtual void GetSvcArguments(std::span<uint64_t, 8> args) const = 0;
|
||||
virtual void SetSvcArguments(std::span<const uint64_t, 8> args) = 0;
|
||||
virtual u32 GetSvcNumber() const = 0;
|
||||
|
||||
/// Clear a previous interrupt.
|
||||
virtual void ClearInterrupt() = 0;
|
||||
void SetWatchpointArray(const WatchpointArray* watchpoints) {
|
||||
m_watchpoints = watchpoints;
|
||||
}
|
||||
|
||||
struct BacktraceEntry {
|
||||
std::string module;
|
||||
u64 address;
|
||||
u64 original_address;
|
||||
u64 offset;
|
||||
std::string name;
|
||||
};
|
||||
// Signal an interrupt for execution to halt as soon as possible.
|
||||
// It is safe to call this if the CPU is not running.
|
||||
virtual void SignalInterrupt(Kernel::KThread* thread) = 0;
|
||||
|
||||
static std::vector<BacktraceEntry> GetBacktraceFromContext(System& system,
|
||||
const ThreadContext32& ctx);
|
||||
static std::vector<BacktraceEntry> GetBacktraceFromContext(System& system,
|
||||
const ThreadContext64& ctx);
|
||||
// Stack trace generation.
|
||||
void LogBacktrace(const Kernel::KProcess* process) const;
|
||||
|
||||
std::vector<BacktraceEntry> GetBacktrace() const;
|
||||
void LogBacktrace() const;
|
||||
// Debug functionality.
|
||||
virtual const Kernel::DebugWatchpoint* HaltedWatchpoint() const = 0;
|
||||
virtual void RewindBreakpointInstruction() = 0;
|
||||
|
||||
protected:
|
||||
/// System context that this ARM interface is running under.
|
||||
System& system;
|
||||
const WatchpointArray* watchpoints;
|
||||
bool uses_wall_clock;
|
||||
|
||||
static void SymbolicateBacktrace(Core::System& system, std::vector<BacktraceEntry>& out);
|
||||
const Kernel::DebugWatchpoint* MatchingWatchpoint(
|
||||
u64 addr, u64 size, Kernel::DebugWatchpointType access_type) const;
|
||||
|
||||
virtual HaltReason RunJit() = 0;
|
||||
virtual HaltReason StepJit() = 0;
|
||||
virtual u32 GetSvcNumber() const = 0;
|
||||
virtual const Kernel::DebugWatchpoint* HaltedWatchpoint() const = 0;
|
||||
virtual void RewindBreakpointInstruction() = 0;
|
||||
protected:
|
||||
const WatchpointArray* m_watchpoints{};
|
||||
bool m_uses_wall_clock{};
|
||||
};
|
||||
|
||||
} // namespace Core
|
||||
|
|
|
@ -0,0 +1,351 @@
|
|||
// SPDX-FileCopyrightText: Copyright 2023 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
#include "common/demangle.h"
|
||||
#include "core/arm/debug.h"
|
||||
#include "core/arm/symbols.h"
|
||||
#include "core/hle/kernel/k_process.h"
|
||||
#include "core/hle/kernel/k_thread.h"
|
||||
#include "core/memory.h"
|
||||
|
||||
namespace Core {
|
||||
|
||||
namespace {
|
||||
|
||||
std::optional<std::string> GetNameFromThreadType64(Core::Memory::Memory& memory,
|
||||
const Kernel::KThread& thread) {
|
||||
// Read thread type from TLS
|
||||
const VAddr tls_thread_type{memory.Read64(thread.GetTlsAddress() + 0x1f8)};
|
||||
const VAddr argument_thread_type{thread.GetArgument()};
|
||||
|
||||
if (argument_thread_type && tls_thread_type != argument_thread_type) {
|
||||
// Probably not created by nnsdk, no name available.
|
||||
return std::nullopt;
|
||||
}
|
||||
|
||||
if (!tls_thread_type) {
|
||||
return std::nullopt;
|
||||
}
|
||||
|
||||
const u16 version{memory.Read16(tls_thread_type + 0x46)};
|
||||
VAddr name_pointer{};
|
||||
if (version == 1) {
|
||||
name_pointer = memory.Read64(tls_thread_type + 0x1a0);
|
||||
} else {
|
||||
name_pointer = memory.Read64(tls_thread_type + 0x1a8);
|
||||
}
|
||||
|
||||
if (!name_pointer) {
|
||||
// No name provided.
|
||||
return std::nullopt;
|
||||
}
|
||||
|
||||
return memory.ReadCString(name_pointer, 256);
|
||||
}
|
||||
|
||||
std::optional<std::string> GetNameFromThreadType32(Core::Memory::Memory& memory,
|
||||
const Kernel::KThread& thread) {
|
||||
// Read thread type from TLS
|
||||
const VAddr tls_thread_type{memory.Read32(thread.GetTlsAddress() + 0x1fc)};
|
||||
const VAddr argument_thread_type{thread.GetArgument()};
|
||||
|
||||
if (argument_thread_type && tls_thread_type != argument_thread_type) {
|
||||
// Probably not created by nnsdk, no name available.
|
||||
return std::nullopt;
|
||||
}
|
||||
|
||||
if (!tls_thread_type) {
|
||||
return std::nullopt;
|
||||
}
|
||||
|
||||
const u16 version{memory.Read16(tls_thread_type + 0x26)};
|
||||
VAddr name_pointer{};
|
||||
if (version == 1) {
|
||||
name_pointer = memory.Read32(tls_thread_type + 0xe4);
|
||||
} else {
|
||||
name_pointer = memory.Read32(tls_thread_type + 0xe8);
|
||||
}
|
||||
|
||||
if (!name_pointer) {
|
||||
// No name provided.
|
||||
return std::nullopt;
|
||||
}
|
||||
|
||||
return memory.ReadCString(name_pointer, 256);
|
||||
}
|
||||
|
||||
constexpr std::array<u64, 2> SegmentBases{
|
||||
0x60000000ULL,
|
||||
0x7100000000ULL,
|
||||
};
|
||||
|
||||
void SymbolicateBacktrace(const Kernel::KProcess* process, std::vector<BacktraceEntry>& out) {
|
||||
auto modules = FindModules(process);
|
||||
|
||||
const bool is_64 = process->Is64Bit();
|
||||
|
||||
std::map<std::string, Symbols::Symbols> symbols;
|
||||
for (const auto& module : modules) {
|
||||
symbols.insert_or_assign(module.second,
|
||||
Symbols::GetSymbols(module.first, process->GetMemory(), is_64));
|
||||
}
|
||||
|
||||
for (auto& entry : out) {
|
||||
VAddr base = 0;
|
||||
for (auto iter = modules.rbegin(); iter != modules.rend(); ++iter) {
|
||||
const auto& module{*iter};
|
||||
if (entry.original_address >= module.first) {
|
||||
entry.module = module.second;
|
||||
base = module.first;
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
entry.offset = entry.original_address - base;
|
||||
entry.address = SegmentBases[is_64] + entry.offset;
|
||||
|
||||
if (entry.module.empty()) {
|
||||
entry.module = "unknown";
|
||||
}
|
||||
|
||||
const auto symbol_set = symbols.find(entry.module);
|
||||
if (symbol_set != symbols.end()) {
|
||||
const auto symbol = Symbols::GetSymbolName(symbol_set->second, entry.offset);
|
||||
if (symbol) {
|
||||
entry.name = Common::DemangleSymbol(*symbol);
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
std::vector<BacktraceEntry> GetAArch64Backtrace(const Kernel::KProcess* process,
|
||||
const Kernel::Svc::ThreadContext& ctx) {
|
||||
std::vector<BacktraceEntry> out;
|
||||
auto& memory = process->GetMemory();
|
||||
auto pc = ctx.pc, lr = ctx.lr, fp = ctx.fp;
|
||||
|
||||
out.push_back({"", 0, pc, 0, ""});
|
||||
|
||||
// fp (= x29) points to the previous frame record.
|
||||
// Frame records are two words long:
|
||||
// fp+0 : pointer to previous frame record
|
||||
// fp+8 : value of lr for frame
|
||||
for (size_t i = 0; i < 256; i++) {
|
||||
out.push_back({"", 0, lr, 0, ""});
|
||||
if (!fp || (fp % 4 != 0) || !memory.IsValidVirtualAddressRange(fp, 16)) {
|
||||
break;
|
||||
}
|
||||
lr = memory.Read64(fp + 8);
|
||||
fp = memory.Read64(fp);
|
||||
}
|
||||
|
||||
SymbolicateBacktrace(process, out);
|
||||
|
||||
return out;
|
||||
}
|
||||
|
||||
std::vector<BacktraceEntry> GetAArch32Backtrace(const Kernel::KProcess* process,
|
||||
const Kernel::Svc::ThreadContext& ctx) {
|
||||
std::vector<BacktraceEntry> out;
|
||||
auto& memory = process->GetMemory();
|
||||
auto pc = ctx.pc, lr = ctx.lr, fp = ctx.fp;
|
||||
|
||||
out.push_back({"", 0, pc, 0, ""});
|
||||
|
||||
// fp (= r11) points to the last frame record.
|
||||
// Frame records are two words long:
|
||||
// fp+0 : pointer to previous frame record
|
||||
// fp+4 : value of lr for frame
|
||||
for (size_t i = 0; i < 256; i++) {
|
||||
out.push_back({"", 0, lr, 0, ""});
|
||||
if (!fp || (fp % 4 != 0) || !memory.IsValidVirtualAddressRange(fp, 8)) {
|
||||
break;
|
||||
}
|
||||
lr = memory.Read32(fp + 4);
|
||||
fp = memory.Read32(fp);
|
||||
}
|
||||
|
||||
SymbolicateBacktrace(process, out);
|
||||
|
||||
return out;
|
||||
}
|
||||
|
||||
} // namespace
|
||||
|
||||
std::optional<std::string> GetThreadName(const Kernel::KThread* thread) {
|
||||
const auto* process = thread->GetOwnerProcess();
|
||||
if (process->Is64Bit()) {
|
||||
return GetNameFromThreadType64(process->GetMemory(), *thread);
|
||||
} else {
|
||||
return GetNameFromThreadType32(process->GetMemory(), *thread);
|
||||
}
|
||||
}
|
||||
|
||||
std::string_view GetThreadWaitReason(const Kernel::KThread* thread) {
|
||||
switch (thread->GetWaitReasonForDebugging()) {
|
||||
case Kernel::ThreadWaitReasonForDebugging::Sleep:
|
||||
return "Sleep";
|
||||
case Kernel::ThreadWaitReasonForDebugging::IPC:
|
||||
return "IPC";
|
||||
case Kernel::ThreadWaitReasonForDebugging::Synchronization:
|
||||
return "Synchronization";
|
||||
case Kernel::ThreadWaitReasonForDebugging::ConditionVar:
|
||||
return "ConditionVar";
|
||||
case Kernel::ThreadWaitReasonForDebugging::Arbitration:
|
||||
return "Arbitration";
|
||||
case Kernel::ThreadWaitReasonForDebugging::Suspended:
|
||||
return "Suspended";
|
||||
default:
|
||||
return "Unknown";
|
||||
}
|
||||
}
|
||||
|
||||
std::string GetThreadState(const Kernel::KThread* thread) {
|
||||
switch (thread->GetState()) {
|
||||
case Kernel::ThreadState::Initialized:
|
||||
return "Initialized";
|
||||
case Kernel::ThreadState::Waiting:
|
||||
return fmt::format("Waiting ({})", GetThreadWaitReason(thread));
|
||||
case Kernel::ThreadState::Runnable:
|
||||
return "Runnable";
|
||||
case Kernel::ThreadState::Terminated:
|
||||
return "Terminated";
|
||||
default:
|
||||
return "Unknown";
|
||||
}
|
||||
}
|
||||
|
||||
Kernel::KProcessAddress GetModuleEnd(const Kernel::KProcess* process,
|
||||
Kernel::KProcessAddress base) {
|
||||
Kernel::KMemoryInfo mem_info;
|
||||
Kernel::Svc::MemoryInfo svc_mem_info;
|
||||
Kernel::Svc::PageInfo page_info;
|
||||
VAddr cur_addr{GetInteger(base)};
|
||||
auto& page_table = process->GetPageTable();
|
||||
|
||||
// Expect: r-x Code (.text)
|
||||
R_ASSERT(page_table.QueryInfo(std::addressof(mem_info), std::addressof(page_info), cur_addr));
|
||||
svc_mem_info = mem_info.GetSvcMemoryInfo();
|
||||
cur_addr = svc_mem_info.base_address + svc_mem_info.size;
|
||||
if (svc_mem_info.state != Kernel::Svc::MemoryState::Code ||
|
||||
svc_mem_info.permission != Kernel::Svc::MemoryPermission::ReadExecute) {
|
||||
return cur_addr - 1;
|
||||
}
|
||||
|
||||
// Expect: r-- Code (.rodata)
|
||||
R_ASSERT(page_table.QueryInfo(std::addressof(mem_info), std::addressof(page_info), cur_addr));
|
||||
svc_mem_info = mem_info.GetSvcMemoryInfo();
|
||||
cur_addr = svc_mem_info.base_address + svc_mem_info.size;
|
||||
if (svc_mem_info.state != Kernel::Svc::MemoryState::Code ||
|
||||
svc_mem_info.permission != Kernel::Svc::MemoryPermission::Read) {
|
||||
return cur_addr - 1;
|
||||
}
|
||||
|
||||
// Expect: rw- CodeData (.data)
|
||||
R_ASSERT(page_table.QueryInfo(std::addressof(mem_info), std::addressof(page_info), cur_addr));
|
||||
svc_mem_info = mem_info.GetSvcMemoryInfo();
|
||||
cur_addr = svc_mem_info.base_address + svc_mem_info.size;
|
||||
return cur_addr - 1;
|
||||
}
|
||||
|
||||
Loader::AppLoader::Modules FindModules(const Kernel::KProcess* process) {
|
||||
Loader::AppLoader::Modules modules;
|
||||
|
||||
auto& page_table = process->GetPageTable();
|
||||
auto& memory = process->GetMemory();
|
||||
VAddr cur_addr = 0;
|
||||
|
||||
// Look for executable sections in Code or AliasCode regions.
|
||||
while (true) {
|
||||
Kernel::KMemoryInfo mem_info{};
|
||||
Kernel::Svc::PageInfo page_info{};
|
||||
R_ASSERT(
|
||||
page_table.QueryInfo(std::addressof(mem_info), std::addressof(page_info), cur_addr));
|
||||
auto svc_mem_info = mem_info.GetSvcMemoryInfo();
|
||||
|
||||
if (svc_mem_info.permission == Kernel::Svc::MemoryPermission::ReadExecute &&
|
||||
(svc_mem_info.state == Kernel::Svc::MemoryState::Code ||
|
||||
svc_mem_info.state == Kernel::Svc::MemoryState::AliasCode)) {
|
||||
// Try to read the module name from its path.
|
||||
constexpr s32 PathLengthMax = 0x200;
|
||||
struct {
|
||||
u32 zero;
|
||||
s32 path_length;
|
||||
std::array<char, PathLengthMax> path;
|
||||
} module_path;
|
||||
|
||||
if (memory.ReadBlock(svc_mem_info.base_address + svc_mem_info.size, &module_path,
|
||||
sizeof(module_path))) {
|
||||
if (module_path.zero == 0 && module_path.path_length > 0) {
|
||||
// Truncate module name.
|
||||
module_path.path[PathLengthMax - 1] = '\0';
|
||||
|
||||
// Ignore leading directories.
|
||||
char* path_pointer = module_path.path.data();
|
||||
|
||||
for (s32 i = 0; i < std::min(PathLengthMax, module_path.path_length) &&
|
||||
module_path.path[i] != '\0';
|
||||
i++) {
|
||||
if (module_path.path[i] == '/' || module_path.path[i] == '\\') {
|
||||
path_pointer = module_path.path.data() + i + 1;
|
||||
}
|
||||
}
|
||||
|
||||
// Insert output.
|
||||
modules.emplace(svc_mem_info.base_address, path_pointer);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Check if we're done.
|
||||
const uintptr_t next_address = svc_mem_info.base_address + svc_mem_info.size;
|
||||
if (next_address <= cur_addr) {
|
||||
break;
|
||||
}
|
||||
|
||||
cur_addr = next_address;
|
||||
}
|
||||
|
||||
return modules;
|
||||
}
|
||||
|
||||
Kernel::KProcessAddress FindMainModuleEntrypoint(const Kernel::KProcess* process) {
|
||||
// Do we have any loaded executable sections?
|
||||
auto modules = FindModules(process);
|
||||
|
||||
if (modules.size() >= 2) {
|
||||
// If we have two or more, the first one is rtld and the second is main.
|
||||
return std::next(modules.begin())->first;
|
||||
} else if (!modules.empty()) {
|
||||
// If we only have one, this is the main module.
|
||||
return modules.begin()->first;
|
||||
}
|
||||
|
||||
// As a last resort, use the start of the code region.
|
||||
return GetInteger(process->GetPageTable().GetCodeRegionStart());
|
||||
}
|
||||
|
||||
void InvalidateInstructionCacheRange(const Kernel::KProcess* process, u64 address, u64 size) {
|
||||
for (size_t i = 0; i < Core::Hardware::NUM_CPU_CORES; i++) {
|
||||
auto* interface = process->GetArmInterface(i);
|
||||
if (interface) {
|
||||
interface->InvalidateCacheRange(address, size);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
std::vector<BacktraceEntry> GetBacktraceFromContext(const Kernel::KProcess* process,
|
||||
const Kernel::Svc::ThreadContext& ctx) {
|
||||
if (process->Is64Bit()) {
|
||||
return GetAArch64Backtrace(process, ctx);
|
||||
} else {
|
||||
return GetAArch32Backtrace(process, ctx);
|
||||
}
|
||||
}
|
||||
|
||||
std::vector<BacktraceEntry> GetBacktrace(const Kernel::KThread* thread) {
|
||||
Kernel::Svc::ThreadContext ctx = thread->GetContext();
|
||||
return GetBacktraceFromContext(thread->GetOwnerProcess(), ctx);
|
||||
}
|
||||
|
||||
} // namespace Core
|
|
@ -0,0 +1,35 @@
|
|||
// SPDX-FileCopyrightText: Copyright 2023 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
#pragma once
|
||||
|
||||
#include <optional>
|
||||
|
||||
#include "core/hle/kernel/k_thread.h"
|
||||
#include "core/loader/loader.h"
|
||||
|
||||
namespace Core {
|
||||
|
||||
std::optional<std::string> GetThreadName(const Kernel::KThread* thread);
|
||||
std::string_view GetThreadWaitReason(const Kernel::KThread* thread);
|
||||
std::string GetThreadState(const Kernel::KThread* thread);
|
||||
|
||||
Loader::AppLoader::Modules FindModules(const Kernel::KProcess* process);
|
||||
Kernel::KProcessAddress GetModuleEnd(const Kernel::KProcess* process, Kernel::KProcessAddress base);
|
||||
Kernel::KProcessAddress FindMainModuleEntrypoint(const Kernel::KProcess* process);
|
||||
|
||||
void InvalidateInstructionCacheRange(const Kernel::KProcess* process, u64 address, u64 size);
|
||||
|
||||
struct BacktraceEntry {
|
||||
std::string module;
|
||||
u64 address;
|
||||
u64 original_address;
|
||||
u64 offset;
|
||||
std::string name;
|
||||
};
|
||||
|
||||
std::vector<BacktraceEntry> GetBacktraceFromContext(const Kernel::KProcess* process,
|
||||
const Kernel::Svc::ThreadContext& ctx);
|
||||
std::vector<BacktraceEntry> GetBacktrace(const Kernel::KThread* thread);
|
||||
|
||||
} // namespace Core
|
|
@ -1,25 +1,13 @@
|
|||
// SPDX-FileCopyrightText: Copyright 2020 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
#include <cinttypes>
|
||||
#include <memory>
|
||||
#include <dynarmic/interface/A32/a32.h>
|
||||
#include <dynarmic/interface/A32/config.h>
|
||||
#include "common/assert.h"
|
||||
#include "common/literals.h"
|
||||
#include "common/logging/log.h"
|
||||
#include "common/page_table.h"
|
||||
#include "common/settings.h"
|
||||
#include "core/arm/dynarmic/arm_dynarmic.h"
|
||||
#include "core/arm/dynarmic/arm_dynarmic_32.h"
|
||||
#include "core/arm/dynarmic/dynarmic_cp15.h"
|
||||
#include "core/arm/dynarmic/dynarmic_exclusive_monitor.h"
|
||||
#include "core/core.h"
|
||||
#include "core/core_timing.h"
|
||||
#include "core/debugger/debugger.h"
|
||||
#include "core/hle/kernel/k_process.h"
|
||||
#include "core/hle/kernel/svc.h"
|
||||
#include "core/memory.h"
|
||||
|
||||
namespace Core {
|
||||
|
||||
|
@ -27,78 +15,78 @@ using namespace Common::Literals;
|
|||
|
||||
class DynarmicCallbacks32 : public Dynarmic::A32::UserCallbacks {
|
||||
public:
|
||||
explicit DynarmicCallbacks32(ARM_Dynarmic_32& parent_)
|
||||
: parent{parent_}, memory(parent.system.ApplicationMemory()),
|
||||
debugger_enabled{parent.system.DebuggerEnabled()},
|
||||
check_memory_access{debugger_enabled ||
|
||||
explicit DynarmicCallbacks32(ArmDynarmic32& parent, const Kernel::KProcess* process)
|
||||
: m_parent{parent}, m_memory(process->GetMemory()),
|
||||
m_process(process), m_debugger_enabled{parent.m_system.DebuggerEnabled()},
|
||||
m_check_memory_access{m_debugger_enabled ||
|
||||
!Settings::values.cpuopt_ignore_memory_aborts.GetValue()} {}
|
||||
|
||||
u8 MemoryRead8(u32 vaddr) override {
|
||||
CheckMemoryAccess(vaddr, 1, Kernel::DebugWatchpointType::Read);
|
||||
return memory.Read8(vaddr);
|
||||
return m_memory.Read8(vaddr);
|
||||
}
|
||||
u16 MemoryRead16(u32 vaddr) override {
|
||||
CheckMemoryAccess(vaddr, 2, Kernel::DebugWatchpointType::Read);
|
||||
return memory.Read16(vaddr);
|
||||
return m_memory.Read16(vaddr);
|
||||
}
|
||||
u32 MemoryRead32(u32 vaddr) override {
|
||||
CheckMemoryAccess(vaddr, 4, Kernel::DebugWatchpointType::Read);
|
||||
return memory.Read32(vaddr);
|
||||
return m_memory.Read32(vaddr);
|
||||
}
|
||||
u64 MemoryRead64(u32 vaddr) override {
|
||||
CheckMemoryAccess(vaddr, 8, Kernel::DebugWatchpointType::Read);
|
||||
return memory.Read64(vaddr);
|
||||
return m_memory.Read64(vaddr);
|
||||
}
|
||||
std::optional<u32> MemoryReadCode(u32 vaddr) override {
|
||||
if (!memory.IsValidVirtualAddressRange(vaddr, sizeof(u32))) {
|
||||
if (!m_memory.IsValidVirtualAddressRange(vaddr, sizeof(u32))) {
|
||||
return std::nullopt;
|
||||
}
|
||||
return memory.Read32(vaddr);
|
||||
return m_memory.Read32(vaddr);
|
||||
}
|
||||
|
||||
void MemoryWrite8(u32 vaddr, u8 value) override {
|
||||
if (CheckMemoryAccess(vaddr, 1, Kernel::DebugWatchpointType::Write)) {
|
||||
memory.Write8(vaddr, value);
|
||||
m_memory.Write8(vaddr, value);
|
||||
}
|
||||
}
|
||||
void MemoryWrite16(u32 vaddr, u16 value) override {
|
||||
if (CheckMemoryAccess(vaddr, 2, Kernel::DebugWatchpointType::Write)) {
|
||||
memory.Write16(vaddr, value);
|
||||
m_memory.Write16(vaddr, value);
|
||||
}
|
||||
}
|
||||
void MemoryWrite32(u32 vaddr, u32 value) override {
|
||||
if (CheckMemoryAccess(vaddr, 4, Kernel::DebugWatchpointType::Write)) {
|
||||
memory.Write32(vaddr, value);
|
||||
m_memory.Write32(vaddr, value);
|
||||
}
|
||||
}
|
||||
void MemoryWrite64(u32 vaddr, u64 value) override {
|
||||
if (CheckMemoryAccess(vaddr, 8, Kernel::DebugWatchpointType::Write)) {
|
||||
memory.Write64(vaddr, value);
|
||||
m_memory.Write64(vaddr, value);
|
||||
}
|
||||
}
|
||||
|
||||
bool MemoryWriteExclusive8(u32 vaddr, u8 value, u8 expected) override {
|
||||
return CheckMemoryAccess(vaddr, 1, Kernel::DebugWatchpointType::Write) &&
|
||||
memory.WriteExclusive8(vaddr, value, expected);
|
||||
m_memory.WriteExclusive8(vaddr, value, expected);
|
||||
}
|
||||
bool MemoryWriteExclusive16(u32 vaddr, u16 value, u16 expected) override {
|
||||
return CheckMemoryAccess(vaddr, 2, Kernel::DebugWatchpointType::Write) &&
|
||||
memory.WriteExclusive16(vaddr, value, expected);
|
||||
m_memory.WriteExclusive16(vaddr, value, expected);
|
||||
}
|
||||
bool MemoryWriteExclusive32(u32 vaddr, u32 value, u32 expected) override {
|
||||
return CheckMemoryAccess(vaddr, 4, Kernel::DebugWatchpointType::Write) &&
|
||||
memory.WriteExclusive32(vaddr, value, expected);
|
||||
m_memory.WriteExclusive32(vaddr, value, expected);
|
||||
}
|
||||
bool MemoryWriteExclusive64(u32 vaddr, u64 value, u64 expected) override {
|
||||
return CheckMemoryAccess(vaddr, 8, Kernel::DebugWatchpointType::Write) &&
|
||||
memory.WriteExclusive64(vaddr, value, expected);
|
||||
m_memory.WriteExclusive64(vaddr, value, expected);
|
||||
}
|
||||
|
||||
void InterpreterFallback(u32 pc, std::size_t num_instructions) override {
|
||||
parent.LogBacktrace();
|
||||
m_parent.LogBacktrace(m_process);
|
||||
LOG_ERROR(Core_ARM,
|
||||
"Unimplemented instruction @ 0x{:X} for {} instructions (instr = {:08X})", pc,
|
||||
num_instructions, memory.Read32(pc));
|
||||
num_instructions, m_memory.Read32(pc));
|
||||
}
|
||||
|
||||
void ExceptionRaised(u32 pc, Dynarmic::A32::Exception exception) override {
|
||||
|
@ -108,73 +96,64 @@ public:
|
|||
ReturnException(pc, PrefetchAbort);
|
||||
return;
|
||||
default:
|
||||
if (debugger_enabled) {
|
||||
if (m_debugger_enabled) {
|
||||
ReturnException(pc, InstructionBreakpoint);
|
||||
return;
|
||||
}
|
||||
|
||||
parent.LogBacktrace();
|
||||
m_parent.LogBacktrace(m_process);
|
||||
LOG_CRITICAL(Core_ARM,
|
||||
"ExceptionRaised(exception = {}, pc = {:08X}, code = {:08X}, thumb = {})",
|
||||
exception, pc, memory.Read32(pc), parent.IsInThumbMode());
|
||||
exception, pc, m_memory.Read32(pc), m_parent.IsInThumbMode());
|
||||
}
|
||||
}
|
||||
|
||||
void CallSVC(u32 swi) override {
|
||||
parent.svc_swi = swi;
|
||||
parent.jit.load()->HaltExecution(SupervisorCall);
|
||||
m_parent.m_svc_swi = swi;
|
||||
m_parent.m_jit->HaltExecution(SupervisorCall);
|
||||
}
|
||||
|
||||
void AddTicks(u64 ticks) override {
|
||||
if (parent.uses_wall_clock) {
|
||||
return;
|
||||
}
|
||||
ASSERT_MSG(!m_parent.m_uses_wall_clock, "Dynarmic ticking disabled");
|
||||
|
||||
// Divide the number of ticks by the amount of CPU cores. TODO(Subv): This yields only a
|
||||
// rough approximation of the amount of executed ticks in the system, it may be thrown off
|
||||
// if not all cores are doing a similar amount of work. Instead of doing this, we should
|
||||
// device a way so that timing is consistent across all cores without increasing the ticks 4
|
||||
// times.
|
||||
u64 amortized_ticks =
|
||||
(ticks - num_interpreted_instructions) / Core::Hardware::NUM_CPU_CORES;
|
||||
u64 amortized_ticks = ticks / Core::Hardware::NUM_CPU_CORES;
|
||||
// Always execute at least one tick.
|
||||
amortized_ticks = std::max<u64>(amortized_ticks, 1);
|
||||
|
||||
parent.system.CoreTiming().AddTicks(amortized_ticks);
|
||||
num_interpreted_instructions = 0;
|
||||
m_parent.m_system.CoreTiming().AddTicks(amortized_ticks);
|
||||
}
|
||||
|
||||
u64 GetTicksRemaining() override {
|
||||
if (parent.uses_wall_clock) {
|
||||
if (!IsInterrupted()) {
|
||||
return minimum_run_cycles;
|
||||
}
|
||||
return 0U;
|
||||
}
|
||||
ASSERT_MSG(!m_parent.m_uses_wall_clock, "Dynarmic ticking disabled");
|
||||
|
||||
return std::max<s64>(parent.system.CoreTiming().GetDowncount(), 0);
|
||||
return std::max<s64>(m_parent.m_system.CoreTiming().GetDowncount(), 0);
|
||||
}
|
||||
|
||||
bool CheckMemoryAccess(u64 addr, u64 size, Kernel::DebugWatchpointType type) {
|
||||
if (!check_memory_access) {
|
||||
if (!m_check_memory_access) {
|
||||
return true;
|
||||
}
|
||||
|
||||
if (!memory.IsValidVirtualAddressRange(addr, size)) {
|
||||
if (!m_memory.IsValidVirtualAddressRange(addr, size)) {
|
||||
LOG_CRITICAL(Core_ARM, "Stopping execution due to unmapped memory access at {:#x}",
|
||||
addr);
|
||||
parent.jit.load()->HaltExecution(PrefetchAbort);
|
||||
m_parent.m_jit->HaltExecution(PrefetchAbort);
|
||||
return false;
|
||||
}
|
||||
|
||||
if (!debugger_enabled) {
|
||||
if (!m_debugger_enabled) {
|
||||
return true;
|
||||
}
|
||||
|
||||
const auto match{parent.MatchingWatchpoint(addr, size, type)};
|
||||
const auto match{m_parent.MatchingWatchpoint(addr, size, type)};
|
||||
if (match) {
|
||||
parent.halted_watchpoint = match;
|
||||
parent.jit.load()->HaltExecution(DataAbort);
|
||||
m_parent.m_halted_watchpoint = match;
|
||||
m_parent.m_jit->HaltExecution(DataAbort);
|
||||
return false;
|
||||
}
|
||||
|
||||
|
@ -182,32 +161,31 @@ public:
|
|||
}
|
||||
|
||||
void ReturnException(u32 pc, Dynarmic::HaltReason hr) {
|
||||
parent.SaveContext(parent.breakpoint_context);
|
||||
parent.breakpoint_context.cpu_registers[15] = pc;
|
||||
parent.jit.load()->HaltExecution(hr);
|
||||
m_parent.GetContext(m_parent.m_breakpoint_context);
|
||||
m_parent.m_breakpoint_context.pc = pc;
|
||||
m_parent.m_breakpoint_context.r[15] = pc;
|
||||
m_parent.m_jit->HaltExecution(hr);
|
||||
}
|
||||
|
||||
bool IsInterrupted() {
|
||||
return parent.system.Kernel().PhysicalCore(parent.core_index).IsInterrupted();
|
||||
}
|
||||
|
||||
ARM_Dynarmic_32& parent;
|
||||
Core::Memory::Memory& memory;
|
||||
std::size_t num_interpreted_instructions{};
|
||||
const bool debugger_enabled{};
|
||||
const bool check_memory_access{};
|
||||
static constexpr u64 minimum_run_cycles = 10000U;
|
||||
ArmDynarmic32& m_parent;
|
||||
Core::Memory::Memory& m_memory;
|
||||
const Kernel::KProcess* m_process{};
|
||||
const bool m_debugger_enabled{};
|
||||
const bool m_check_memory_access{};
|
||||
static constexpr u64 MinimumRunCycles = 10000U;
|
||||
};
|
||||
|
||||
std::shared_ptr<Dynarmic::A32::Jit> ARM_Dynarmic_32::MakeJit(Common::PageTable* page_table) const {
|
||||
std::shared_ptr<Dynarmic::A32::Jit> ArmDynarmic32::MakeJit(Common::PageTable* page_table) const {
|
||||
Dynarmic::A32::UserConfig config;
|
||||
config.callbacks = cb.get();
|
||||
config.coprocessors[15] = cp15;
|
||||
config.callbacks = m_cb.get();
|
||||
config.coprocessors[15] = m_cp15;
|
||||
config.define_unpredictable_behaviour = true;
|
||||
static constexpr std::size_t YUZU_PAGEBITS = 12;
|
||||
static constexpr std::size_t NUM_PAGE_TABLE_ENTRIES = 1 << (32 - YUZU_PAGEBITS);
|
||||
|
||||
if (page_table) {
|
||||
config.page_table = reinterpret_cast<std::array<std::uint8_t*, NUM_PAGE_TABLE_ENTRIES>*>(
|
||||
constexpr size_t PageBits = 12;
|
||||
constexpr size_t NumPageTableEntries = 1 << (32 - PageBits);
|
||||
|
||||
config.page_table = reinterpret_cast<std::array<std::uint8_t*, NumPageTableEntries>*>(
|
||||
page_table->pointers.data());
|
||||
config.absolute_offset_page_table = true;
|
||||
config.page_table_pointer_mask_bits = Common::PageTable::ATTRIBUTE_BITS;
|
||||
|
@ -221,12 +199,12 @@ std::shared_ptr<Dynarmic::A32::Jit> ARM_Dynarmic_32::MakeJit(Common::PageTable*
|
|||
}
|
||||
|
||||
// Multi-process state
|
||||
config.processor_id = core_index;
|
||||
config.global_monitor = &exclusive_monitor.monitor;
|
||||
config.processor_id = m_core_index;
|
||||
config.global_monitor = &m_exclusive_monitor.monitor;
|
||||
|
||||
// Timing
|
||||
config.wall_clock_cntpct = uses_wall_clock;
|
||||
config.enable_cycle_counting = true;
|
||||
config.wall_clock_cntpct = m_uses_wall_clock;
|
||||
config.enable_cycle_counting = !m_uses_wall_clock;
|
||||
|
||||
// Code cache size
|
||||
#ifdef ARCHITECTURE_arm64
|
||||
|
@ -236,7 +214,7 @@ std::shared_ptr<Dynarmic::A32::Jit> ARM_Dynarmic_32::MakeJit(Common::PageTable*
|
|||
#endif
|
||||
|
||||
// Allow memory fault handling to work
|
||||
if (system.DebuggerEnabled()) {
|
||||
if (m_system.DebuggerEnabled()) {
|
||||
config.check_halt_on_memory_access = true;
|
||||
}
|
||||
|
||||
|
@ -325,137 +303,140 @@ std::shared_ptr<Dynarmic::A32::Jit> ARM_Dynarmic_32::MakeJit(Common::PageTable*
|
|||
return std::make_unique<Dynarmic::A32::Jit>(config);
|
||||
}
|
||||
|
||||
HaltReason ARM_Dynarmic_32::RunJit() {
|
||||
return TranslateHaltReason(jit.load()->Run());
|
||||
static std::pair<u32, u32> FpscrToFpsrFpcr(u32 fpscr) {
|
||||
// FPSCR bits [31:27] are mapped to FPSR[31:27].
|
||||
// FPSCR bit [7] is mapped to FPSR[7].
|
||||
// FPSCR bits [4:0] are mapped to FPSR[4:0].
|
||||
const u32 nzcv = fpscr & 0xf8000000;
|
||||
const u32 idc = fpscr & 0x80;
|
||||
const u32 fiq = fpscr & 0x1f;
|
||||
const u32 fpsr = nzcv | idc | fiq;
|
||||
|
||||
// FPSCR bits [26:15] are mapped to FPCR[26:15].
|
||||
// FPSCR bits [12:8] are mapped to FPCR[12:8].
|
||||
const u32 round = fpscr & 0x7ff8000;
|
||||
const u32 trap = fpscr & 0x1f00;
|
||||
const u32 fpcr = round | trap;
|
||||
|
||||
return {fpsr, fpcr};
|
||||
}
|
||||
|
||||
HaltReason ARM_Dynarmic_32::StepJit() {
|
||||
return TranslateHaltReason(jit.load()->Step());
|
||||
static u32 FpsrFpcrToFpscr(u64 fpsr, u64 fpcr) {
|
||||
auto [s, c] = FpscrToFpsrFpcr(static_cast<u32>(fpsr | fpcr));
|
||||
return s | c;
|
||||
}
|
||||
|
||||
u32 ARM_Dynarmic_32::GetSvcNumber() const {
|
||||
return svc_swi;
|
||||
bool ArmDynarmic32::IsInThumbMode() const {
|
||||
return (m_jit->Cpsr() & 0x20) != 0;
|
||||
}
|
||||
|
||||
const Kernel::DebugWatchpoint* ARM_Dynarmic_32::HaltedWatchpoint() const {
|
||||
return halted_watchpoint;
|
||||
HaltReason ArmDynarmic32::RunThread(Kernel::KThread* thread) {
|
||||
m_jit->ClearExclusiveState();
|
||||
return TranslateHaltReason(m_jit->Run());
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_32::RewindBreakpointInstruction() {
|
||||
LoadContext(breakpoint_context);
|
||||
HaltReason ArmDynarmic32::StepThread(Kernel::KThread* thread) {
|
||||
m_jit->ClearExclusiveState();
|
||||
return TranslateHaltReason(m_jit->Step());
|
||||
}
|
||||
|
||||
ARM_Dynarmic_32::ARM_Dynarmic_32(System& system_, bool uses_wall_clock_,
|
||||
DynarmicExclusiveMonitor& exclusive_monitor_,
|
||||
std::size_t core_index_)
|
||||
: ARM_Interface{system_, uses_wall_clock_}, cb(std::make_unique<DynarmicCallbacks32>(*this)),
|
||||
cp15(std::make_shared<DynarmicCP15>(*this)), core_index{core_index_},
|
||||
exclusive_monitor{exclusive_monitor_}, null_jit{MakeJit(nullptr)}, jit{null_jit.get()} {}
|
||||
|
||||
ARM_Dynarmic_32::~ARM_Dynarmic_32() = default;
|
||||
|
||||
void ARM_Dynarmic_32::SetPC(u64 pc) {
|
||||
jit.load()->Regs()[15] = static_cast<u32>(pc);
|
||||
u32 ArmDynarmic32::GetSvcNumber() const {
|
||||
return m_svc_swi;
|
||||
}
|
||||
|
||||
u64 ARM_Dynarmic_32::GetPC() const {
|
||||
return jit.load()->Regs()[15];
|
||||
}
|
||||
void ArmDynarmic32::GetSvcArguments(std::span<uint64_t, 8> args) const {
|
||||
Dynarmic::A32::Jit& j = *m_jit;
|
||||
auto& gpr = j.Regs();
|
||||
|
||||
u64 ARM_Dynarmic_32::GetSP() const {
|
||||
return jit.load()->Regs()[13];
|
||||
}
|
||||
|
||||
u64 ARM_Dynarmic_32::GetReg(int index) const {
|
||||
return jit.load()->Regs()[index];
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_32::SetReg(int index, u64 value) {
|
||||
jit.load()->Regs()[index] = static_cast<u32>(value);
|
||||
}
|
||||
|
||||
u128 ARM_Dynarmic_32::GetVectorReg(int index) const {
|
||||
return {};
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_32::SetVectorReg(int index, u128 value) {}
|
||||
|
||||
u32 ARM_Dynarmic_32::GetPSTATE() const {
|
||||
return jit.load()->Cpsr();
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_32::SetPSTATE(u32 cpsr) {
|
||||
jit.load()->SetCpsr(cpsr);
|
||||
}
|
||||
|
||||
u64 ARM_Dynarmic_32::GetTlsAddress() const {
|
||||
return cp15->uro;
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_32::SetTlsAddress(u64 address) {
|
||||
cp15->uro = static_cast<u32>(address);
|
||||
}
|
||||
|
||||
u64 ARM_Dynarmic_32::GetTPIDR_EL0() const {
|
||||
return cp15->uprw;
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_32::SetTPIDR_EL0(u64 value) {
|
||||
cp15->uprw = static_cast<u32>(value);
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_32::SaveContext(ThreadContext32& ctx) const {
|
||||
Dynarmic::A32::Jit* j = jit.load();
|
||||
ctx.cpu_registers = j->Regs();
|
||||
ctx.extension_registers = j->ExtRegs();
|
||||
ctx.cpsr = j->Cpsr();
|
||||
ctx.fpscr = j->Fpscr();
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_32::LoadContext(const ThreadContext32& ctx) {
|
||||
Dynarmic::A32::Jit* j = jit.load();
|
||||
j->Regs() = ctx.cpu_registers;
|
||||
j->ExtRegs() = ctx.extension_registers;
|
||||
j->SetCpsr(ctx.cpsr);
|
||||
j->SetFpscr(ctx.fpscr);
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_32::SignalInterrupt() {
|
||||
jit.load()->HaltExecution(BreakLoop);
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_32::ClearInterrupt() {
|
||||
jit.load()->ClearHalt(BreakLoop);
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_32::ClearInstructionCache() {
|
||||
jit.load()->ClearCache();
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_32::InvalidateCacheRange(u64 addr, std::size_t size) {
|
||||
jit.load()->InvalidateCacheRange(static_cast<u32>(addr), size);
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_32::ClearExclusiveState() {
|
||||
jit.load()->ClearExclusiveState();
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_32::PageTableChanged(Common::PageTable& page_table,
|
||||
std::size_t new_address_space_size_in_bits) {
|
||||
ThreadContext32 ctx{};
|
||||
SaveContext(ctx);
|
||||
|
||||
auto key = std::make_pair(&page_table, new_address_space_size_in_bits);
|
||||
auto iter = jit_cache.find(key);
|
||||
if (iter != jit_cache.end()) {
|
||||
jit.store(iter->second.get());
|
||||
LoadContext(ctx);
|
||||
return;
|
||||
for (size_t i = 0; i < 8; i++) {
|
||||
args[i] = gpr[i];
|
||||
}
|
||||
std::shared_ptr new_jit = MakeJit(&page_table);
|
||||
jit.store(new_jit.get());
|
||||
LoadContext(ctx);
|
||||
jit_cache.emplace(key, std::move(new_jit));
|
||||
}
|
||||
|
||||
void ArmDynarmic32::SetSvcArguments(std::span<const uint64_t, 8> args) {
|
||||
Dynarmic::A32::Jit& j = *m_jit;
|
||||
auto& gpr = j.Regs();
|
||||
|
||||
for (size_t i = 0; i < 8; i++) {
|
||||
gpr[i] = static_cast<u32>(args[i]);
|
||||
}
|
||||
}
|
||||
|
||||
const Kernel::DebugWatchpoint* ArmDynarmic32::HaltedWatchpoint() const {
|
||||
return m_halted_watchpoint;
|
||||
}
|
||||
|
||||
void ArmDynarmic32::RewindBreakpointInstruction() {
|
||||
this->SetContext(m_breakpoint_context);
|
||||
}
|
||||
|
||||
ArmDynarmic32::ArmDynarmic32(System& system, bool uses_wall_clock, const Kernel::KProcess* process,
|
||||
DynarmicExclusiveMonitor& exclusive_monitor, std::size_t core_index)
|
||||
: ArmInterface{uses_wall_clock}, m_system{system}, m_exclusive_monitor{exclusive_monitor},
|
||||
m_cb(std::make_unique<DynarmicCallbacks32>(*this, process)),
|
||||
m_cp15(std::make_shared<DynarmicCP15>(*this)), m_core_index{core_index} {
|
||||
auto& page_table_impl = process->GetPageTable().GetBasePageTable().GetImpl();
|
||||
m_jit = MakeJit(&page_table_impl);
|
||||
}
|
||||
|
||||
ArmDynarmic32::~ArmDynarmic32() = default;
|
||||
|
||||
void ArmDynarmic32::SetTpidrroEl0(u64 value) {
|
||||
m_cp15->uro = static_cast<u32>(value);
|
||||
}
|
||||
|
||||
void ArmDynarmic32::GetContext(Kernel::Svc::ThreadContext& ctx) const {
|
||||
Dynarmic::A32::Jit& j = *m_jit;
|
||||
auto& gpr = j.Regs();
|
||||
auto& fpr = j.ExtRegs();
|
||||
|
||||
for (size_t i = 0; i < 16; i++) {
|
||||
ctx.r[i] = gpr[i];
|
||||
}
|
||||
|
||||
ctx.fp = gpr[11];
|
||||
ctx.sp = gpr[13];
|
||||
ctx.lr = gpr[14];
|
||||
ctx.pc = gpr[15];
|
||||
ctx.pstate = j.Cpsr();
|
||||
|
||||
static_assert(sizeof(fpr) <= sizeof(ctx.v));
|
||||
std::memcpy(ctx.v.data(), &fpr, sizeof(fpr));
|
||||
|
||||
auto [fpsr, fpcr] = FpscrToFpsrFpcr(j.Fpscr());
|
||||
ctx.fpcr = fpcr;
|
||||
ctx.fpsr = fpsr;
|
||||
ctx.tpidr = m_cp15->uprw;
|
||||
}
|
||||
|
||||
void ArmDynarmic32::SetContext(const Kernel::Svc::ThreadContext& ctx) {
|
||||
Dynarmic::A32::Jit& j = *m_jit;
|
||||
auto& gpr = j.Regs();
|
||||
auto& fpr = j.ExtRegs();
|
||||
|
||||
for (size_t i = 0; i < 16; i++) {
|
||||
gpr[i] = static_cast<u32>(ctx.r[i]);
|
||||
}
|
||||
|
||||
j.SetCpsr(ctx.pstate);
|
||||
|
||||
static_assert(sizeof(fpr) <= sizeof(ctx.v));
|
||||
std::memcpy(&fpr, ctx.v.data(), sizeof(fpr));
|
||||
|
||||
j.SetFpscr(FpsrFpcrToFpscr(ctx.fpsr, ctx.fpcr));
|
||||
m_cp15->uprw = static_cast<u32>(ctx.tpidr);
|
||||
}
|
||||
|
||||
void ArmDynarmic32::SignalInterrupt(Kernel::KThread* thread) {
|
||||
m_jit->HaltExecution(BreakLoop);
|
||||
}
|
||||
|
||||
void ArmDynarmic32::ClearInstructionCache() {
|
||||
m_jit->ClearCache();
|
||||
}
|
||||
|
||||
void ArmDynarmic32::InvalidateCacheRange(u64 addr, std::size_t size) {
|
||||
m_jit->InvalidateCacheRange(static_cast<u32>(addr), size);
|
||||
}
|
||||
|
||||
} // namespace Core
|
||||
|
|
|
@ -3,14 +3,8 @@
|
|||
|
||||
#pragma once
|
||||
|
||||
#include <atomic>
|
||||
#include <memory>
|
||||
#include <unordered_map>
|
||||
|
||||
#include <dynarmic/interface/A32/a32.h>
|
||||
#include <dynarmic/interface/A64/a64.h>
|
||||
#include "common/common_types.h"
|
||||
#include "common/hash.h"
|
||||
|
||||
#include "core/arm/arm_interface.h"
|
||||
#include "core/arm/dynarmic/dynarmic_exclusive_monitor.h"
|
||||
|
||||
|
@ -20,89 +14,63 @@ class Memory;
|
|||
|
||||
namespace Core {
|
||||
|
||||
class CPUInterruptHandler;
|
||||
class DynarmicCallbacks32;
|
||||
class DynarmicCP15;
|
||||
class DynarmicExclusiveMonitor;
|
||||
class System;
|
||||
|
||||
class ARM_Dynarmic_32 final : public ARM_Interface {
|
||||
class ArmDynarmic32 final : public ArmInterface {
|
||||
public:
|
||||
ARM_Dynarmic_32(System& system_, bool uses_wall_clock_,
|
||||
DynarmicExclusiveMonitor& exclusive_monitor_, std::size_t core_index_);
|
||||
~ARM_Dynarmic_32() override;
|
||||
|
||||
void SetPC(u64 pc) override;
|
||||
u64 GetPC() const override;
|
||||
u64 GetSP() const override;
|
||||
u64 GetReg(int index) const override;
|
||||
void SetReg(int index, u64 value) override;
|
||||
u128 GetVectorReg(int index) const override;
|
||||
void SetVectorReg(int index, u128 value) override;
|
||||
u32 GetPSTATE() const override;
|
||||
void SetPSTATE(u32 pstate) override;
|
||||
u64 GetTlsAddress() const override;
|
||||
void SetTlsAddress(u64 address) override;
|
||||
void SetTPIDR_EL0(u64 value) override;
|
||||
u64 GetTPIDR_EL0() const override;
|
||||
|
||||
bool IsInThumbMode() const {
|
||||
return (GetPSTATE() & 0x20) != 0;
|
||||
}
|
||||
ArmDynarmic32(System& system, bool uses_wall_clock, const Kernel::KProcess* process,
|
||||
DynarmicExclusiveMonitor& exclusive_monitor, std::size_t core_index);
|
||||
~ArmDynarmic32() override;
|
||||
|
||||
Architecture GetArchitecture() const override {
|
||||
return Architecture::Aarch32;
|
||||
return Architecture::AArch32;
|
||||
}
|
||||
void SaveContext(ThreadContext32& ctx) const override;
|
||||
void SaveContext(ThreadContext64& ctx) const override {}
|
||||
void LoadContext(const ThreadContext32& ctx) override;
|
||||
void LoadContext(const ThreadContext64& ctx) override {}
|
||||
|
||||
void SignalInterrupt() override;
|
||||
void ClearInterrupt() override;
|
||||
void ClearExclusiveState() override;
|
||||
bool IsInThumbMode() const;
|
||||
|
||||
HaltReason RunThread(Kernel::KThread* thread) override;
|
||||
HaltReason StepThread(Kernel::KThread* thread) override;
|
||||
|
||||
void GetContext(Kernel::Svc::ThreadContext& ctx) const override;
|
||||
void SetContext(const Kernel::Svc::ThreadContext& ctx) override;
|
||||
void SetTpidrroEl0(u64 value) override;
|
||||
|
||||
void GetSvcArguments(std::span<uint64_t, 8> args) const override;
|
||||
void SetSvcArguments(std::span<const uint64_t, 8> args) override;
|
||||
u32 GetSvcNumber() const override;
|
||||
|
||||
void SignalInterrupt(Kernel::KThread* thread) override;
|
||||
void ClearInstructionCache() override;
|
||||
void InvalidateCacheRange(u64 addr, std::size_t size) override;
|
||||
void PageTableChanged(Common::PageTable& new_page_table,
|
||||
std::size_t new_address_space_size_in_bits) override;
|
||||
|
||||
protected:
|
||||
HaltReason RunJit() override;
|
||||
HaltReason StepJit() override;
|
||||
u32 GetSvcNumber() const override;
|
||||
const Kernel::DebugWatchpoint* HaltedWatchpoint() const override;
|
||||
void RewindBreakpointInstruction() override;
|
||||
|
||||
private:
|
||||
std::shared_ptr<Dynarmic::A32::Jit> MakeJit(Common::PageTable* page_table) const;
|
||||
|
||||
static std::vector<BacktraceEntry> GetBacktrace(Core::System& system, u64 fp, u64 lr, u64 pc);
|
||||
|
||||
using JitCacheKey = std::pair<Common::PageTable*, std::size_t>;
|
||||
using JitCacheType =
|
||||
std::unordered_map<JitCacheKey, std::shared_ptr<Dynarmic::A32::Jit>, Common::PairHash>;
|
||||
System& m_system;
|
||||
DynarmicExclusiveMonitor& m_exclusive_monitor;
|
||||
|
||||
private:
|
||||
friend class DynarmicCallbacks32;
|
||||
friend class DynarmicCP15;
|
||||
|
||||
std::unique_ptr<DynarmicCallbacks32> cb;
|
||||
JitCacheType jit_cache;
|
||||
std::shared_ptr<DynarmicCP15> cp15;
|
||||
std::size_t core_index;
|
||||
DynarmicExclusiveMonitor& exclusive_monitor;
|
||||
std::shared_ptr<Dynarmic::A32::Jit> MakeJit(Common::PageTable* page_table) const;
|
||||
|
||||
std::shared_ptr<Dynarmic::A32::Jit> null_jit;
|
||||
std::unique_ptr<DynarmicCallbacks32> m_cb{};
|
||||
std::shared_ptr<DynarmicCP15> m_cp15{};
|
||||
std::size_t m_core_index{};
|
||||
|
||||
// A raw pointer here is fine; we never delete Jit instances.
|
||||
std::atomic<Dynarmic::A32::Jit*> jit;
|
||||
std::shared_ptr<Dynarmic::A32::Jit> m_jit{};
|
||||
|
||||
// SVC callback
|
||||
u32 svc_swi{};
|
||||
u32 m_svc_swi{};
|
||||
|
||||
// Watchpoint info
|
||||
const Kernel::DebugWatchpoint* halted_watchpoint;
|
||||
ThreadContext32 breakpoint_context;
|
||||
const Kernel::DebugWatchpoint* m_halted_watchpoint{};
|
||||
Kernel::Svc::ThreadContext m_breakpoint_context{};
|
||||
};
|
||||
|
||||
} // namespace Core
|
||||
|
|
|
@ -1,25 +1,12 @@
|
|||
// SPDX-FileCopyrightText: Copyright 2018 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
#include <cinttypes>
|
||||
#include <memory>
|
||||
#include <dynarmic/interface/A64/a64.h>
|
||||
#include <dynarmic/interface/A64/config.h>
|
||||
#include "common/assert.h"
|
||||
#include "common/literals.h"
|
||||
#include "common/logging/log.h"
|
||||
#include "common/page_table.h"
|
||||
#include "common/settings.h"
|
||||
#include "core/arm/dynarmic/arm_dynarmic.h"
|
||||
#include "core/arm/dynarmic/arm_dynarmic_64.h"
|
||||
#include "core/arm/dynarmic/dynarmic_exclusive_monitor.h"
|
||||
#include "core/core.h"
|
||||
#include "core/core_timing.h"
|
||||
#include "core/debugger/debugger.h"
|
||||
#include "core/hardware_properties.h"
|
||||
#include "core/hle/kernel/k_process.h"
|
||||
#include "core/hle/kernel/svc.h"
|
||||
#include "core/memory.h"
|
||||
|
||||
namespace Core {
|
||||
|
||||
|
@ -28,92 +15,92 @@ using namespace Common::Literals;
|
|||
|
||||
class DynarmicCallbacks64 : public Dynarmic::A64::UserCallbacks {
|
||||
public:
|
||||
explicit DynarmicCallbacks64(ARM_Dynarmic_64& parent_)
|
||||
: parent{parent_}, memory(parent.system.ApplicationMemory()),
|
||||
debugger_enabled{parent.system.DebuggerEnabled()},
|
||||
check_memory_access{debugger_enabled ||
|
||||
explicit DynarmicCallbacks64(ArmDynarmic64& parent, const Kernel::KProcess* process)
|
||||
: m_parent{parent}, m_memory(process->GetMemory()),
|
||||
m_process(process), m_debugger_enabled{parent.m_system.DebuggerEnabled()},
|
||||
m_check_memory_access{m_debugger_enabled ||
|
||||
!Settings::values.cpuopt_ignore_memory_aborts.GetValue()} {}
|
||||
|
||||
u8 MemoryRead8(u64 vaddr) override {
|
||||
CheckMemoryAccess(vaddr, 1, Kernel::DebugWatchpointType::Read);
|
||||
return memory.Read8(vaddr);
|
||||
return m_memory.Read8(vaddr);
|
||||
}
|
||||
u16 MemoryRead16(u64 vaddr) override {
|
||||
CheckMemoryAccess(vaddr, 2, Kernel::DebugWatchpointType::Read);
|
||||
return memory.Read16(vaddr);
|
||||
return m_memory.Read16(vaddr);
|
||||
}
|
||||
u32 MemoryRead32(u64 vaddr) override {
|
||||
CheckMemoryAccess(vaddr, 4, Kernel::DebugWatchpointType::Read);
|
||||
return memory.Read32(vaddr);
|
||||
return m_memory.Read32(vaddr);
|
||||
}
|
||||
u64 MemoryRead64(u64 vaddr) override {
|
||||
CheckMemoryAccess(vaddr, 8, Kernel::DebugWatchpointType::Read);
|
||||
return memory.Read64(vaddr);
|
||||
return m_memory.Read64(vaddr);
|
||||
}
|
||||
Vector MemoryRead128(u64 vaddr) override {
|
||||
CheckMemoryAccess(vaddr, 16, Kernel::DebugWatchpointType::Read);
|
||||
return {memory.Read64(vaddr), memory.Read64(vaddr + 8)};
|
||||
return {m_memory.Read64(vaddr), m_memory.Read64(vaddr + 8)};
|
||||
}
|
||||
std::optional<u32> MemoryReadCode(u64 vaddr) override {
|
||||
if (!memory.IsValidVirtualAddressRange(vaddr, sizeof(u32))) {
|
||||
if (!m_memory.IsValidVirtualAddressRange(vaddr, sizeof(u32))) {
|
||||
return std::nullopt;
|
||||
}
|
||||
return memory.Read32(vaddr);
|
||||
return m_memory.Read32(vaddr);
|
||||
}
|
||||
|
||||
void MemoryWrite8(u64 vaddr, u8 value) override {
|
||||
if (CheckMemoryAccess(vaddr, 1, Kernel::DebugWatchpointType::Write)) {
|
||||
memory.Write8(vaddr, value);
|
||||
m_memory.Write8(vaddr, value);
|
||||
}
|
||||
}
|
||||
void MemoryWrite16(u64 vaddr, u16 value) override {
|
||||
if (CheckMemoryAccess(vaddr, 2, Kernel::DebugWatchpointType::Write)) {
|
||||
memory.Write16(vaddr, value);
|
||||
m_memory.Write16(vaddr, value);
|
||||
}
|
||||
}
|
||||
void MemoryWrite32(u64 vaddr, u32 value) override {
|
||||
if (CheckMemoryAccess(vaddr, 4, Kernel::DebugWatchpointType::Write)) {
|
||||
memory.Write32(vaddr, value);
|
||||
m_memory.Write32(vaddr, value);
|
||||
}
|
||||
}
|
||||
void MemoryWrite64(u64 vaddr, u64 value) override {
|
||||
if (CheckMemoryAccess(vaddr, 8, Kernel::DebugWatchpointType::Write)) {
|
||||
memory.Write64(vaddr, value);
|
||||
m_memory.Write64(vaddr, value);
|
||||
}
|
||||
}
|
||||
void MemoryWrite128(u64 vaddr, Vector value) override {
|
||||
if (CheckMemoryAccess(vaddr, 16, Kernel::DebugWatchpointType::Write)) {
|
||||
memory.Write64(vaddr, value[0]);
|
||||
memory.Write64(vaddr + 8, value[1]);
|
||||
m_memory.Write64(vaddr, value[0]);
|
||||
m_memory.Write64(vaddr + 8, value[1]);
|
||||
}
|
||||
}
|
||||
|
||||
bool MemoryWriteExclusive8(u64 vaddr, std::uint8_t value, std::uint8_t expected) override {
|
||||
return CheckMemoryAccess(vaddr, 1, Kernel::DebugWatchpointType::Write) &&
|
||||
memory.WriteExclusive8(vaddr, value, expected);
|
||||
m_memory.WriteExclusive8(vaddr, value, expected);
|
||||
}
|
||||
bool MemoryWriteExclusive16(u64 vaddr, std::uint16_t value, std::uint16_t expected) override {
|
||||
return CheckMemoryAccess(vaddr, 2, Kernel::DebugWatchpointType::Write) &&
|
||||
memory.WriteExclusive16(vaddr, value, expected);
|
||||
m_memory.WriteExclusive16(vaddr, value, expected);
|
||||
}
|
||||
bool MemoryWriteExclusive32(u64 vaddr, std::uint32_t value, std::uint32_t expected) override {
|
||||
return CheckMemoryAccess(vaddr, 4, Kernel::DebugWatchpointType::Write) &&
|
||||
memory.WriteExclusive32(vaddr, value, expected);
|
||||
m_memory.WriteExclusive32(vaddr, value, expected);
|
||||
}
|
||||
bool MemoryWriteExclusive64(u64 vaddr, std::uint64_t value, std::uint64_t expected) override {
|
||||
return CheckMemoryAccess(vaddr, 8, Kernel::DebugWatchpointType::Write) &&
|
||||
memory.WriteExclusive64(vaddr, value, expected);
|
||||
m_memory.WriteExclusive64(vaddr, value, expected);
|
||||
}
|
||||
bool MemoryWriteExclusive128(u64 vaddr, Vector value, Vector expected) override {
|
||||
return CheckMemoryAccess(vaddr, 16, Kernel::DebugWatchpointType::Write) &&
|
||||
memory.WriteExclusive128(vaddr, value, expected);
|
||||
m_memory.WriteExclusive128(vaddr, value, expected);
|
||||
}
|
||||
|
||||
void InterpreterFallback(u64 pc, std::size_t num_instructions) override {
|
||||
parent.LogBacktrace();
|
||||
m_parent.LogBacktrace(m_process);
|
||||
LOG_ERROR(Core_ARM,
|
||||
"Unimplemented instruction @ 0x{:X} for {} instructions (instr = {:08X})", pc,
|
||||
num_instructions, memory.Read32(pc));
|
||||
num_instructions, m_memory.Read32(pc));
|
||||
ReturnException(pc, PrefetchAbort);
|
||||
}
|
||||
|
||||
|
@ -124,11 +111,11 @@ public:
|
|||
static constexpr u64 ICACHE_LINE_SIZE = 64;
|
||||
|
||||
const u64 cache_line_start = value & ~(ICACHE_LINE_SIZE - 1);
|
||||
parent.system.InvalidateCpuInstructionCacheRange(cache_line_start, ICACHE_LINE_SIZE);
|
||||
m_parent.InvalidateCacheRange(cache_line_start, ICACHE_LINE_SIZE);
|
||||
break;
|
||||
}
|
||||
case Dynarmic::A64::InstructionCacheOperation::InvalidateAllToPoU:
|
||||
parent.system.InvalidateCpuInstructionCaches();
|
||||
m_parent.ClearInstructionCache();
|
||||
break;
|
||||
case Dynarmic::A64::InstructionCacheOperation::InvalidateAllToPoUInnerSharable:
|
||||
default:
|
||||
|
@ -136,7 +123,7 @@ public:
|
|||
break;
|
||||
}
|
||||
|
||||
parent.jit.load()->HaltExecution(Dynarmic::HaltReason::CacheInvalidation);
|
||||
m_parent.m_jit->HaltExecution(Dynarmic::HaltReason::CacheInvalidation);
|
||||
}
|
||||
|
||||
void ExceptionRaised(u64 pc, Dynarmic::A64::Exception exception) override {
|
||||
|
@ -152,26 +139,24 @@ public:
|
|||
ReturnException(pc, PrefetchAbort);
|
||||
return;
|
||||
default:
|
||||
if (debugger_enabled) {
|
||||
if (m_debugger_enabled) {
|
||||
ReturnException(pc, InstructionBreakpoint);
|
||||
return;
|
||||
}
|
||||
|
||||
parent.LogBacktrace();
|
||||
m_parent.LogBacktrace(m_process);
|
||||
LOG_CRITICAL(Core_ARM, "ExceptionRaised(exception = {}, pc = {:08X}, code = {:08X})",
|
||||
static_cast<std::size_t>(exception), pc, memory.Read32(pc));
|
||||
static_cast<std::size_t>(exception), pc, m_memory.Read32(pc));
|
||||
}
|
||||
}
|
||||
|
||||
void CallSVC(u32 swi) override {
|
||||
parent.svc_swi = swi;
|
||||
parent.jit.load()->HaltExecution(SupervisorCall);
|
||||
void CallSVC(u32 svc) override {
|
||||
m_parent.m_svc = svc;
|
||||
m_parent.m_jit->HaltExecution(SupervisorCall);
|
||||
}
|
||||
|
||||
void AddTicks(u64 ticks) override {
|
||||
if (parent.uses_wall_clock) {
|
||||
return;
|
||||
}
|
||||
ASSERT_MSG(!m_parent.m_uses_wall_clock, "Dynarmic ticking disabled");
|
||||
|
||||
// Divide the number of ticks by the amount of CPU cores. TODO(Subv): This yields only a
|
||||
// rough approximation of the amount of executed ticks in the system, it may be thrown off
|
||||
|
@ -182,44 +167,39 @@ public:
|
|||
// Always execute at least one tick.
|
||||
amortized_ticks = std::max<u64>(amortized_ticks, 1);
|
||||
|
||||
parent.system.CoreTiming().AddTicks(amortized_ticks);
|
||||
m_parent.m_system.CoreTiming().AddTicks(amortized_ticks);
|
||||
}
|
||||
|
||||
u64 GetTicksRemaining() override {
|
||||
if (parent.uses_wall_clock) {
|
||||
if (!IsInterrupted()) {
|
||||
return minimum_run_cycles;
|
||||
}
|
||||
return 0U;
|
||||
}
|
||||
ASSERT_MSG(!m_parent.m_uses_wall_clock, "Dynarmic ticking disabled");
|
||||
|
||||
return std::max<s64>(parent.system.CoreTiming().GetDowncount(), 0);
|
||||
return std::max<s64>(m_parent.m_system.CoreTiming().GetDowncount(), 0);
|
||||
}
|
||||
|
||||
u64 GetCNTPCT() override {
|
||||
return parent.system.CoreTiming().GetClockTicks();
|
||||
return m_parent.m_system.CoreTiming().GetClockTicks();
|
||||
}
|
||||
|
||||
bool CheckMemoryAccess(u64 addr, u64 size, Kernel::DebugWatchpointType type) {
|
||||
if (!check_memory_access) {
|
||||
if (!m_check_memory_access) {
|
||||
return true;
|
||||
}
|
||||
|
||||
if (!memory.IsValidVirtualAddressRange(addr, size)) {
|
||||
if (!m_memory.IsValidVirtualAddressRange(addr, size)) {
|
||||
LOG_CRITICAL(Core_ARM, "Stopping execution due to unmapped memory access at {:#x}",
|
||||
addr);
|
||||
parent.jit.load()->HaltExecution(PrefetchAbort);
|
||||
m_parent.m_jit->HaltExecution(PrefetchAbort);
|
||||
return false;
|
||||
}
|
||||
|
||||
if (!debugger_enabled) {
|
||||
if (!m_debugger_enabled) {
|
||||
return true;
|
||||
}
|
||||
|
||||
const auto match{parent.MatchingWatchpoint(addr, size, type)};
|
||||
const auto match{m_parent.MatchingWatchpoint(addr, size, type)};
|
||||
if (match) {
|
||||
parent.halted_watchpoint = match;
|
||||
parent.jit.load()->HaltExecution(DataAbort);
|
||||
m_parent.m_halted_watchpoint = match;
|
||||
m_parent.m_jit->HaltExecution(DataAbort);
|
||||
return false;
|
||||
}
|
||||
|
||||
|
@ -227,30 +207,27 @@ public:
|
|||
}
|
||||
|
||||
void ReturnException(u64 pc, Dynarmic::HaltReason hr) {
|
||||
parent.SaveContext(parent.breakpoint_context);
|
||||
parent.breakpoint_context.pc = pc;
|
||||
parent.jit.load()->HaltExecution(hr);
|
||||
m_parent.GetContext(m_parent.m_breakpoint_context);
|
||||
m_parent.m_breakpoint_context.pc = pc;
|
||||
m_parent.m_jit->HaltExecution(hr);
|
||||
}
|
||||
|
||||
bool IsInterrupted() {
|
||||
return parent.system.Kernel().PhysicalCore(parent.core_index).IsInterrupted();
|
||||
}
|
||||
|
||||
ARM_Dynarmic_64& parent;
|
||||
Core::Memory::Memory& memory;
|
||||
u64 tpidrro_el0 = 0;
|
||||
u64 tpidr_el0 = 0;
|
||||
const bool debugger_enabled{};
|
||||
const bool check_memory_access{};
|
||||
static constexpr u64 minimum_run_cycles = 10000U;
|
||||
ArmDynarmic64& m_parent;
|
||||
Core::Memory::Memory& m_memory;
|
||||
u64 m_tpidrro_el0{};
|
||||
u64 m_tpidr_el0{};
|
||||
const Kernel::KProcess* m_process{};
|
||||
const bool m_debugger_enabled{};
|
||||
const bool m_check_memory_access{};
|
||||
static constexpr u64 MinimumRunCycles = 10000U;
|
||||
};
|
||||
|
||||
std::shared_ptr<Dynarmic::A64::Jit> ARM_Dynarmic_64::MakeJit(Common::PageTable* page_table,
|
||||
std::shared_ptr<Dynarmic::A64::Jit> ArmDynarmic64::MakeJit(Common::PageTable* page_table,
|
||||
std::size_t address_space_bits) const {
|
||||
Dynarmic::A64::UserConfig config;
|
||||
|
||||
// Callbacks
|
||||
config.callbacks = cb.get();
|
||||
config.callbacks = m_cb.get();
|
||||
|
||||
// Memory
|
||||
if (page_table) {
|
||||
|
@ -271,12 +248,12 @@ std::shared_ptr<Dynarmic::A64::Jit> ARM_Dynarmic_64::MakeJit(Common::PageTable*
|
|||
}
|
||||
|
||||
// Multi-process state
|
||||
config.processor_id = core_index;
|
||||
config.global_monitor = &exclusive_monitor.monitor;
|
||||
config.processor_id = m_core_index;
|
||||
config.global_monitor = &m_exclusive_monitor.monitor;
|
||||
|
||||
// System registers
|
||||
config.tpidrro_el0 = &cb->tpidrro_el0;
|
||||
config.tpidr_el0 = &cb->tpidr_el0;
|
||||
config.tpidrro_el0 = &m_cb->m_tpidrro_el0;
|
||||
config.tpidr_el0 = &m_cb->m_tpidr_el0;
|
||||
config.dczid_el0 = 4;
|
||||
config.ctr_el0 = 0x8444c004;
|
||||
config.cntfrq_el0 = Hardware::CNTFREQ;
|
||||
|
@ -285,8 +262,8 @@ std::shared_ptr<Dynarmic::A64::Jit> ARM_Dynarmic_64::MakeJit(Common::PageTable*
|
|||
config.define_unpredictable_behaviour = true;
|
||||
|
||||
// Timing
|
||||
config.wall_clock_cntpct = uses_wall_clock;
|
||||
config.enable_cycle_counting = true;
|
||||
config.wall_clock_cntpct = m_uses_wall_clock;
|
||||
config.enable_cycle_counting = !m_uses_wall_clock;
|
||||
|
||||
// Code cache size
|
||||
#ifdef ARCHITECTURE_arm64
|
||||
|
@ -296,7 +273,7 @@ std::shared_ptr<Dynarmic::A64::Jit> ARM_Dynarmic_64::MakeJit(Common::PageTable*
|
|||
#endif
|
||||
|
||||
// Allow memory fault handling to work
|
||||
if (system.DebuggerEnabled()) {
|
||||
if (m_system.DebuggerEnabled()) {
|
||||
config.check_halt_on_memory_access = true;
|
||||
}
|
||||
|
||||
|
@ -384,147 +361,112 @@ std::shared_ptr<Dynarmic::A64::Jit> ARM_Dynarmic_64::MakeJit(Common::PageTable*
|
|||
return std::make_shared<Dynarmic::A64::Jit>(config);
|
||||
}
|
||||
|
||||
HaltReason ARM_Dynarmic_64::RunJit() {
|
||||
return TranslateHaltReason(jit.load()->Run());
|
||||
HaltReason ArmDynarmic64::RunThread(Kernel::KThread* thread) {
|
||||
m_jit->ClearExclusiveState();
|
||||
return TranslateHaltReason(m_jit->Run());
|
||||
}
|
||||
|
||||
HaltReason ARM_Dynarmic_64::StepJit() {
|
||||
return TranslateHaltReason(jit.load()->Step());
|
||||
HaltReason ArmDynarmic64::StepThread(Kernel::KThread* thread) {
|
||||
m_jit->ClearExclusiveState();
|
||||
return TranslateHaltReason(m_jit->Step());
|
||||
}
|
||||
|
||||
u32 ARM_Dynarmic_64::GetSvcNumber() const {
|
||||
return svc_swi;
|
||||
u32 ArmDynarmic64::GetSvcNumber() const {
|
||||
return m_svc;
|
||||
}
|
||||
|
||||
const Kernel::DebugWatchpoint* ARM_Dynarmic_64::HaltedWatchpoint() const {
|
||||
return halted_watchpoint;
|
||||
}
|
||||
void ArmDynarmic64::GetSvcArguments(std::span<uint64_t, 8> args) const {
|
||||
Dynarmic::A64::Jit& j = *m_jit;
|
||||
|
||||
void ARM_Dynarmic_64::RewindBreakpointInstruction() {
|
||||
LoadContext(breakpoint_context);
|
||||
}
|
||||
|
||||
ARM_Dynarmic_64::ARM_Dynarmic_64(System& system_, bool uses_wall_clock_,
|
||||
DynarmicExclusiveMonitor& exclusive_monitor_,
|
||||
std::size_t core_index_)
|
||||
: ARM_Interface{system_, uses_wall_clock_},
|
||||
cb(std::make_unique<DynarmicCallbacks64>(*this)), core_index{core_index_},
|
||||
exclusive_monitor{exclusive_monitor_}, null_jit{MakeJit(nullptr, 48)}, jit{null_jit.get()} {}
|
||||
|
||||
ARM_Dynarmic_64::~ARM_Dynarmic_64() = default;
|
||||
|
||||
void ARM_Dynarmic_64::SetPC(u64 pc) {
|
||||
jit.load()->SetPC(pc);
|
||||
}
|
||||
|
||||
u64 ARM_Dynarmic_64::GetPC() const {
|
||||
return jit.load()->GetPC();
|
||||
}
|
||||
|
||||
u64 ARM_Dynarmic_64::GetSP() const {
|
||||
return jit.load()->GetSP();
|
||||
}
|
||||
|
||||
u64 ARM_Dynarmic_64::GetReg(int index) const {
|
||||
return jit.load()->GetRegister(index);
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_64::SetReg(int index, u64 value) {
|
||||
jit.load()->SetRegister(index, value);
|
||||
}
|
||||
|
||||
u128 ARM_Dynarmic_64::GetVectorReg(int index) const {
|
||||
return jit.load()->GetVector(index);
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_64::SetVectorReg(int index, u128 value) {
|
||||
jit.load()->SetVector(index, value);
|
||||
}
|
||||
|
||||
u32 ARM_Dynarmic_64::GetPSTATE() const {
|
||||
return jit.load()->GetPstate();
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_64::SetPSTATE(u32 pstate) {
|
||||
jit.load()->SetPstate(pstate);
|
||||
}
|
||||
|
||||
u64 ARM_Dynarmic_64::GetTlsAddress() const {
|
||||
return cb->tpidrro_el0;
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_64::SetTlsAddress(u64 address) {
|
||||
cb->tpidrro_el0 = address;
|
||||
}
|
||||
|
||||
u64 ARM_Dynarmic_64::GetTPIDR_EL0() const {
|
||||
return cb->tpidr_el0;
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_64::SetTPIDR_EL0(u64 value) {
|
||||
cb->tpidr_el0 = value;
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_64::SaveContext(ThreadContext64& ctx) const {
|
||||
Dynarmic::A64::Jit* j = jit.load();
|
||||
ctx.cpu_registers = j->GetRegisters();
|
||||
ctx.sp = j->GetSP();
|
||||
ctx.pc = j->GetPC();
|
||||
ctx.pstate = j->GetPstate();
|
||||
ctx.vector_registers = j->GetVectors();
|
||||
ctx.fpcr = j->GetFpcr();
|
||||
ctx.fpsr = j->GetFpsr();
|
||||
ctx.tpidr = cb->tpidr_el0;
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_64::LoadContext(const ThreadContext64& ctx) {
|
||||
Dynarmic::A64::Jit* j = jit.load();
|
||||
j->SetRegisters(ctx.cpu_registers);
|
||||
j->SetSP(ctx.sp);
|
||||
j->SetPC(ctx.pc);
|
||||
j->SetPstate(ctx.pstate);
|
||||
j->SetVectors(ctx.vector_registers);
|
||||
j->SetFpcr(ctx.fpcr);
|
||||
j->SetFpsr(ctx.fpsr);
|
||||
SetTPIDR_EL0(ctx.tpidr);
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_64::SignalInterrupt() {
|
||||
jit.load()->HaltExecution(BreakLoop);
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_64::ClearInterrupt() {
|
||||
jit.load()->ClearHalt(BreakLoop);
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_64::ClearInstructionCache() {
|
||||
jit.load()->ClearCache();
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_64::InvalidateCacheRange(u64 addr, std::size_t size) {
|
||||
jit.load()->InvalidateCacheRange(addr, size);
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_64::ClearExclusiveState() {
|
||||
jit.load()->ClearExclusiveState();
|
||||
}
|
||||
|
||||
void ARM_Dynarmic_64::PageTableChanged(Common::PageTable& page_table,
|
||||
std::size_t new_address_space_size_in_bits) {
|
||||
ThreadContext64 ctx{};
|
||||
SaveContext(ctx);
|
||||
|
||||
auto key = std::make_pair(&page_table, new_address_space_size_in_bits);
|
||||
auto iter = jit_cache.find(key);
|
||||
if (iter != jit_cache.end()) {
|
||||
jit.store(iter->second.get());
|
||||
LoadContext(ctx);
|
||||
return;
|
||||
for (size_t i = 0; i < 8; i++) {
|
||||
args[i] = j.GetRegister(i);
|
||||
}
|
||||
std::shared_ptr new_jit = MakeJit(&page_table, new_address_space_size_in_bits);
|
||||
jit.store(new_jit.get());
|
||||
LoadContext(ctx);
|
||||
jit_cache.emplace(key, std::move(new_jit));
|
||||
}
|
||||
|
||||
void ArmDynarmic64::SetSvcArguments(std::span<const uint64_t, 8> args) {
|
||||
Dynarmic::A64::Jit& j = *m_jit;
|
||||
|
||||
for (size_t i = 0; i < 8; i++) {
|
||||
j.SetRegister(i, args[i]);
|
||||
}
|
||||
}
|
||||
|
||||
const Kernel::DebugWatchpoint* ArmDynarmic64::HaltedWatchpoint() const {
|
||||
return m_halted_watchpoint;
|
||||
}
|
||||
|
||||
void ArmDynarmic64::RewindBreakpointInstruction() {
|
||||
this->SetContext(m_breakpoint_context);
|
||||
}
|
||||
|
||||
ArmDynarmic64::ArmDynarmic64(System& system, bool uses_wall_clock, const Kernel::KProcess* process,
|
||||
DynarmicExclusiveMonitor& exclusive_monitor, std::size_t core_index)
|
||||
: ArmInterface{uses_wall_clock}, m_system{system}, m_exclusive_monitor{exclusive_monitor},
|
||||
m_cb(std::make_unique<DynarmicCallbacks64>(*this, process)), m_core_index{core_index} {
|
||||
auto& page_table = process->GetPageTable().GetBasePageTable();
|
||||
auto& page_table_impl = page_table.GetImpl();
|
||||
m_jit = MakeJit(&page_table_impl, page_table.GetAddressSpaceWidth());
|
||||
}
|
||||
|
||||
ArmDynarmic64::~ArmDynarmic64() = default;
|
||||
|
||||
void ArmDynarmic64::SetTpidrroEl0(u64 value) {
|
||||
m_cb->m_tpidrro_el0 = value;
|
||||
}
|
||||
|
||||
void ArmDynarmic64::GetContext(Kernel::Svc::ThreadContext& ctx) const {
|
||||
Dynarmic::A64::Jit& j = *m_jit;
|
||||
auto gpr = j.GetRegisters();
|
||||
auto fpr = j.GetVectors();
|
||||
|
||||
// TODO: this is inconvenient
|
||||
for (size_t i = 0; i < 29; i++) {
|
||||
ctx.r[i] = gpr[i];
|
||||
}
|
||||
ctx.fp = gpr[29];
|
||||
ctx.lr = gpr[30];
|
||||
|
||||
ctx.sp = j.GetSP();
|
||||
ctx.pc = j.GetPC();
|
||||
ctx.pstate = j.GetPstate();
|
||||
ctx.v = fpr;
|
||||
ctx.fpcr = j.GetFpcr();
|
||||
ctx.fpsr = j.GetFpsr();
|
||||
ctx.tpidr = m_cb->m_tpidr_el0;
|
||||
}
|
||||
|
||||
void ArmDynarmic64::SetContext(const Kernel::Svc::ThreadContext& ctx) {
|
||||
Dynarmic::A64::Jit& j = *m_jit;
|
||||
|
||||
// TODO: this is inconvenient
|
||||
std::array<u64, 31> gpr;
|
||||
|
||||
for (size_t i = 0; i < 29; i++) {
|
||||
gpr[i] = ctx.r[i];
|
||||
}
|
||||
gpr[29] = ctx.fp;
|
||||
gpr[30] = ctx.lr;
|
||||
|
||||
j.SetRegisters(gpr);
|
||||
j.SetSP(ctx.sp);
|
||||
j.SetPC(ctx.pc);
|
||||
j.SetPstate(ctx.pstate);
|
||||
j.SetVectors(ctx.v);
|
||||
j.SetFpcr(ctx.fpcr);
|
||||
j.SetFpsr(ctx.fpsr);
|
||||
m_cb->m_tpidr_el0 = ctx.tpidr;
|
||||
}
|
||||
|
||||
void ArmDynarmic64::SignalInterrupt(Kernel::KThread* thread) {
|
||||
m_jit->HaltExecution(BreakLoop);
|
||||
}
|
||||
|
||||
void ArmDynarmic64::ClearInstructionCache() {
|
||||
m_jit->ClearCache();
|
||||
}
|
||||
|
||||
void ArmDynarmic64::InvalidateCacheRange(u64 addr, std::size_t size) {
|
||||
m_jit->InvalidateCacheRange(addr, size);
|
||||
}
|
||||
|
||||
} // namespace Core
|
||||
|
|
|
@ -23,76 +23,55 @@ class DynarmicCallbacks64;
|
|||
class DynarmicExclusiveMonitor;
|
||||
class System;
|
||||
|
||||
class ARM_Dynarmic_64 final : public ARM_Interface {
|
||||
class ArmDynarmic64 final : public ArmInterface {
|
||||
public:
|
||||
ARM_Dynarmic_64(System& system_, bool uses_wall_clock_,
|
||||
DynarmicExclusiveMonitor& exclusive_monitor_, std::size_t core_index_);
|
||||
~ARM_Dynarmic_64() override;
|
||||
|
||||
void SetPC(u64 pc) override;
|
||||
u64 GetPC() const override;
|
||||
u64 GetSP() const override;
|
||||
u64 GetReg(int index) const override;
|
||||
void SetReg(int index, u64 value) override;
|
||||
u128 GetVectorReg(int index) const override;
|
||||
void SetVectorReg(int index, u128 value) override;
|
||||
u32 GetPSTATE() const override;
|
||||
void SetPSTATE(u32 pstate) override;
|
||||
u64 GetTlsAddress() const override;
|
||||
void SetTlsAddress(u64 address) override;
|
||||
void SetTPIDR_EL0(u64 value) override;
|
||||
u64 GetTPIDR_EL0() const override;
|
||||
ArmDynarmic64(System& system, bool uses_wall_clock, const Kernel::KProcess* process,
|
||||
DynarmicExclusiveMonitor& exclusive_monitor, std::size_t core_index);
|
||||
~ArmDynarmic64() override;
|
||||
|
||||
Architecture GetArchitecture() const override {
|
||||
return Architecture::Aarch64;
|
||||
return Architecture::AArch64;
|
||||
}
|
||||
void SaveContext(ThreadContext32& ctx) const override {}
|
||||
void SaveContext(ThreadContext64& ctx) const override;
|
||||
void LoadContext(const ThreadContext32& ctx) override {}
|
||||
void LoadContext(const ThreadContext64& ctx) override;
|
||||
|
||||
void SignalInterrupt() override;
|
||||
void ClearInterrupt() override;
|
||||
void ClearExclusiveState() override;
|
||||
HaltReason RunThread(Kernel::KThread* thread) override;
|
||||
HaltReason StepThread(Kernel::KThread* thread) override;
|
||||
|
||||
void GetContext(Kernel::Svc::ThreadContext& ctx) const override;
|
||||
void SetContext(const Kernel::Svc::ThreadContext& ctx) override;
|
||||
void SetTpidrroEl0(u64 value) override;
|
||||
|
||||
void GetSvcArguments(std::span<uint64_t, 8> args) const override;
|
||||
void SetSvcArguments(std::span<const uint64_t, 8> args) override;
|
||||
u32 GetSvcNumber() const override;
|
||||
|
||||
void SignalInterrupt(Kernel::KThread* thread) override;
|
||||
void ClearInstructionCache() override;
|
||||
void InvalidateCacheRange(u64 addr, std::size_t size) override;
|
||||
void PageTableChanged(Common::PageTable& new_page_table,
|
||||
std::size_t new_address_space_size_in_bits) override;
|
||||
|
||||
protected:
|
||||
HaltReason RunJit() override;
|
||||
HaltReason StepJit() override;
|
||||
u32 GetSvcNumber() const override;
|
||||
const Kernel::DebugWatchpoint* HaltedWatchpoint() const override;
|
||||
void RewindBreakpointInstruction() override;
|
||||
|
||||
private:
|
||||
System& m_system;
|
||||
DynarmicExclusiveMonitor& m_exclusive_monitor;
|
||||
|
||||
private:
|
||||
friend class DynarmicCallbacks64;
|
||||
|
||||
std::shared_ptr<Dynarmic::A64::Jit> MakeJit(Common::PageTable* page_table,
|
||||
std::size_t address_space_bits) const;
|
||||
std::unique_ptr<DynarmicCallbacks64> m_cb{};
|
||||
std::size_t m_core_index{};
|
||||
|
||||
using JitCacheKey = std::pair<Common::PageTable*, std::size_t>;
|
||||
using JitCacheType =
|
||||
std::unordered_map<JitCacheKey, std::shared_ptr<Dynarmic::A64::Jit>, Common::PairHash>;
|
||||
|
||||
friend class DynarmicCallbacks64;
|
||||
std::unique_ptr<DynarmicCallbacks64> cb;
|
||||
JitCacheType jit_cache;
|
||||
|
||||
std::size_t core_index;
|
||||
DynarmicExclusiveMonitor& exclusive_monitor;
|
||||
|
||||
std::shared_ptr<Dynarmic::A64::Jit> null_jit;
|
||||
|
||||
// A raw pointer here is fine; we never delete Jit instances.
|
||||
std::atomic<Dynarmic::A64::Jit*> jit;
|
||||
std::shared_ptr<Dynarmic::A64::Jit> m_jit{};
|
||||
|
||||
// SVC callback
|
||||
u32 svc_swi{};
|
||||
u32 m_svc{};
|
||||
|
||||
// Breakpoint info
|
||||
const Kernel::DebugWatchpoint* halted_watchpoint;
|
||||
ThreadContext64 breakpoint_context;
|
||||
// Watchpoint info
|
||||
const Kernel::DebugWatchpoint* m_halted_watchpoint{};
|
||||
Kernel::Svc::ThreadContext m_breakpoint_context{};
|
||||
};
|
||||
|
||||
} // namespace Core
|
||||
|
|
|
@ -124,8 +124,8 @@ CallbackOrAccessTwoWords DynarmicCP15::CompileGetTwoWords(bool two, unsigned opc
|
|||
if (!two && opc == 0 && CRm == CoprocReg::C14) {
|
||||
// CNTPCT
|
||||
const auto callback = [](void* arg, u32, u32) -> u64 {
|
||||
const auto& parent_arg = *static_cast<ARM_Dynarmic_32*>(arg);
|
||||
return parent_arg.system.CoreTiming().GetClockTicks();
|
||||
const auto& parent_arg = *static_cast<ArmDynarmic32*>(arg);
|
||||
return parent_arg.m_system.CoreTiming().GetClockTicks();
|
||||
};
|
||||
return Callback{callback, &parent};
|
||||
}
|
||||
|
|
|
@ -10,13 +10,13 @@
|
|||
|
||||
namespace Core {
|
||||
|
||||
class ARM_Dynarmic_32;
|
||||
class ArmDynarmic32;
|
||||
|
||||
class DynarmicCP15 final : public Dynarmic::A32::Coprocessor {
|
||||
public:
|
||||
using CoprocReg = Dynarmic::A32::CoprocReg;
|
||||
|
||||
explicit DynarmicCP15(ARM_Dynarmic_32& parent_) : parent{parent_} {}
|
||||
explicit DynarmicCP15(ArmDynarmic32& parent_) : parent{parent_} {}
|
||||
|
||||
std::optional<Callback> CompileInternalOperation(bool two, unsigned opc1, CoprocReg CRd,
|
||||
CoprocReg CRn, CoprocReg CRm,
|
||||
|
@ -32,11 +32,11 @@ public:
|
|||
std::optional<Callback> CompileStoreWords(bool two, bool long_transfer, CoprocReg CRd,
|
||||
std::optional<u8> option) override;
|
||||
|
||||
ARM_Dynarmic_32& parent;
|
||||
ArmDynarmic32& parent;
|
||||
u32 uprw = 0;
|
||||
u32 uro = 0;
|
||||
|
||||
friend class ARM_Dynarmic_32;
|
||||
friend class ArmDynarmic32;
|
||||
};
|
||||
|
||||
} // namespace Core
|
||||
|
|
|
@ -14,8 +14,8 @@ class Memory;
|
|||
|
||||
namespace Core {
|
||||
|
||||
class ARM_Dynarmic_32;
|
||||
class ARM_Dynarmic_64;
|
||||
class ArmDynarmic32;
|
||||
class ArmDynarmic64;
|
||||
|
||||
class DynarmicExclusiveMonitor final : public ExclusiveMonitor {
|
||||
public:
|
||||
|
@ -36,8 +36,8 @@ public:
|
|||
bool ExclusiveWrite128(std::size_t core_index, VAddr vaddr, u128 value) override;
|
||||
|
||||
private:
|
||||
friend class ARM_Dynarmic_32;
|
||||
friend class ARM_Dynarmic_64;
|
||||
friend class ArmDynarmic32;
|
||||
friend class ArmDynarmic64;
|
||||
Dynarmic::ExclusiveMonitor monitor;
|
||||
Core::Memory::Memory& memory;
|
||||
};
|
||||
|
|
|
@ -6,6 +6,7 @@
|
|||
|
||||
#include "common/signal_chain.h"
|
||||
#include "core/arm/nce/arm_nce.h"
|
||||
#include "core/arm/nce/guest_context.h"
|
||||
#include "core/arm/nce/patcher.h"
|
||||
#include "core/core.h"
|
||||
#include "core/memory.h"
|
||||
|
@ -38,7 +39,7 @@ fpsimd_context* GetFloatingPointState(mcontext_t& host_ctx) {
|
|||
|
||||
} // namespace
|
||||
|
||||
void* ARM_NCE::RestoreGuestContext(void* raw_context) {
|
||||
void* ArmNce::RestoreGuestContext(void* raw_context) {
|
||||
// Retrieve the host context.
|
||||
auto& host_ctx = static_cast<ucontext_t*>(raw_context)->uc_mcontext;
|
||||
|
||||
|
@ -71,7 +72,7 @@ void* ARM_NCE::RestoreGuestContext(void* raw_context) {
|
|||
return tpidr;
|
||||
}
|
||||
|
||||
void ARM_NCE::SaveGuestContext(GuestContext* guest_ctx, void* raw_context) {
|
||||
void ArmNce::SaveGuestContext(GuestContext* guest_ctx, void* raw_context) {
|
||||
// Retrieve the host context.
|
||||
auto& host_ctx = static_cast<ucontext_t*>(raw_context)->uc_mcontext;
|
||||
|
||||
|
@ -103,7 +104,7 @@ void ARM_NCE::SaveGuestContext(GuestContext* guest_ctx, void* raw_context) {
|
|||
host_ctx.regs[0] = guest_ctx->esr_el1.exchange(0);
|
||||
}
|
||||
|
||||
bool ARM_NCE::HandleGuestFault(GuestContext* guest_ctx, void* raw_info, void* raw_context) {
|
||||
bool ArmNce::HandleGuestFault(GuestContext* guest_ctx, void* raw_info, void* raw_context) {
|
||||
auto& host_ctx = static_cast<ucontext_t*>(raw_context)->uc_mcontext;
|
||||
auto* info = static_cast<siginfo_t*>(raw_info);
|
||||
|
||||
|
@ -134,7 +135,7 @@ bool ARM_NCE::HandleGuestFault(GuestContext* guest_ctx, void* raw_info, void* ra
|
|||
// - If we lose the race, then SignalInterrupt will send us a signal we are masking,
|
||||
// and it will do nothing when it is unmasked, as we have already left guest code.
|
||||
// - If we win the race, then SignalInterrupt will wait for us to unlock first.
|
||||
auto& thread_params = guest_ctx->parent->running_thread->GetNativeExecutionParameters();
|
||||
auto& thread_params = guest_ctx->parent->m_running_thread->GetNativeExecutionParameters();
|
||||
thread_params.lock.store(SpinLockLocked);
|
||||
|
||||
// Return to host.
|
||||
|
@ -142,97 +143,93 @@ bool ARM_NCE::HandleGuestFault(GuestContext* guest_ctx, void* raw_info, void* ra
|
|||
return false;
|
||||
}
|
||||
|
||||
void ARM_NCE::HandleHostFault(int sig, void* raw_info, void* raw_context) {
|
||||
void ArmNce::HandleHostFault(int sig, void* raw_info, void* raw_context) {
|
||||
return g_orig_action.sa_sigaction(sig, static_cast<siginfo_t*>(raw_info), raw_context);
|
||||
}
|
||||
|
||||
HaltReason ARM_NCE::RunJit() {
|
||||
// Get the thread parameters.
|
||||
// TODO: pass the current thread down from ::Run
|
||||
auto* thread = Kernel::GetCurrentThreadPointer(system.Kernel());
|
||||
void ArmNce::LockThread(Kernel::KThread* thread) {
|
||||
auto* thread_params = &thread->GetNativeExecutionParameters();
|
||||
|
||||
{
|
||||
// Lock our core context.
|
||||
std::scoped_lock lk{lock};
|
||||
|
||||
// We should not be running.
|
||||
ASSERT(running_thread == nullptr);
|
||||
|
||||
// Check if we need to run. If we have already been halted, we are done.
|
||||
u64 halt = guest_ctx.esr_el1.exchange(0);
|
||||
if (halt != 0) {
|
||||
return static_cast<HaltReason>(halt);
|
||||
}
|
||||
|
||||
// Mark that we are running.
|
||||
running_thread = thread;
|
||||
|
||||
// Acquire the lock on the thread parameters.
|
||||
// This allows us to force synchronization with SignalInterrupt.
|
||||
LockThreadParameters(thread_params);
|
||||
}
|
||||
|
||||
void ArmNce::UnlockThread(Kernel::KThread* thread) {
|
||||
auto* thread_params = &thread->GetNativeExecutionParameters();
|
||||
UnlockThreadParameters(thread_params);
|
||||
}
|
||||
|
||||
HaltReason ArmNce::RunThread(Kernel::KThread* thread) {
|
||||
// Check if we're already interrupted.
|
||||
// If we are, we can just return immediately.
|
||||
HaltReason hr = static_cast<HaltReason>(m_guest_ctx.esr_el1.exchange(0));
|
||||
if (True(hr)) {
|
||||
return hr;
|
||||
}
|
||||
|
||||
// Get the thread context.
|
||||
auto* thread_params = &thread->GetNativeExecutionParameters();
|
||||
auto* process = thread->GetOwnerProcess();
|
||||
|
||||
// Assign current members.
|
||||
guest_ctx.parent = this;
|
||||
thread_params->native_context = &guest_ctx;
|
||||
thread_params->tpidr_el0 = guest_ctx.tpidr_el0;
|
||||
thread_params->tpidrro_el0 = guest_ctx.tpidrro_el0;
|
||||
m_running_thread = thread;
|
||||
m_guest_ctx.parent = this;
|
||||
thread_params->native_context = &m_guest_ctx;
|
||||
thread_params->tpidr_el0 = m_guest_ctx.tpidr_el0;
|
||||
thread_params->tpidrro_el0 = m_guest_ctx.tpidrro_el0;
|
||||
thread_params->is_running = true;
|
||||
|
||||
HaltReason halt{};
|
||||
|
||||
// TODO: finding and creating the post handler needs to be locked
|
||||
// to deal with dynamic loading of NROs.
|
||||
const auto& post_handlers = system.ApplicationProcess()->GetPostHandlers();
|
||||
if (auto it = post_handlers.find(guest_ctx.pc); it != post_handlers.end()) {
|
||||
halt = ReturnToRunCodeByTrampoline(thread_params, &guest_ctx, it->second);
|
||||
const auto& post_handlers = process->GetPostHandlers();
|
||||
if (auto it = post_handlers.find(m_guest_ctx.pc); it != post_handlers.end()) {
|
||||
hr = ReturnToRunCodeByTrampoline(thread_params, &m_guest_ctx, it->second);
|
||||
} else {
|
||||
halt = ReturnToRunCodeByExceptionLevelChange(thread_id, thread_params);
|
||||
hr = ReturnToRunCodeByExceptionLevelChange(m_thread_id, thread_params);
|
||||
}
|
||||
|
||||
// Unload members.
|
||||
// The thread does not change, so we can persist the old reference.
|
||||
guest_ctx.tpidr_el0 = thread_params->tpidr_el0;
|
||||
m_running_thread = nullptr;
|
||||
m_guest_ctx.tpidr_el0 = thread_params->tpidr_el0;
|
||||
thread_params->native_context = nullptr;
|
||||
thread_params->is_running = false;
|
||||
|
||||
// Unlock the thread parameters.
|
||||
UnlockThreadParameters(thread_params);
|
||||
|
||||
{
|
||||
// Lock the core context.
|
||||
std::scoped_lock lk{lock};
|
||||
|
||||
// On exit, we no longer have an active thread.
|
||||
running_thread = nullptr;
|
||||
}
|
||||
|
||||
// Return the halt reason.
|
||||
return halt;
|
||||
return hr;
|
||||
}
|
||||
|
||||
HaltReason ARM_NCE::StepJit() {
|
||||
HaltReason ArmNce::StepThread(Kernel::KThread* thread) {
|
||||
return HaltReason::StepThread;
|
||||
}
|
||||
|
||||
u32 ARM_NCE::GetSvcNumber() const {
|
||||
return guest_ctx.svc_swi;
|
||||
u32 ArmNce::GetSvcNumber() const {
|
||||
return m_guest_ctx.svc;
|
||||
}
|
||||
|
||||
ARM_NCE::ARM_NCE(System& system_, bool uses_wall_clock_, std::size_t core_index_)
|
||||
: ARM_Interface{system_, uses_wall_clock_}, core_index{core_index_} {
|
||||
guest_ctx.system = &system_;
|
||||
void ArmNce::GetSvcArguments(std::span<uint64_t, 8> args) const {
|
||||
for (size_t i = 0; i < 8; i++) {
|
||||
args[i] = m_guest_ctx.cpu_registers[i];
|
||||
}
|
||||
}
|
||||
|
||||
ARM_NCE::~ARM_NCE() = default;
|
||||
void ArmNce::SetSvcArguments(std::span<const uint64_t, 8> args) {
|
||||
for (size_t i = 0; i < 8; i++) {
|
||||
m_guest_ctx.cpu_registers[i] = args[i];
|
||||
}
|
||||
}
|
||||
|
||||
void ARM_NCE::Initialize() {
|
||||
thread_id = gettid();
|
||||
ArmNce::ArmNce(System& system, bool uses_wall_clock, std::size_t core_index)
|
||||
: ArmInterface{uses_wall_clock}, m_system{system}, m_core_index{core_index} {
|
||||
m_guest_ctx.system = &m_system;
|
||||
}
|
||||
|
||||
ArmNce::~ArmNce() = default;
|
||||
|
||||
void ArmNce::Initialize() {
|
||||
m_thread_id = gettid();
|
||||
|
||||
// Setup our signals
|
||||
static std::once_flag flag;
|
||||
std::call_once(flag, [] {
|
||||
static std::once_flag signals;
|
||||
std::call_once(signals, [] {
|
||||
using HandlerType = decltype(sigaction::sa_sigaction);
|
||||
|
||||
sigset_t signal_mask;
|
||||
|
@ -244,7 +241,7 @@ void ARM_NCE::Initialize() {
|
|||
struct sigaction return_to_run_code_action {};
|
||||
return_to_run_code_action.sa_flags = SA_SIGINFO | SA_ONSTACK;
|
||||
return_to_run_code_action.sa_sigaction = reinterpret_cast<HandlerType>(
|
||||
&ARM_NCE::ReturnToRunCodeByExceptionLevelChangeSignalHandler);
|
||||
&ArmNce::ReturnToRunCodeByExceptionLevelChangeSignalHandler);
|
||||
return_to_run_code_action.sa_mask = signal_mask;
|
||||
Common::SigAction(ReturnToRunCodeByExceptionLevelChangeSignal, &return_to_run_code_action,
|
||||
nullptr);
|
||||
|
@ -252,14 +249,13 @@ void ARM_NCE::Initialize() {
|
|||
struct sigaction break_from_run_code_action {};
|
||||
break_from_run_code_action.sa_flags = SA_SIGINFO | SA_ONSTACK;
|
||||
break_from_run_code_action.sa_sigaction =
|
||||
reinterpret_cast<HandlerType>(&ARM_NCE::BreakFromRunCodeSignalHandler);
|
||||
reinterpret_cast<HandlerType>(&ArmNce::BreakFromRunCodeSignalHandler);
|
||||
break_from_run_code_action.sa_mask = signal_mask;
|
||||
Common::SigAction(BreakFromRunCodeSignal, &break_from_run_code_action, nullptr);
|
||||
|
||||
struct sigaction fault_action {};
|
||||
fault_action.sa_flags = SA_SIGINFO | SA_ONSTACK | SA_RESTART;
|
||||
fault_action.sa_sigaction =
|
||||
reinterpret_cast<HandlerType>(&ARM_NCE::GuestFaultSignalHandler);
|
||||
fault_action.sa_sigaction = reinterpret_cast<HandlerType>(&ArmNce::GuestFaultSignalHandler);
|
||||
fault_action.sa_mask = signal_mask;
|
||||
Common::SigAction(GuestFaultSignal, &fault_action, &g_orig_action);
|
||||
|
||||
|
@ -272,111 +268,59 @@ void ARM_NCE::Initialize() {
|
|||
});
|
||||
}
|
||||
|
||||
void ARM_NCE::SetPC(u64 pc) {
|
||||
guest_ctx.pc = pc;
|
||||
void ArmNce::SetTpidrroEl0(u64 value) {
|
||||
m_guest_ctx.tpidrro_el0 = value;
|
||||
}
|
||||
|
||||
u64 ARM_NCE::GetPC() const {
|
||||
return guest_ctx.pc;
|
||||
}
|
||||
|
||||
u64 ARM_NCE::GetSP() const {
|
||||
return guest_ctx.sp;
|
||||
}
|
||||
|
||||
u64 ARM_NCE::GetReg(int index) const {
|
||||
return guest_ctx.cpu_registers[index];
|
||||
}
|
||||
|
||||
void ARM_NCE::SetReg(int index, u64 value) {
|
||||
guest_ctx.cpu_registers[index] = value;
|
||||
}
|
||||
|
||||
u128 ARM_NCE::GetVectorReg(int index) const {
|
||||
return guest_ctx.vector_registers[index];
|
||||
}
|
||||
|
||||
void ARM_NCE::SetVectorReg(int index, u128 value) {
|
||||
guest_ctx.vector_registers[index] = value;
|
||||
}
|
||||
|
||||
u32 ARM_NCE::GetPSTATE() const {
|
||||
return guest_ctx.pstate;
|
||||
}
|
||||
|
||||
void ARM_NCE::SetPSTATE(u32 pstate) {
|
||||
guest_ctx.pstate = pstate;
|
||||
}
|
||||
|
||||
u64 ARM_NCE::GetTlsAddress() const {
|
||||
return guest_ctx.tpidrro_el0;
|
||||
}
|
||||
|
||||
void ARM_NCE::SetTlsAddress(u64 address) {
|
||||
guest_ctx.tpidrro_el0 = address;
|
||||
}
|
||||
|
||||
u64 ARM_NCE::GetTPIDR_EL0() const {
|
||||
return guest_ctx.tpidr_el0;
|
||||
}
|
||||
|
||||
void ARM_NCE::SetTPIDR_EL0(u64 value) {
|
||||
guest_ctx.tpidr_el0 = value;
|
||||
}
|
||||
|
||||
void ARM_NCE::SaveContext(ThreadContext64& ctx) const {
|
||||
ctx.cpu_registers = guest_ctx.cpu_registers;
|
||||
ctx.sp = guest_ctx.sp;
|
||||
ctx.pc = guest_ctx.pc;
|
||||
ctx.pstate = guest_ctx.pstate;
|
||||
ctx.vector_registers = guest_ctx.vector_registers;
|
||||
ctx.fpcr = guest_ctx.fpcr;
|
||||
ctx.fpsr = guest_ctx.fpsr;
|
||||
ctx.tpidr = guest_ctx.tpidr_el0;
|
||||
}
|
||||
|
||||
void ARM_NCE::LoadContext(const ThreadContext64& ctx) {
|
||||
guest_ctx.cpu_registers = ctx.cpu_registers;
|
||||
guest_ctx.sp = ctx.sp;
|
||||
guest_ctx.pc = ctx.pc;
|
||||
guest_ctx.pstate = ctx.pstate;
|
||||
guest_ctx.vector_registers = ctx.vector_registers;
|
||||
guest_ctx.fpcr = ctx.fpcr;
|
||||
guest_ctx.fpsr = ctx.fpsr;
|
||||
guest_ctx.tpidr_el0 = ctx.tpidr;
|
||||
}
|
||||
|
||||
void ARM_NCE::SignalInterrupt() {
|
||||
// Lock core context.
|
||||
std::scoped_lock lk{lock};
|
||||
|
||||
// Add break loop condition.
|
||||
guest_ctx.esr_el1.fetch_or(static_cast<u64>(HaltReason::BreakLoop));
|
||||
|
||||
// If there is no thread running, we are done.
|
||||
if (running_thread == nullptr) {
|
||||
return;
|
||||
void ArmNce::GetContext(Kernel::Svc::ThreadContext& ctx) const {
|
||||
for (size_t i = 0; i < 29; i++) {
|
||||
ctx.r[i] = m_guest_ctx.cpu_registers[i];
|
||||
}
|
||||
ctx.fp = m_guest_ctx.cpu_registers[29];
|
||||
ctx.lr = m_guest_ctx.cpu_registers[30];
|
||||
ctx.sp = m_guest_ctx.sp;
|
||||
ctx.pc = m_guest_ctx.pc;
|
||||
ctx.pstate = m_guest_ctx.pstate;
|
||||
ctx.v = m_guest_ctx.vector_registers;
|
||||
ctx.fpcr = m_guest_ctx.fpcr;
|
||||
ctx.fpsr = m_guest_ctx.fpsr;
|
||||
ctx.tpidr = m_guest_ctx.tpidr_el0;
|
||||
}
|
||||
|
||||
void ArmNce::SetContext(const Kernel::Svc::ThreadContext& ctx) {
|
||||
for (size_t i = 0; i < 29; i++) {
|
||||
m_guest_ctx.cpu_registers[i] = ctx.r[i];
|
||||
}
|
||||
m_guest_ctx.cpu_registers[29] = ctx.fp;
|
||||
m_guest_ctx.cpu_registers[30] = ctx.lr;
|
||||
m_guest_ctx.sp = ctx.sp;
|
||||
m_guest_ctx.pc = ctx.pc;
|
||||
m_guest_ctx.pstate = ctx.pstate;
|
||||
m_guest_ctx.vector_registers = ctx.v;
|
||||
m_guest_ctx.fpcr = ctx.fpcr;
|
||||
m_guest_ctx.fpsr = ctx.fpsr;
|
||||
m_guest_ctx.tpidr_el0 = ctx.tpidr;
|
||||
}
|
||||
|
||||
void ArmNce::SignalInterrupt(Kernel::KThread* thread) {
|
||||
// Add break loop condition.
|
||||
m_guest_ctx.esr_el1.fetch_or(static_cast<u64>(HaltReason::BreakLoop));
|
||||
|
||||
// Lock the thread context.
|
||||
auto* params = &running_thread->GetNativeExecutionParameters();
|
||||
auto* params = &thread->GetNativeExecutionParameters();
|
||||
LockThreadParameters(params);
|
||||
|
||||
if (params->is_running) {
|
||||
// We should signal to the running thread.
|
||||
// The running thread will unlock the thread context.
|
||||
syscall(SYS_tkill, thread_id, BreakFromRunCodeSignal);
|
||||
syscall(SYS_tkill, m_thread_id, BreakFromRunCodeSignal);
|
||||
} else {
|
||||
// If the thread is no longer running, we have nothing to do.
|
||||
UnlockThreadParameters(params);
|
||||
}
|
||||
}
|
||||
|
||||
void ARM_NCE::ClearInterrupt() {
|
||||
guest_ctx.esr_el1 = {};
|
||||
}
|
||||
|
||||
void ARM_NCE::ClearInstructionCache() {
|
||||
void ArmNce::ClearInstructionCache() {
|
||||
// TODO: This is not possible to implement correctly on Linux because
|
||||
// we do not have any access to ic iallu.
|
||||
|
||||
|
@ -384,17 +328,8 @@ void ARM_NCE::ClearInstructionCache() {
|
|||
std::atomic_thread_fence(std::memory_order_seq_cst);
|
||||
}
|
||||
|
||||
void ARM_NCE::InvalidateCacheRange(u64 addr, std::size_t size) {
|
||||
void ArmNce::InvalidateCacheRange(u64 addr, std::size_t size) {
|
||||
this->ClearInstructionCache();
|
||||
}
|
||||
|
||||
void ARM_NCE::ClearExclusiveState() {
|
||||
// No-op.
|
||||
}
|
||||
|
||||
void ARM_NCE::PageTableChanged(Common::PageTable& page_table,
|
||||
std::size_t new_address_space_size_in_bits) {
|
||||
// No-op. Page table is never used.
|
||||
}
|
||||
|
||||
} // namespace Core
|
||||
|
|
|
@ -3,11 +3,7 @@
|
|||
|
||||
#pragma once
|
||||
|
||||
#include <atomic>
|
||||
#include <memory>
|
||||
#include <span>
|
||||
#include <unordered_map>
|
||||
#include <vector>
|
||||
#include <mutex>
|
||||
|
||||
#include "core/arm/arm_interface.h"
|
||||
#include "core/arm/nce/guest_context.h"
|
||||
|
@ -20,51 +16,36 @@ namespace Core {
|
|||
|
||||
class System;
|
||||
|
||||
class ARM_NCE final : public ARM_Interface {
|
||||
class ArmNce final : public ArmInterface {
|
||||
public:
|
||||
ARM_NCE(System& system_, bool uses_wall_clock_, std::size_t core_index_);
|
||||
|
||||
~ARM_NCE() override;
|
||||
ArmNce(System& system, bool uses_wall_clock, std::size_t core_index);
|
||||
~ArmNce() override;
|
||||
|
||||
void Initialize() override;
|
||||
void SetPC(u64 pc) override;
|
||||
u64 GetPC() const override;
|
||||
u64 GetSP() const override;
|
||||
u64 GetReg(int index) const override;
|
||||
void SetReg(int index, u64 value) override;
|
||||
u128 GetVectorReg(int index) const override;
|
||||
void SetVectorReg(int index, u128 value) override;
|
||||
|
||||
u32 GetPSTATE() const override;
|
||||
void SetPSTATE(u32 pstate) override;
|
||||
u64 GetTlsAddress() const override;
|
||||
void SetTlsAddress(u64 address) override;
|
||||
void SetTPIDR_EL0(u64 value) override;
|
||||
u64 GetTPIDR_EL0() const override;
|
||||
|
||||
Architecture GetArchitecture() const override {
|
||||
return Architecture::Aarch64;
|
||||
return Architecture::AArch64;
|
||||
}
|
||||
|
||||
void SaveContext(ThreadContext32& ctx) const override {}
|
||||
void SaveContext(ThreadContext64& ctx) const override;
|
||||
void LoadContext(const ThreadContext32& ctx) override {}
|
||||
void LoadContext(const ThreadContext64& ctx) override;
|
||||
HaltReason RunThread(Kernel::KThread* thread) override;
|
||||
HaltReason StepThread(Kernel::KThread* thread) override;
|
||||
|
||||
void SignalInterrupt() override;
|
||||
void ClearInterrupt() override;
|
||||
void ClearExclusiveState() override;
|
||||
void ClearInstructionCache() override;
|
||||
void InvalidateCacheRange(u64 addr, std::size_t size) override;
|
||||
void PageTableChanged(Common::PageTable& new_page_table,
|
||||
std::size_t new_address_space_size_in_bits) override;
|
||||
|
||||
protected:
|
||||
HaltReason RunJit() override;
|
||||
HaltReason StepJit() override;
|
||||
void GetContext(Kernel::Svc::ThreadContext& ctx) const override;
|
||||
void SetContext(const Kernel::Svc::ThreadContext& ctx) override;
|
||||
void SetTpidrroEl0(u64 value) override;
|
||||
|
||||
void GetSvcArguments(std::span<uint64_t, 8> args) const override;
|
||||
void SetSvcArguments(std::span<const uint64_t, 8> args) override;
|
||||
u32 GetSvcNumber() const override;
|
||||
|
||||
void SignalInterrupt(Kernel::KThread* thread) override;
|
||||
void ClearInstructionCache() override;
|
||||
void InvalidateCacheRange(u64 addr, std::size_t size) override;
|
||||
|
||||
void LockThread(Kernel::KThread* thread) override;
|
||||
void UnlockThread(Kernel::KThread* thread) override;
|
||||
|
||||
protected:
|
||||
const Kernel::DebugWatchpoint* HaltedWatchpoint() const override {
|
||||
return nullptr;
|
||||
}
|
||||
|
@ -93,16 +74,15 @@ private:
|
|||
static void HandleHostFault(int sig, void* info, void* raw_context);
|
||||
|
||||
public:
|
||||
Core::System& m_system;
|
||||
|
||||
// Members set on initialization.
|
||||
std::size_t core_index{};
|
||||
pid_t thread_id{-1};
|
||||
std::size_t m_core_index{};
|
||||
pid_t m_thread_id{-1};
|
||||
|
||||
// Core context.
|
||||
GuestContext guest_ctx;
|
||||
|
||||
// Thread and invalidation info.
|
||||
std::mutex lock;
|
||||
Kernel::KThread* running_thread{};
|
||||
GuestContext m_guest_ctx{};
|
||||
Kernel::KThread* m_running_thread{};
|
||||
};
|
||||
|
||||
} // namespace Core
|
||||
|
|
|
@ -8,11 +8,11 @@
|
|||
movk reg, #(((val) >> 0x10) & 0xFFFF), lsl #16
|
||||
|
||||
|
||||
/* static HaltReason Core::ARM_NCE::ReturnToRunCodeByTrampoline(void* tpidr, Core::GuestContext* ctx, u64 trampoline_addr) */
|
||||
.section .text._ZN4Core7ARM_NCE27ReturnToRunCodeByTrampolineEPvPNS_12GuestContextEm, "ax", %progbits
|
||||
.global _ZN4Core7ARM_NCE27ReturnToRunCodeByTrampolineEPvPNS_12GuestContextEm
|
||||
.type _ZN4Core7ARM_NCE27ReturnToRunCodeByTrampolineEPvPNS_12GuestContextEm, %function
|
||||
_ZN4Core7ARM_NCE27ReturnToRunCodeByTrampolineEPvPNS_12GuestContextEm:
|
||||
/* static HaltReason Core::ArmNce::ReturnToRunCodeByTrampoline(void* tpidr, Core::GuestContext* ctx, u64 trampoline_addr) */
|
||||
.section .text._ZN4Core6ArmNce27ReturnToRunCodeByTrampolineEPvPNS_12GuestContextEm, "ax", %progbits
|
||||
.global _ZN4Core6ArmNce27ReturnToRunCodeByTrampolineEPvPNS_12GuestContextEm
|
||||
.type _ZN4Core6ArmNce27ReturnToRunCodeByTrampolineEPvPNS_12GuestContextEm, %function
|
||||
_ZN4Core6ArmNce27ReturnToRunCodeByTrampolineEPvPNS_12GuestContextEm:
|
||||
/* Back up host sp to x3. */
|
||||
/* Back up host tpidr_el0 to x4. */
|
||||
mov x3, sp
|
||||
|
@ -49,11 +49,11 @@ _ZN4Core7ARM_NCE27ReturnToRunCodeByTrampolineEPvPNS_12GuestContextEm:
|
|||
br x2
|
||||
|
||||
|
||||
/* static HaltReason Core::ARM_NCE::ReturnToRunCodeByExceptionLevelChange(int tid, void* tpidr) */
|
||||
.section .text._ZN4Core7ARM_NCE37ReturnToRunCodeByExceptionLevelChangeEiPv, "ax", %progbits
|
||||
.global _ZN4Core7ARM_NCE37ReturnToRunCodeByExceptionLevelChangeEiPv
|
||||
.type _ZN4Core7ARM_NCE37ReturnToRunCodeByExceptionLevelChangeEiPv, %function
|
||||
_ZN4Core7ARM_NCE37ReturnToRunCodeByExceptionLevelChangeEiPv:
|
||||
/* static HaltReason Core::ArmNce::ReturnToRunCodeByExceptionLevelChange(int tid, void* tpidr) */
|
||||
.section .text._ZN4Core6ArmNce37ReturnToRunCodeByExceptionLevelChangeEiPv, "ax", %progbits
|
||||
.global _ZN4Core6ArmNce37ReturnToRunCodeByExceptionLevelChangeEiPv
|
||||
.type _ZN4Core6ArmNce37ReturnToRunCodeByExceptionLevelChangeEiPv, %function
|
||||
_ZN4Core6ArmNce37ReturnToRunCodeByExceptionLevelChangeEiPv:
|
||||
/* This jumps to the signal handler, which will restore the entire context. */
|
||||
/* On entry, x0 = thread id, which is already in the right place. */
|
||||
|
||||
|
@ -71,17 +71,17 @@ _ZN4Core7ARM_NCE37ReturnToRunCodeByExceptionLevelChangeEiPv:
|
|||
brk #1000
|
||||
|
||||
|
||||
/* static void Core::ARM_NCE::ReturnToRunCodeByExceptionLevelChangeSignalHandler(int sig, void* info, void* raw_context) */
|
||||
.section .text._ZN4Core7ARM_NCE50ReturnToRunCodeByExceptionLevelChangeSignalHandlerEiPvS1_, "ax", %progbits
|
||||
.global _ZN4Core7ARM_NCE50ReturnToRunCodeByExceptionLevelChangeSignalHandlerEiPvS1_
|
||||
.type _ZN4Core7ARM_NCE50ReturnToRunCodeByExceptionLevelChangeSignalHandlerEiPvS1_, %function
|
||||
_ZN4Core7ARM_NCE50ReturnToRunCodeByExceptionLevelChangeSignalHandlerEiPvS1_:
|
||||
/* static void Core::ArmNce::ReturnToRunCodeByExceptionLevelChangeSignalHandler(int sig, void* info, void* raw_context) */
|
||||
.section .text._ZN4Core6ArmNce50ReturnToRunCodeByExceptionLevelChangeSignalHandlerEiPvS1_, "ax", %progbits
|
||||
.global _ZN4Core6ArmNce50ReturnToRunCodeByExceptionLevelChangeSignalHandlerEiPvS1_
|
||||
.type _ZN4Core6ArmNce50ReturnToRunCodeByExceptionLevelChangeSignalHandlerEiPvS1_, %function
|
||||
_ZN4Core6ArmNce50ReturnToRunCodeByExceptionLevelChangeSignalHandlerEiPvS1_:
|
||||
stp x29, x30, [sp, #-0x10]!
|
||||
mov x29, sp
|
||||
|
||||
/* Call the context restorer with the raw context. */
|
||||
mov x0, x2
|
||||
bl _ZN4Core7ARM_NCE19RestoreGuestContextEPv
|
||||
bl _ZN4Core6ArmNce19RestoreGuestContextEPv
|
||||
|
||||
/* Save the old value of tpidr_el0. */
|
||||
mrs x8, tpidr_el0
|
||||
|
@ -92,18 +92,18 @@ _ZN4Core7ARM_NCE50ReturnToRunCodeByExceptionLevelChangeSignalHandlerEiPvS1_:
|
|||
msr tpidr_el0, x0
|
||||
|
||||
/* Unlock the context. */
|
||||
bl _ZN4Core7ARM_NCE22UnlockThreadParametersEPv
|
||||
bl _ZN4Core6ArmNce22UnlockThreadParametersEPv
|
||||
|
||||
/* Returning from here will enter the guest. */
|
||||
ldp x29, x30, [sp], #0x10
|
||||
ret
|
||||
|
||||
|
||||
/* static void Core::ARM_NCE::BreakFromRunCodeSignalHandler(int sig, void* info, void* raw_context) */
|
||||
.section .text._ZN4Core7ARM_NCE29BreakFromRunCodeSignalHandlerEiPvS1_, "ax", %progbits
|
||||
.global _ZN4Core7ARM_NCE29BreakFromRunCodeSignalHandlerEiPvS1_
|
||||
.type _ZN4Core7ARM_NCE29BreakFromRunCodeSignalHandlerEiPvS1_, %function
|
||||
_ZN4Core7ARM_NCE29BreakFromRunCodeSignalHandlerEiPvS1_:
|
||||
/* static void Core::ArmNce::BreakFromRunCodeSignalHandler(int sig, void* info, void* raw_context) */
|
||||
.section .text._ZN4Core6ArmNce29BreakFromRunCodeSignalHandlerEiPvS1_, "ax", %progbits
|
||||
.global _ZN4Core6ArmNce29BreakFromRunCodeSignalHandlerEiPvS1_
|
||||
.type _ZN4Core6ArmNce29BreakFromRunCodeSignalHandlerEiPvS1_, %function
|
||||
_ZN4Core6ArmNce29BreakFromRunCodeSignalHandlerEiPvS1_:
|
||||
/* Check to see if we have the correct TLS magic. */
|
||||
mrs x8, tpidr_el0
|
||||
ldr w9, [x8, #(TpidrEl0TlsMagic)]
|
||||
|
@ -121,7 +121,7 @@ _ZN4Core7ARM_NCE29BreakFromRunCodeSignalHandlerEiPvS1_:
|
|||
|
||||
/* Tail call the restorer. */
|
||||
mov x1, x2
|
||||
b _ZN4Core7ARM_NCE16SaveGuestContextEPNS_12GuestContextEPv
|
||||
b _ZN4Core6ArmNce16SaveGuestContextEPNS_12GuestContextEPv
|
||||
|
||||
/* Returning from here will enter host code. */
|
||||
|
||||
|
@ -130,11 +130,11 @@ _ZN4Core7ARM_NCE29BreakFromRunCodeSignalHandlerEiPvS1_:
|
|||
ret
|
||||
|
||||
|
||||
/* static void Core::ARM_NCE::GuestFaultSignalHandler(int sig, void* info, void* raw_context) */
|
||||
.section .text._ZN4Core7ARM_NCE23GuestFaultSignalHandlerEiPvS1_, "ax", %progbits
|
||||
.global _ZN4Core7ARM_NCE23GuestFaultSignalHandlerEiPvS1_
|
||||
.type _ZN4Core7ARM_NCE23GuestFaultSignalHandlerEiPvS1_, %function
|
||||
_ZN4Core7ARM_NCE23GuestFaultSignalHandlerEiPvS1_:
|
||||
/* static void Core::ArmNce::GuestFaultSignalHandler(int sig, void* info, void* raw_context) */
|
||||
.section .text._ZN4Core6ArmNce23GuestFaultSignalHandlerEiPvS1_, "ax", %progbits
|
||||
.global _ZN4Core6ArmNce23GuestFaultSignalHandlerEiPvS1_
|
||||
.type _ZN4Core6ArmNce23GuestFaultSignalHandlerEiPvS1_, %function
|
||||
_ZN4Core6ArmNce23GuestFaultSignalHandlerEiPvS1_:
|
||||
/* Check to see if we have the correct TLS magic. */
|
||||
mrs x8, tpidr_el0
|
||||
ldr w9, [x8, #(TpidrEl0TlsMagic)]
|
||||
|
@ -146,7 +146,7 @@ _ZN4Core7ARM_NCE23GuestFaultSignalHandlerEiPvS1_:
|
|||
|
||||
/* Incorrect TLS magic, so this is a host fault. */
|
||||
/* Tail call the handler. */
|
||||
b _ZN4Core7ARM_NCE15HandleHostFaultEiPvS1_
|
||||
b _ZN4Core6ArmNce15HandleHostFaultEiPvS1_
|
||||
|
||||
1:
|
||||
/* Correct TLS magic, so this is a guest fault. */
|
||||
|
@ -163,7 +163,7 @@ _ZN4Core7ARM_NCE23GuestFaultSignalHandlerEiPvS1_:
|
|||
msr tpidr_el0, x3
|
||||
|
||||
/* Call the handler. */
|
||||
bl _ZN4Core7ARM_NCE16HandleGuestFaultEPNS_12GuestContextEPvS3_
|
||||
bl _ZN4Core6ArmNce16HandleGuestFaultEPNS_12GuestContextEPvS3_
|
||||
|
||||
/* If the handler returned false, we want to preserve the host tpidr_el0. */
|
||||
cbz x0, 2f
|
||||
|
@ -177,11 +177,11 @@ _ZN4Core7ARM_NCE23GuestFaultSignalHandlerEiPvS1_:
|
|||
ret
|
||||
|
||||
|
||||
/* static void Core::ARM_NCE::LockThreadParameters(void* tpidr) */
|
||||
.section .text._ZN4Core7ARM_NCE20LockThreadParametersEPv, "ax", %progbits
|
||||
.global _ZN4Core7ARM_NCE20LockThreadParametersEPv
|
||||
.type _ZN4Core7ARM_NCE20LockThreadParametersEPv, %function
|
||||
_ZN4Core7ARM_NCE20LockThreadParametersEPv:
|
||||
/* static void Core::ArmNce::LockThreadParameters(void* tpidr) */
|
||||
.section .text._ZN4Core6ArmNce20LockThreadParametersEPv, "ax", %progbits
|
||||
.global _ZN4Core6ArmNce20LockThreadParametersEPv
|
||||
.type _ZN4Core6ArmNce20LockThreadParametersEPv, %function
|
||||
_ZN4Core6ArmNce20LockThreadParametersEPv:
|
||||
/* Offset to lock member. */
|
||||
add x0, x0, #(TpidrEl0Lock)
|
||||
|
||||
|
@ -205,11 +205,11 @@ _ZN4Core7ARM_NCE20LockThreadParametersEPv:
|
|||
ret
|
||||
|
||||
|
||||
/* static void Core::ARM_NCE::UnlockThreadParameters(void* tpidr) */
|
||||
.section .text._ZN4Core7ARM_NCE22UnlockThreadParametersEPv, "ax", %progbits
|
||||
.global _ZN4Core7ARM_NCE22UnlockThreadParametersEPv
|
||||
.type _ZN4Core7ARM_NCE22UnlockThreadParametersEPv, %function
|
||||
_ZN4Core7ARM_NCE22UnlockThreadParametersEPv:
|
||||
/* static void Core::ArmNce::UnlockThreadParameters(void* tpidr) */
|
||||
.section .text._ZN4Core6ArmNce22UnlockThreadParametersEPv, "ax", %progbits
|
||||
.global _ZN4Core6ArmNce22UnlockThreadParametersEPv
|
||||
.type _ZN4Core6ArmNce22UnlockThreadParametersEPv, %function
|
||||
_ZN4Core6ArmNce22UnlockThreadParametersEPv:
|
||||
/* Offset to lock member. */
|
||||
add x0, x0, #(TpidrEl0Lock)
|
||||
|
||||
|
|
|
@ -3,6 +3,8 @@
|
|||
|
||||
#pragma once
|
||||
|
||||
#include <atomic>
|
||||
|
||||
#include "common/common_funcs.h"
|
||||
#include "common/common_types.h"
|
||||
#include "core/arm/arm_interface.h"
|
||||
|
@ -10,7 +12,7 @@
|
|||
|
||||
namespace Core {
|
||||
|
||||
class ARM_NCE;
|
||||
class ArmNce;
|
||||
class System;
|
||||
|
||||
struct HostContext {
|
||||
|
@ -33,9 +35,9 @@ struct GuestContext {
|
|||
u64 tpidr_el0{};
|
||||
std::atomic<u64> esr_el1{};
|
||||
u32 nzcv{};
|
||||
u32 svc_swi{};
|
||||
u32 svc{};
|
||||
System* system{};
|
||||
ARM_NCE* parent{};
|
||||
ArmNce* parent{};
|
||||
};
|
||||
|
||||
// Verify assembly offsets.
|
||||
|
|
|
@ -280,7 +280,7 @@ void Patcher::WriteSvcTrampoline(ModuleDestLabel module_dest, u32 svc_id) {
|
|||
|
||||
// Store SVC number to execute when we return
|
||||
c.MOV(X2, svc_id);
|
||||
c.STR(W2, X1, offsetof(GuestContext, svc_swi));
|
||||
c.STR(W2, X1, offsetof(GuestContext, svc));
|
||||
|
||||
// We are calling a SVC. Clear esr_el1 and return it.
|
||||
static_assert(std::is_same_v<std::underlying_type_t<HaltReason>, u64>);
|
||||
|
|
|
@ -323,7 +323,6 @@ struct System::Impl {
|
|||
static_cast<u32>(SystemResultStatus::ErrorLoader) + static_cast<u32>(load_result));
|
||||
}
|
||||
AddGlueRegistrationForProcess(*app_loader, *main_process);
|
||||
kernel.InitializeCores();
|
||||
|
||||
// Initialize cheat engine
|
||||
if (cheat_engine) {
|
||||
|
@ -600,14 +599,6 @@ bool System::IsPaused() const {
|
|||
return impl->IsPaused();
|
||||
}
|
||||
|
||||
void System::InvalidateCpuInstructionCaches() {
|
||||
impl->kernel.InvalidateAllInstructionCaches();
|
||||
}
|
||||
|
||||
void System::InvalidateCpuInstructionCacheRange(u64 addr, std::size_t size) {
|
||||
impl->kernel.InvalidateCpuInstructionCacheRange(addr, size);
|
||||
}
|
||||
|
||||
void System::ShutdownMainProcess() {
|
||||
impl->ShutdownMainProcess();
|
||||
}
|
||||
|
@ -696,14 +687,6 @@ const TelemetrySession& System::TelemetrySession() const {
|
|||
return *impl->telemetry_session;
|
||||
}
|
||||
|
||||
ARM_Interface& System::CurrentArmInterface() {
|
||||
return impl->kernel.CurrentPhysicalCore().ArmInterface();
|
||||
}
|
||||
|
||||
const ARM_Interface& System::CurrentArmInterface() const {
|
||||
return impl->kernel.CurrentPhysicalCore().ArmInterface();
|
||||
}
|
||||
|
||||
Kernel::PhysicalCore& System::CurrentPhysicalCore() {
|
||||
return impl->kernel.CurrentPhysicalCore();
|
||||
}
|
||||
|
@ -738,14 +721,6 @@ const Kernel::KProcess* System::ApplicationProcess() const {
|
|||
return impl->kernel.ApplicationProcess();
|
||||
}
|
||||
|
||||
ARM_Interface& System::ArmInterface(std::size_t core_index) {
|
||||
return impl->kernel.PhysicalCore(core_index).ArmInterface();
|
||||
}
|
||||
|
||||
const ARM_Interface& System::ArmInterface(std::size_t core_index) const {
|
||||
return impl->kernel.PhysicalCore(core_index).ArmInterface();
|
||||
}
|
||||
|
||||
ExclusiveMonitor& System::Monitor() {
|
||||
return impl->kernel.GetExclusiveMonitor();
|
||||
}
|
||||
|
|
|
@ -108,7 +108,6 @@ class RenderdocAPI;
|
|||
|
||||
namespace Core {
|
||||
|
||||
class ARM_Interface;
|
||||
class CpuManager;
|
||||
class Debugger;
|
||||
class DeviceMemory;
|
||||
|
@ -171,15 +170,6 @@ public:
|
|||
/// Check if the core is currently paused.
|
||||
[[nodiscard]] bool IsPaused() const;
|
||||
|
||||
/**
|
||||
* Invalidate the CPU instruction caches
|
||||
* This function should only be used by GDB Stub to support breakpoints, memory updates and
|
||||
* step/continue commands.
|
||||
*/
|
||||
void InvalidateCpuInstructionCaches();
|
||||
|
||||
void InvalidateCpuInstructionCacheRange(u64 addr, std::size_t size);
|
||||
|
||||
/// Shutdown the main emulated process.
|
||||
void ShutdownMainProcess();
|
||||
|
||||
|
@ -244,24 +234,12 @@ public:
|
|||
/// Gets and resets core performance statistics
|
||||
[[nodiscard]] PerfStatsResults GetAndResetPerfStats();
|
||||
|
||||
/// Gets an ARM interface to the CPU core that is currently running
|
||||
[[nodiscard]] ARM_Interface& CurrentArmInterface();
|
||||
|
||||
/// Gets an ARM interface to the CPU core that is currently running
|
||||
[[nodiscard]] const ARM_Interface& CurrentArmInterface() const;
|
||||
|
||||
/// Gets the physical core for the CPU core that is currently running
|
||||
[[nodiscard]] Kernel::PhysicalCore& CurrentPhysicalCore();
|
||||
|
||||
/// Gets the physical core for the CPU core that is currently running
|
||||
[[nodiscard]] const Kernel::PhysicalCore& CurrentPhysicalCore() const;
|
||||
|
||||
/// Gets a reference to an ARM interface for the CPU core with the specified index
|
||||
[[nodiscard]] ARM_Interface& ArmInterface(std::size_t core_index);
|
||||
|
||||
/// Gets a const reference to an ARM interface from the CPU core with the specified index
|
||||
[[nodiscard]] const ARM_Interface& ArmInterface(std::size_t core_index) const;
|
||||
|
||||
/// Gets a reference to the underlying CPU manager.
|
||||
[[nodiscard]] CpuManager& GetCpuManager();
|
||||
|
||||
|
|
|
@ -73,12 +73,13 @@ void CpuManager::HandleInterrupt() {
|
|||
void CpuManager::MultiCoreRunGuestThread() {
|
||||
// Similar to UserModeThreadStarter in HOS
|
||||
auto& kernel = system.Kernel();
|
||||
auto* thread = Kernel::GetCurrentThreadPointer(kernel);
|
||||
kernel.CurrentScheduler()->OnThreadStart();
|
||||
|
||||
while (true) {
|
||||
auto* physical_core = &kernel.CurrentPhysicalCore();
|
||||
while (!physical_core->IsInterrupted()) {
|
||||
physical_core->Run();
|
||||
physical_core->RunThread(thread);
|
||||
physical_core = &kernel.CurrentPhysicalCore();
|
||||
}
|
||||
|
||||
|
@ -110,12 +111,13 @@ void CpuManager::MultiCoreRunIdleThread() {
|
|||
|
||||
void CpuManager::SingleCoreRunGuestThread() {
|
||||
auto& kernel = system.Kernel();
|
||||
auto* thread = Kernel::GetCurrentThreadPointer(kernel);
|
||||
kernel.CurrentScheduler()->OnThreadStart();
|
||||
|
||||
while (true) {
|
||||
auto* physical_core = &kernel.CurrentPhysicalCore();
|
||||
if (!physical_core->IsInterrupted()) {
|
||||
physical_core->Run();
|
||||
physical_core->RunThread(thread);
|
||||
physical_core = &kernel.CurrentPhysicalCore();
|
||||
}
|
||||
|
||||
|
@ -211,8 +213,6 @@ void CpuManager::RunThread(std::stop_token token, std::size_t core) {
|
|||
system.GPU().ObtainContext();
|
||||
}
|
||||
|
||||
system.ArmInterface(core).Initialize();
|
||||
|
||||
auto& kernel = system.Kernel();
|
||||
auto& scheduler = *kernel.CurrentScheduler();
|
||||
auto* thread = scheduler.GetSchedulerCurrentThread();
|
||||
|
|
|
@ -16,6 +16,7 @@
|
|||
#include "common/settings.h"
|
||||
#include "common/string_util.h"
|
||||
#include "core/arm/arm_interface.h"
|
||||
#include "core/arm/debug.h"
|
||||
#include "core/core.h"
|
||||
#include "core/debugger/gdbstub.h"
|
||||
#include "core/debugger/gdbstub_arch.h"
|
||||
|
@ -310,7 +311,7 @@ void GDBStub::ExecuteCommand(std::string_view packet, std::vector<DebuggerAction
|
|||
const auto mem{Common::HexStringToVector(mem_substr, false)};
|
||||
|
||||
if (system.ApplicationMemory().WriteBlock(addr, mem.data(), size)) {
|
||||
system.InvalidateCpuInstructionCacheRange(addr, size);
|
||||
Core::InvalidateInstructionCacheRange(system.ApplicationProcess(), addr, size);
|
||||
SendReply(GDB_STUB_REPLY_OK);
|
||||
} else {
|
||||
SendReply(GDB_STUB_REPLY_ERR);
|
||||
|
@ -363,7 +364,7 @@ void GDBStub::HandleBreakpointInsert(std::string_view command) {
|
|||
case BreakpointType::Software:
|
||||
replaced_instructions[addr] = system.ApplicationMemory().Read32(addr);
|
||||
system.ApplicationMemory().Write32(addr, arch->BreakpointInstruction());
|
||||
system.InvalidateCpuInstructionCacheRange(addr, sizeof(u32));
|
||||
Core::InvalidateInstructionCacheRange(system.ApplicationProcess(), addr, sizeof(u32));
|
||||
success = true;
|
||||
break;
|
||||
case BreakpointType::WriteWatch:
|
||||
|
@ -411,7 +412,7 @@ void GDBStub::HandleBreakpointRemove(std::string_view command) {
|
|||
const auto orig_insn{replaced_instructions.find(addr)};
|
||||
if (orig_insn != replaced_instructions.end()) {
|
||||
system.ApplicationMemory().Write32(addr, orig_insn->second);
|
||||
system.InvalidateCpuInstructionCacheRange(addr, sizeof(u32));
|
||||
Core::InvalidateInstructionCacheRange(system.ApplicationProcess(), addr, sizeof(u32));
|
||||
replaced_instructions.erase(addr);
|
||||
success = true;
|
||||
}
|
||||
|
@ -442,114 +443,6 @@ void GDBStub::HandleBreakpointRemove(std::string_view command) {
|
|||
}
|
||||
}
|
||||
|
||||
// Structure offsets are from Atmosphere
|
||||
// See osdbg_thread_local_region.os.horizon.hpp and osdbg_thread_type.os.horizon.hpp
|
||||
|
||||
static std::optional<std::string> GetNameFromThreadType32(Core::Memory::Memory& memory,
|
||||
const Kernel::KThread& thread) {
|
||||
// Read thread type from TLS
|
||||
const VAddr tls_thread_type{memory.Read32(thread.GetTlsAddress() + 0x1fc)};
|
||||
const VAddr argument_thread_type{thread.GetArgument()};
|
||||
|
||||
if (argument_thread_type && tls_thread_type != argument_thread_type) {
|
||||
// Probably not created by nnsdk, no name available.
|
||||
return std::nullopt;
|
||||
}
|
||||
|
||||
if (!tls_thread_type) {
|
||||
return std::nullopt;
|
||||
}
|
||||
|
||||
const u16 version{memory.Read16(tls_thread_type + 0x26)};
|
||||
VAddr name_pointer{};
|
||||
if (version == 1) {
|
||||
name_pointer = memory.Read32(tls_thread_type + 0xe4);
|
||||
} else {
|
||||
name_pointer = memory.Read32(tls_thread_type + 0xe8);
|
||||
}
|
||||
|
||||
if (!name_pointer) {
|
||||
// No name provided.
|
||||
return std::nullopt;
|
||||
}
|
||||
|
||||
return memory.ReadCString(name_pointer, 256);
|
||||
}
|
||||
|
||||
static std::optional<std::string> GetNameFromThreadType64(Core::Memory::Memory& memory,
|
||||
const Kernel::KThread& thread) {
|
||||
// Read thread type from TLS
|
||||
const VAddr tls_thread_type{memory.Read64(thread.GetTlsAddress() + 0x1f8)};
|
||||
const VAddr argument_thread_type{thread.GetArgument()};
|
||||
|
||||
if (argument_thread_type && tls_thread_type != argument_thread_type) {
|
||||
// Probably not created by nnsdk, no name available.
|
||||
return std::nullopt;
|
||||
}
|
||||
|
||||
if (!tls_thread_type) {
|
||||
return std::nullopt;
|
||||
}
|
||||
|
||||
const u16 version{memory.Read16(tls_thread_type + 0x46)};
|
||||
VAddr name_pointer{};
|
||||
if (version == 1) {
|
||||
name_pointer = memory.Read64(tls_thread_type + 0x1a0);
|
||||
} else {
|
||||
name_pointer = memory.Read64(tls_thread_type + 0x1a8);
|
||||
}
|
||||
|
||||
if (!name_pointer) {
|
||||
// No name provided.
|
||||
return std::nullopt;
|
||||
}
|
||||
|
||||
return memory.ReadCString(name_pointer, 256);
|
||||
}
|
||||
|
||||
static std::optional<std::string> GetThreadName(Core::System& system,
|
||||
const Kernel::KThread& thread) {
|
||||
if (system.ApplicationProcess()->Is64Bit()) {
|
||||
return GetNameFromThreadType64(system.ApplicationMemory(), thread);
|
||||
} else {
|
||||
return GetNameFromThreadType32(system.ApplicationMemory(), thread);
|
||||
}
|
||||
}
|
||||
|
||||
static std::string_view GetThreadWaitReason(const Kernel::KThread& thread) {
|
||||
switch (thread.GetWaitReasonForDebugging()) {
|
||||
case Kernel::ThreadWaitReasonForDebugging::Sleep:
|
||||
return "Sleep";
|
||||
case Kernel::ThreadWaitReasonForDebugging::IPC:
|
||||
return "IPC";
|
||||
case Kernel::ThreadWaitReasonForDebugging::Synchronization:
|
||||
return "Synchronization";
|
||||
case Kernel::ThreadWaitReasonForDebugging::ConditionVar:
|
||||
return "ConditionVar";
|
||||
case Kernel::ThreadWaitReasonForDebugging::Arbitration:
|
||||
return "Arbitration";
|
||||
case Kernel::ThreadWaitReasonForDebugging::Suspended:
|
||||
return "Suspended";
|
||||
default:
|
||||
return "Unknown";
|
||||
}
|
||||
}
|
||||
|
||||
static std::string GetThreadState(const Kernel::KThread& thread) {
|
||||
switch (thread.GetState()) {
|
||||
case Kernel::ThreadState::Initialized:
|
||||
return "Initialized";
|
||||
case Kernel::ThreadState::Waiting:
|
||||
return fmt::format("Waiting ({})", GetThreadWaitReason(thread));
|
||||
case Kernel::ThreadState::Runnable:
|
||||
return "Runnable";
|
||||
case Kernel::ThreadState::Terminated:
|
||||
return "Terminated";
|
||||
default:
|
||||
return "Unknown";
|
||||
}
|
||||
}
|
||||
|
||||
static std::string PaginateBuffer(std::string_view buffer, std::string_view request) {
|
||||
const auto amount{request.substr(request.find(',') + 1)};
|
||||
const auto offset_val{static_cast<u64>(strtoll(request.data(), nullptr, 16))};
|
||||
|
@ -562,120 +455,6 @@ static std::string PaginateBuffer(std::string_view buffer, std::string_view requ
|
|||
}
|
||||
}
|
||||
|
||||
static VAddr GetModuleEnd(Kernel::KProcessPageTable& page_table, VAddr base) {
|
||||
Kernel::KMemoryInfo mem_info;
|
||||
Kernel::Svc::MemoryInfo svc_mem_info;
|
||||
Kernel::Svc::PageInfo page_info;
|
||||
VAddr cur_addr{base};
|
||||
|
||||
// Expect: r-x Code (.text)
|
||||
R_ASSERT(page_table.QueryInfo(std::addressof(mem_info), std::addressof(page_info), cur_addr));
|
||||
svc_mem_info = mem_info.GetSvcMemoryInfo();
|
||||
cur_addr = svc_mem_info.base_address + svc_mem_info.size;
|
||||
if (svc_mem_info.state != Kernel::Svc::MemoryState::Code ||
|
||||
svc_mem_info.permission != Kernel::Svc::MemoryPermission::ReadExecute) {
|
||||
return cur_addr - 1;
|
||||
}
|
||||
|
||||
// Expect: r-- Code (.rodata)
|
||||
R_ASSERT(page_table.QueryInfo(std::addressof(mem_info), std::addressof(page_info), cur_addr));
|
||||
svc_mem_info = mem_info.GetSvcMemoryInfo();
|
||||
cur_addr = svc_mem_info.base_address + svc_mem_info.size;
|
||||
if (svc_mem_info.state != Kernel::Svc::MemoryState::Code ||
|
||||
svc_mem_info.permission != Kernel::Svc::MemoryPermission::Read) {
|
||||
return cur_addr - 1;
|
||||
}
|
||||
|
||||
// Expect: rw- CodeData (.data)
|
||||
R_ASSERT(page_table.QueryInfo(std::addressof(mem_info), std::addressof(page_info), cur_addr));
|
||||
svc_mem_info = mem_info.GetSvcMemoryInfo();
|
||||
cur_addr = svc_mem_info.base_address + svc_mem_info.size;
|
||||
return cur_addr - 1;
|
||||
}
|
||||
|
||||
static Loader::AppLoader::Modules FindModules(Core::System& system) {
|
||||
Loader::AppLoader::Modules modules;
|
||||
|
||||
auto& page_table = system.ApplicationProcess()->GetPageTable();
|
||||
auto& memory = system.ApplicationMemory();
|
||||
VAddr cur_addr = 0;
|
||||
|
||||
// Look for executable sections in Code or AliasCode regions.
|
||||
while (true) {
|
||||
Kernel::KMemoryInfo mem_info{};
|
||||
Kernel::Svc::PageInfo page_info{};
|
||||
R_ASSERT(
|
||||
page_table.QueryInfo(std::addressof(mem_info), std::addressof(page_info), cur_addr));
|
||||
auto svc_mem_info = mem_info.GetSvcMemoryInfo();
|
||||
|
||||
if (svc_mem_info.permission == Kernel::Svc::MemoryPermission::ReadExecute &&
|
||||
(svc_mem_info.state == Kernel::Svc::MemoryState::Code ||
|
||||
svc_mem_info.state == Kernel::Svc::MemoryState::AliasCode)) {
|
||||
// Try to read the module name from its path.
|
||||
constexpr s32 PathLengthMax = 0x200;
|
||||
struct {
|
||||
u32 zero;
|
||||
s32 path_length;
|
||||
std::array<char, PathLengthMax> path;
|
||||
} module_path;
|
||||
|
||||
if (memory.ReadBlock(svc_mem_info.base_address + svc_mem_info.size, &module_path,
|
||||
sizeof(module_path))) {
|
||||
if (module_path.zero == 0 && module_path.path_length > 0) {
|
||||
// Truncate module name.
|
||||
module_path.path[PathLengthMax - 1] = '\0';
|
||||
|
||||
// Ignore leading directories.
|
||||
char* path_pointer = module_path.path.data();
|
||||
|
||||
for (s32 i = 0; i < std::min(PathLengthMax, module_path.path_length) &&
|
||||
module_path.path[i] != '\0';
|
||||
i++) {
|
||||
if (module_path.path[i] == '/' || module_path.path[i] == '\\') {
|
||||
path_pointer = module_path.path.data() + i + 1;
|
||||
}
|
||||
}
|
||||
|
||||
// Insert output.
|
||||
modules.emplace(svc_mem_info.base_address, path_pointer);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Check if we're done.
|
||||
const uintptr_t next_address = svc_mem_info.base_address + svc_mem_info.size;
|
||||
if (next_address <= cur_addr) {
|
||||
break;
|
||||
}
|
||||
|
||||
cur_addr = next_address;
|
||||
}
|
||||
|
||||
return modules;
|
||||
}
|
||||
|
||||
static VAddr FindMainModuleEntrypoint(Core::System& system) {
|
||||
Loader::AppLoader::Modules modules;
|
||||
system.GetAppLoader().ReadNSOModules(modules);
|
||||
|
||||
// Do we have a module named main?
|
||||
const auto main = std::find_if(modules.begin(), modules.end(),
|
||||
[](const auto& key) { return key.second == "main"; });
|
||||
|
||||
if (main != modules.end()) {
|
||||
return main->first;
|
||||
}
|
||||
|
||||
// Do we have any loaded executable sections?
|
||||
modules = FindModules(system);
|
||||
if (!modules.empty()) {
|
||||
return modules.begin()->first;
|
||||
}
|
||||
|
||||
// As a last resort, use the start of the code region.
|
||||
return GetInteger(system.ApplicationProcess()->GetPageTable().GetCodeRegionStart());
|
||||
}
|
||||
|
||||
void GDBStub::HandleQuery(std::string_view command) {
|
||||
if (command.starts_with("TStatus")) {
|
||||
// no tracepoint support
|
||||
|
@ -687,10 +466,10 @@ void GDBStub::HandleQuery(std::string_view command) {
|
|||
const auto target_xml{arch->GetTargetXML()};
|
||||
SendReply(PaginateBuffer(target_xml, command.substr(30)));
|
||||
} else if (command.starts_with("Offsets")) {
|
||||
const auto main_offset = FindMainModuleEntrypoint(system);
|
||||
SendReply(fmt::format("TextSeg={:x}", main_offset));
|
||||
const auto main_offset = Core::FindMainModuleEntrypoint(system.ApplicationProcess());
|
||||
SendReply(fmt::format("TextSeg={:x}", GetInteger(main_offset)));
|
||||
} else if (command.starts_with("Xfer:libraries:read::")) {
|
||||
auto modules = FindModules(system);
|
||||
auto modules = Core::FindModules(system.ApplicationProcess());
|
||||
|
||||
std::string buffer;
|
||||
buffer += R"(<?xml version="1.0"?>)";
|
||||
|
@ -720,14 +499,14 @@ void GDBStub::HandleQuery(std::string_view command) {
|
|||
|
||||
const auto& threads = system.ApplicationProcess()->GetThreadList();
|
||||
for (const auto& thread : threads) {
|
||||
auto thread_name{GetThreadName(system, thread)};
|
||||
auto thread_name{Core::GetThreadName(&thread)};
|
||||
if (!thread_name) {
|
||||
thread_name = fmt::format("Thread {:d}", thread.GetThreadId());
|
||||
}
|
||||
|
||||
buffer += fmt::format(R"(<thread id="{:x}" core="{:d}" name="{}">{}</thread>)",
|
||||
thread.GetThreadId(), thread.GetActiveCore(),
|
||||
EscapeXML(*thread_name), GetThreadState(thread));
|
||||
EscapeXML(*thread_name), GetThreadState(&thread));
|
||||
}
|
||||
|
||||
buffer += "</threads>";
|
||||
|
@ -856,7 +635,7 @@ void GDBStub::HandleRcmd(const std::vector<u8>& command) {
|
|||
reply = "Fastmem is not enabled.\n";
|
||||
}
|
||||
} else if (command_str == "get info") {
|
||||
auto modules = FindModules(system);
|
||||
auto modules = Core::FindModules(process);
|
||||
|
||||
reply = fmt::format("Process: {:#x} ({})\n"
|
||||
"Program Id: {:#018x}\n",
|
||||
|
@ -880,7 +659,7 @@ void GDBStub::HandleRcmd(const std::vector<u8>& command) {
|
|||
|
||||
for (const auto& [vaddr, name] : modules) {
|
||||
reply += fmt::format(" {:#012x} - {:#012x} {}\n", vaddr,
|
||||
GetModuleEnd(page_table, vaddr), name);
|
||||
GetInteger(Core::GetModuleEnd(process, vaddr)), name);
|
||||
}
|
||||
} else if (command_str == "get mappings") {
|
||||
reply = "Mappings:\n";
|
||||
|
|
|
@ -24,21 +24,6 @@ static std::string ValueToHex(const T value) {
|
|||
return Common::HexToString(mem);
|
||||
}
|
||||
|
||||
template <typename T>
|
||||
static T GetSIMDRegister(const std::array<u32, 64>& simd_regs, size_t offset) {
|
||||
static_assert(std::is_trivially_copyable_v<T>);
|
||||
T value{};
|
||||
std::memcpy(&value, reinterpret_cast<const u8*>(simd_regs.data()) + sizeof(T) * offset,
|
||||
sizeof(T));
|
||||
return value;
|
||||
}
|
||||
|
||||
template <typename T>
|
||||
static void PutSIMDRegister(std::array<u32, 64>& simd_regs, size_t offset, const T value) {
|
||||
static_assert(std::is_trivially_copyable_v<T>);
|
||||
std::memcpy(reinterpret_cast<u8*>(simd_regs.data()) + sizeof(T) * offset, &value, sizeof(T));
|
||||
}
|
||||
|
||||
// For sample XML files see the GDB source /gdb/features
|
||||
// This XML defines what the registers are for this specific ARM device
|
||||
std::string_view GDBStubA64::GetTargetXML() const {
|
||||
|
@ -184,12 +169,16 @@ std::string GDBStubA64::RegRead(const Kernel::KThread* thread, size_t id) const
|
|||
return "";
|
||||
}
|
||||
|
||||
const auto& context{thread->GetContext64()};
|
||||
const auto& gprs{context.cpu_registers};
|
||||
const auto& fprs{context.vector_registers};
|
||||
const auto& context{thread->GetContext()};
|
||||
const auto& gprs{context.r};
|
||||
const auto& fprs{context.v};
|
||||
|
||||
if (id < SP_REGISTER) {
|
||||
if (id < FP_REGISTER) {
|
||||
return ValueToHex(gprs[id]);
|
||||
} else if (id == FP_REGISTER) {
|
||||
return ValueToHex(context.fp);
|
||||
} else if (id == LR_REGISTER) {
|
||||
return ValueToHex(context.lr);
|
||||
} else if (id == SP_REGISTER) {
|
||||
return ValueToHex(context.sp);
|
||||
} else if (id == PC_REGISTER) {
|
||||
|
@ -212,10 +201,14 @@ void GDBStubA64::RegWrite(Kernel::KThread* thread, size_t id, std::string_view v
|
|||
return;
|
||||
}
|
||||
|
||||
auto& context{thread->GetContext64()};
|
||||
auto& context{thread->GetContext()};
|
||||
|
||||
if (id < SP_REGISTER) {
|
||||
context.cpu_registers[id] = HexToValue<u64>(value);
|
||||
if (id < FP_REGISTER) {
|
||||
context.r[id] = HexToValue<u64>(value);
|
||||
} else if (id == FP_REGISTER) {
|
||||
context.fp = HexToValue<u64>(value);
|
||||
} else if (id == LR_REGISTER) {
|
||||
context.lr = HexToValue<u64>(value);
|
||||
} else if (id == SP_REGISTER) {
|
||||
context.sp = HexToValue<u64>(value);
|
||||
} else if (id == PC_REGISTER) {
|
||||
|
@ -223,7 +216,7 @@ void GDBStubA64::RegWrite(Kernel::KThread* thread, size_t id, std::string_view v
|
|||
} else if (id == PSTATE_REGISTER) {
|
||||
context.pstate = HexToValue<u32>(value);
|
||||
} else if (id >= Q0_REGISTER && id < FPSR_REGISTER) {
|
||||
context.vector_registers[id - Q0_REGISTER] = HexToValue<u128>(value);
|
||||
context.v[id - Q0_REGISTER] = HexToValue<u128>(value);
|
||||
} else if (id == FPSR_REGISTER) {
|
||||
context.fpsr = HexToValue<u32>(value);
|
||||
} else if (id == FPCR_REGISTER) {
|
||||
|
@ -381,22 +374,20 @@ std::string GDBStubA32::RegRead(const Kernel::KThread* thread, size_t id) const
|
|||
return "";
|
||||
}
|
||||
|
||||
const auto& context{thread->GetContext32()};
|
||||
const auto& gprs{context.cpu_registers};
|
||||
const auto& fprs{context.extension_registers};
|
||||
const auto& context{thread->GetContext()};
|
||||
const auto& gprs{context.r};
|
||||
const auto& fprs{context.v};
|
||||
|
||||
if (id <= PC_REGISTER) {
|
||||
return ValueToHex(gprs[id]);
|
||||
return ValueToHex(static_cast<u32>(gprs[id]));
|
||||
} else if (id == CPSR_REGISTER) {
|
||||
return ValueToHex(context.cpsr);
|
||||
return ValueToHex(context.pstate);
|
||||
} else if (id >= D0_REGISTER && id < Q0_REGISTER) {
|
||||
const u64 dN{GetSIMDRegister<u64>(fprs, id - D0_REGISTER)};
|
||||
return ValueToHex(dN);
|
||||
return ValueToHex(fprs[id - D0_REGISTER][0]);
|
||||
} else if (id >= Q0_REGISTER && id < FPSCR_REGISTER) {
|
||||
const u128 qN{GetSIMDRegister<u128>(fprs, id - Q0_REGISTER)};
|
||||
return ValueToHex(qN);
|
||||
return ValueToHex(fprs[id - Q0_REGISTER]);
|
||||
} else if (id == FPSCR_REGISTER) {
|
||||
return ValueToHex(context.fpscr);
|
||||
return ValueToHex(context.fpcr | context.fpsr);
|
||||
} else {
|
||||
return "";
|
||||
}
|
||||
|
@ -407,19 +398,20 @@ void GDBStubA32::RegWrite(Kernel::KThread* thread, size_t id, std::string_view v
|
|||
return;
|
||||
}
|
||||
|
||||
auto& context{thread->GetContext32()};
|
||||
auto& fprs{context.extension_registers};
|
||||
auto& context{thread->GetContext()};
|
||||
auto& fprs{context.v};
|
||||
|
||||
if (id <= PC_REGISTER) {
|
||||
context.cpu_registers[id] = HexToValue<u32>(value);
|
||||
context.r[id] = HexToValue<u32>(value);
|
||||
} else if (id == CPSR_REGISTER) {
|
||||
context.cpsr = HexToValue<u32>(value);
|
||||
context.pstate = HexToValue<u32>(value);
|
||||
} else if (id >= D0_REGISTER && id < Q0_REGISTER) {
|
||||
PutSIMDRegister(fprs, id - D0_REGISTER, HexToValue<u64>(value));
|
||||
fprs[id - D0_REGISTER] = {HexToValue<u64>(value), 0};
|
||||
} else if (id >= Q0_REGISTER && id < FPSCR_REGISTER) {
|
||||
PutSIMDRegister(fprs, id - Q0_REGISTER, HexToValue<u128>(value));
|
||||
fprs[id - Q0_REGISTER] = HexToValue<u128>(value);
|
||||
} else if (id == FPSCR_REGISTER) {
|
||||
context.fpscr = HexToValue<u32>(value);
|
||||
context.fpcr = HexToValue<u32>(value);
|
||||
context.fpsr = HexToValue<u32>(value);
|
||||
}
|
||||
}
|
||||
|
||||
|
|
|
@ -36,6 +36,7 @@ public:
|
|||
u32 BreakpointInstruction() const override;
|
||||
|
||||
private:
|
||||
static constexpr u32 FP_REGISTER = 29;
|
||||
static constexpr u32 LR_REGISTER = 30;
|
||||
static constexpr u32 SP_REGISTER = 31;
|
||||
static constexpr u32 PC_REGISTER = 32;
|
||||
|
|
|
@ -69,8 +69,16 @@ public:
|
|||
};
|
||||
|
||||
template <typename AddressType>
|
||||
void InvalidateInstructionCache(Core::System& system, AddressType addr, u64 size) {
|
||||
system.InvalidateCpuInstructionCacheRange(GetInteger(addr), size);
|
||||
void InvalidateInstructionCache(KernelCore& kernel, AddressType addr, u64 size) {
|
||||
// TODO: lock the process list
|
||||
for (auto& process : kernel.GetProcessList()) {
|
||||
for (size_t i = 0; i < Core::Hardware::NUM_CPU_CORES; i++) {
|
||||
auto* interface = process->GetArmInterface(i);
|
||||
if (interface) {
|
||||
interface->InvalidateCacheRange(GetInteger(addr), size);
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
template <typename AddressType>
|
||||
|
@ -1261,7 +1269,7 @@ Result KPageTableBase::UnmapCodeMemory(KProcessAddress dst_address, KProcessAddr
|
|||
bool reprotected_pages = false;
|
||||
SCOPE_EXIT({
|
||||
if (reprotected_pages && any_code_pages) {
|
||||
InvalidateInstructionCache(m_system, dst_address, size);
|
||||
InvalidateInstructionCache(m_kernel, dst_address, size);
|
||||
}
|
||||
});
|
||||
|
||||
|
@ -1997,7 +2005,7 @@ Result KPageTableBase::SetProcessMemoryPermission(KProcessAddress addr, size_t s
|
|||
for (const auto& block : pg) {
|
||||
StoreDataCache(GetHeapVirtualPointer(m_kernel, block.GetAddress()), block.GetSize());
|
||||
}
|
||||
InvalidateInstructionCache(m_system, addr, size);
|
||||
InvalidateInstructionCache(m_kernel, addr, size);
|
||||
}
|
||||
|
||||
R_SUCCEED();
|
||||
|
@ -3239,7 +3247,7 @@ Result KPageTableBase::WriteDebugMemory(KProcessAddress dst_address, KProcessAdd
|
|||
R_TRY(PerformCopy());
|
||||
|
||||
// Invalidate the instruction cache, as this svc allows modifying executable pages.
|
||||
InvalidateInstructionCache(m_system, dst_address, size);
|
||||
InvalidateInstructionCache(m_kernel, dst_address, size);
|
||||
|
||||
R_SUCCEED();
|
||||
}
|
||||
|
|
|
@ -13,6 +13,12 @@
|
|||
#include "core/hle/kernel/k_thread_queue.h"
|
||||
#include "core/hle/kernel/k_worker_task_manager.h"
|
||||
|
||||
#include "core/arm/dynarmic/arm_dynarmic_32.h"
|
||||
#include "core/arm/dynarmic/arm_dynarmic_64.h"
|
||||
#ifdef HAS_NCE
|
||||
#include "core/arm/nce/arm_nce.h"
|
||||
#endif
|
||||
|
||||
namespace Kernel {
|
||||
|
||||
namespace {
|
||||
|
@ -957,10 +963,8 @@ Result KProcess::Run(s32 priority, size_t stack_size) {
|
|||
R_TRY(m_handle_table.Add(std::addressof(thread_handle), main_thread));
|
||||
|
||||
// Set the thread arguments.
|
||||
main_thread->GetContext32().cpu_registers[0] = 0;
|
||||
main_thread->GetContext64().cpu_registers[0] = 0;
|
||||
main_thread->GetContext32().cpu_registers[1] = thread_handle;
|
||||
main_thread->GetContext64().cpu_registers[1] = thread_handle;
|
||||
main_thread->GetContext().r[0] = 0;
|
||||
main_thread->GetContext().r[1] = thread_handle;
|
||||
|
||||
// Update our state.
|
||||
this->ChangeState((state == State::Created) ? State::Running : State::RunningAttached);
|
||||
|
@ -1199,6 +1203,9 @@ Result KProcess::LoadFromMetadata(const FileSys::ProgramMetadata& metadata, std:
|
|||
m_is_hbl = is_hbl;
|
||||
m_ideal_core_id = metadata.GetMainThreadCore();
|
||||
|
||||
// Set up emulation context.
|
||||
this->InitializeInterfaces();
|
||||
|
||||
// We succeeded.
|
||||
R_SUCCEED();
|
||||
}
|
||||
|
@ -1227,6 +1234,31 @@ void KProcess::LoadModule(CodeSet code_set, KProcessAddress base_addr) {
|
|||
#endif
|
||||
}
|
||||
|
||||
void KProcess::InitializeInterfaces() {
|
||||
this->GetMemory().SetCurrentPageTable(*this);
|
||||
|
||||
#ifdef HAS_NCE
|
||||
if (this->Is64Bit() && Settings::IsNceEnabled()) {
|
||||
for (size_t i = 0; i < Core::Hardware::NUM_CPU_CORES; i++) {
|
||||
m_arm_interfaces[i] = std::make_unique<Core::ArmNce>(m_kernel.System(), true, i);
|
||||
}
|
||||
} else
|
||||
#endif
|
||||
if (this->Is64Bit()) {
|
||||
for (size_t i = 0; i < Core::Hardware::NUM_CPU_CORES; i++) {
|
||||
m_arm_interfaces[i] = std::make_unique<Core::ArmDynarmic64>(
|
||||
m_kernel.System(), m_kernel.IsMulticore(), this,
|
||||
static_cast<Core::DynarmicExclusiveMonitor&>(m_kernel.GetExclusiveMonitor()), i);
|
||||
}
|
||||
} else {
|
||||
for (size_t i = 0; i < Core::Hardware::NUM_CPU_CORES; i++) {
|
||||
m_arm_interfaces[i] = std::make_unique<Core::ArmDynarmic32>(
|
||||
m_kernel.System(), m_kernel.IsMulticore(), this,
|
||||
static_cast<Core::DynarmicExclusiveMonitor&>(m_kernel.GetExclusiveMonitor()), i);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
bool KProcess::InsertWatchpoint(KProcessAddress addr, u64 size, DebugWatchpointType type) {
|
||||
const auto watch{std::find_if(m_watchpoints.begin(), m_watchpoints.end(), [&](const auto& wp) {
|
||||
return wp.type == DebugWatchpointType::None;
|
||||
|
|
|
@ -5,6 +5,7 @@
|
|||
|
||||
#include <map>
|
||||
|
||||
#include "core/arm/arm_interface.h"
|
||||
#include "core/file_sys/program_metadata.h"
|
||||
#include "core/hle/kernel/code_set.h"
|
||||
#include "core/hle/kernel/k_address_arbiter.h"
|
||||
|
@ -106,6 +107,8 @@ private:
|
|||
bool m_is_suspended{};
|
||||
bool m_is_immortal{};
|
||||
bool m_is_handle_table_initialized{};
|
||||
std::array<std::unique_ptr<Core::ArmInterface>, Core::Hardware::NUM_CPU_CORES>
|
||||
m_arm_interfaces{};
|
||||
std::array<KThread*, Core::Hardware::NUM_CPU_CORES> m_running_threads{};
|
||||
std::array<u64, Core::Hardware::NUM_CPU_CORES> m_running_thread_idle_counts{};
|
||||
std::array<u64, Core::Hardware::NUM_CPU_CORES> m_running_thread_switch_counts{};
|
||||
|
@ -476,6 +479,10 @@ public:
|
|||
}
|
||||
#endif
|
||||
|
||||
Core::ArmInterface* GetArmInterface(size_t core_index) const {
|
||||
return m_arm_interfaces[core_index].get();
|
||||
}
|
||||
|
||||
public:
|
||||
// Attempts to insert a watchpoint into a free slot. Returns false if none are available.
|
||||
bool InsertWatchpoint(KProcessAddress addr, u64 size, DebugWatchpointType type);
|
||||
|
@ -493,6 +500,8 @@ public:
|
|||
|
||||
void LoadModule(CodeSet code_set, KProcessAddress base_addr);
|
||||
|
||||
void InitializeInterfaces();
|
||||
|
||||
Core::Memory::Memory& GetMemory() const;
|
||||
|
||||
public:
|
||||
|
|
|
@ -7,10 +7,6 @@
|
|||
#include "core/hle/kernel/k_scoped_lock.h"
|
||||
#include "core/hle/kernel/svc_types.h"
|
||||
|
||||
namespace Core {
|
||||
class ARM_Interface;
|
||||
}
|
||||
|
||||
namespace Kernel {
|
||||
|
||||
class KProcessPageTable {
|
||||
|
|
|
@ -494,12 +494,7 @@ void KScheduler::ScheduleImplFiber() {
|
|||
}
|
||||
|
||||
void KScheduler::Unload(KThread* thread) {
|
||||
auto& cpu_core = m_kernel.System().ArmInterface(m_core_id);
|
||||
cpu_core.SaveContext(thread->GetContext32());
|
||||
cpu_core.SaveContext(thread->GetContext64());
|
||||
// Save the TPIDR_EL0 system register in case it was modified.
|
||||
thread->SetTpidrEl0(cpu_core.GetTPIDR_EL0());
|
||||
cpu_core.ClearExclusiveState();
|
||||
m_kernel.PhysicalCore(m_core_id).SaveContext(thread);
|
||||
|
||||
// Check if the thread is terminated by checking the DPC flags.
|
||||
if ((thread->GetStackParameters().dpc_flags & static_cast<u32>(DpcFlag::Terminated)) == 0) {
|
||||
|
@ -509,14 +504,7 @@ void KScheduler::Unload(KThread* thread) {
|
|||
}
|
||||
|
||||
void KScheduler::Reload(KThread* thread) {
|
||||
auto& cpu_core = m_kernel.System().ArmInterface(m_core_id);
|
||||
auto* process = thread->GetOwnerProcess();
|
||||
cpu_core.LoadContext(thread->GetContext32());
|
||||
cpu_core.LoadContext(thread->GetContext64());
|
||||
cpu_core.SetTlsAddress(GetInteger(thread->GetTlsAddress()));
|
||||
cpu_core.SetTPIDR_EL0(thread->GetTpidrEl0());
|
||||
cpu_core.LoadWatchpointArray(process ? &process->GetWatchpoints() : nullptr);
|
||||
cpu_core.ClearExclusiveState();
|
||||
m_kernel.PhysicalCore(m_core_id).LoadContext(thread);
|
||||
}
|
||||
|
||||
void KScheduler::ClearPreviousThread(KernelCore& kernel, KThread* thread) {
|
||||
|
|
|
@ -41,24 +41,25 @@ namespace {
|
|||
|
||||
constexpr inline s32 TerminatingThreadPriority = Kernel::Svc::SystemThreadPriorityHighest - 1;
|
||||
|
||||
static void ResetThreadContext32(Kernel::KThread::ThreadContext32& context, u32 stack_top,
|
||||
u32 entry_point, u32 arg) {
|
||||
context = {};
|
||||
context.cpu_registers[0] = arg;
|
||||
context.cpu_registers[15] = entry_point;
|
||||
context.cpu_registers[13] = stack_top;
|
||||
context.fpscr = 0;
|
||||
static void ResetThreadContext32(Kernel::Svc::ThreadContext& ctx, u64 stack_top, u64 entry_point,
|
||||
u64 arg) {
|
||||
ctx = {};
|
||||
ctx.r[0] = arg;
|
||||
ctx.r[15] = entry_point;
|
||||
ctx.r[13] = stack_top;
|
||||
ctx.fpcr = 0;
|
||||
ctx.fpsr = 0;
|
||||
}
|
||||
|
||||
static void ResetThreadContext64(Kernel::KThread::ThreadContext64& context, u64 stack_top,
|
||||
u64 entry_point, u64 arg) {
|
||||
context = {};
|
||||
context.cpu_registers[0] = arg;
|
||||
context.cpu_registers[18] = Kernel::KSystemControl::GenerateRandomU64() | 1;
|
||||
context.pc = entry_point;
|
||||
context.sp = stack_top;
|
||||
context.fpcr = 0;
|
||||
context.fpsr = 0;
|
||||
static void ResetThreadContext64(Kernel::Svc::ThreadContext& ctx, u64 stack_top, u64 entry_point,
|
||||
u64 arg) {
|
||||
ctx = {};
|
||||
ctx.r[0] = arg;
|
||||
ctx.r[18] = Kernel::KSystemControl::GenerateRandomU64() | 1;
|
||||
ctx.pc = entry_point;
|
||||
ctx.sp = stack_top;
|
||||
ctx.fpcr = 0;
|
||||
ctx.fpsr = 0;
|
||||
}
|
||||
} // namespace
|
||||
|
||||
|
@ -223,9 +224,11 @@ Result KThread::Initialize(KThreadFunction func, uintptr_t arg, KProcessAddress
|
|||
}
|
||||
|
||||
// Initialize thread context.
|
||||
ResetThreadContext64(m_thread_context_64, GetInteger(user_stack_top), GetInteger(func), arg);
|
||||
ResetThreadContext32(m_thread_context_32, static_cast<u32>(GetInteger(user_stack_top)),
|
||||
static_cast<u32>(GetInteger(func)), static_cast<u32>(arg));
|
||||
if (m_parent != nullptr && !m_parent->Is64Bit()) {
|
||||
ResetThreadContext32(m_thread_context, GetInteger(user_stack_top), GetInteger(func), arg);
|
||||
} else {
|
||||
ResetThreadContext64(m_thread_context, GetInteger(user_stack_top), GetInteger(func), arg);
|
||||
}
|
||||
|
||||
// Setup the stack parameters.
|
||||
StackParameters& sp = this->GetStackParameters();
|
||||
|
@ -823,20 +826,7 @@ void KThread::CloneFpuStatus() {
|
|||
ASSERT(this->GetOwnerProcess() != nullptr);
|
||||
ASSERT(this->GetOwnerProcess() == GetCurrentProcessPointer(m_kernel));
|
||||
|
||||
if (this->GetOwnerProcess()->Is64Bit()) {
|
||||
// Clone FPSR and FPCR.
|
||||
ThreadContext64 cur_ctx{};
|
||||
m_kernel.System().CurrentArmInterface().SaveContext(cur_ctx);
|
||||
|
||||
this->GetContext64().fpcr = cur_ctx.fpcr;
|
||||
this->GetContext64().fpsr = cur_ctx.fpsr;
|
||||
} else {
|
||||
// Clone FPSCR.
|
||||
ThreadContext32 cur_ctx{};
|
||||
m_kernel.System().CurrentArmInterface().SaveContext(cur_ctx);
|
||||
|
||||
this->GetContext32().fpscr = cur_ctx.fpscr;
|
||||
}
|
||||
m_kernel.CurrentPhysicalCore().CloneFpuStatus(this);
|
||||
}
|
||||
|
||||
Result KThread::SetActivity(Svc::ThreadActivity activity) {
|
||||
|
@ -912,7 +902,7 @@ Result KThread::SetActivity(Svc::ThreadActivity activity) {
|
|||
R_SUCCEED();
|
||||
}
|
||||
|
||||
Result KThread::GetThreadContext3(Common::ScratchBuffer<u8>& out) {
|
||||
Result KThread::GetThreadContext3(Svc::ThreadContext* out) {
|
||||
// Lock ourselves.
|
||||
KScopedLightLock lk{m_activity_pause_lock};
|
||||
|
||||
|
@ -926,18 +916,16 @@ Result KThread::GetThreadContext3(Common::ScratchBuffer<u8>& out) {
|
|||
|
||||
// If we're not terminating, get the thread's user context.
|
||||
if (!this->IsTerminationRequested()) {
|
||||
*out = m_thread_context;
|
||||
|
||||
// Mask away mode bits, interrupt bits, IL bit, and other reserved bits.
|
||||
constexpr u32 El0Aarch64PsrMask = 0xF0000000;
|
||||
constexpr u32 El0Aarch32PsrMask = 0xFE0FFE20;
|
||||
|
||||
if (m_parent->Is64Bit()) {
|
||||
// Mask away mode bits, interrupt bits, IL bit, and other reserved bits.
|
||||
auto context = GetContext64();
|
||||
context.pstate &= 0xFF0FFE20;
|
||||
out.resize_destructive(sizeof(context));
|
||||
std::memcpy(out.data(), std::addressof(context), sizeof(context));
|
||||
out->pstate &= El0Aarch64PsrMask;
|
||||
} else {
|
||||
// Mask away mode bits, interrupt bits, IL bit, and other reserved bits.
|
||||
auto context = GetContext32();
|
||||
context.cpsr &= 0xFF0FFE20;
|
||||
out.resize_destructive(sizeof(context));
|
||||
std::memcpy(out.data(), std::addressof(context), sizeof(context));
|
||||
out->pstate &= El0Aarch32PsrMask;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
|
|
@ -38,7 +38,6 @@ namespace Core {
|
|||
namespace Memory {
|
||||
class Memory;
|
||||
}
|
||||
class ARM_Interface;
|
||||
class System;
|
||||
} // namespace Core
|
||||
|
||||
|
@ -137,8 +136,6 @@ public:
|
|||
~KThread() override;
|
||||
|
||||
public:
|
||||
using ThreadContext32 = Core::ARM_Interface::ThreadContext32;
|
||||
using ThreadContext64 = Core::ARM_Interface::ThreadContext64;
|
||||
using WaiterList = Common::IntrusiveListBaseTraits<KThread>::ListType;
|
||||
|
||||
/**
|
||||
|
@ -246,31 +243,22 @@ public:
|
|||
* @returns The value of the TPIDR_EL0 register.
|
||||
*/
|
||||
u64 GetTpidrEl0() const {
|
||||
return m_thread_context_64.tpidr;
|
||||
return m_thread_context.tpidr;
|
||||
}
|
||||
|
||||
/// Sets the value of the TPIDR_EL0 Read/Write system register for this thread.
|
||||
void SetTpidrEl0(u64 value) {
|
||||
m_thread_context_64.tpidr = value;
|
||||
m_thread_context_32.tpidr = static_cast<u32>(value);
|
||||
m_thread_context.tpidr = value;
|
||||
}
|
||||
|
||||
void CloneFpuStatus();
|
||||
|
||||
ThreadContext32& GetContext32() {
|
||||
return m_thread_context_32;
|
||||
Svc::ThreadContext& GetContext() {
|
||||
return m_thread_context;
|
||||
}
|
||||
|
||||
const ThreadContext32& GetContext32() const {
|
||||
return m_thread_context_32;
|
||||
}
|
||||
|
||||
ThreadContext64& GetContext64() {
|
||||
return m_thread_context_64;
|
||||
}
|
||||
|
||||
const ThreadContext64& GetContext64() const {
|
||||
return m_thread_context_64;
|
||||
const Svc::ThreadContext& GetContext() const {
|
||||
return m_thread_context;
|
||||
}
|
||||
|
||||
std::shared_ptr<Common::Fiber>& GetHostContext();
|
||||
|
@ -577,7 +565,7 @@ public:
|
|||
|
||||
void RemoveWaiter(KThread* thread);
|
||||
|
||||
Result GetThreadContext3(Common::ScratchBuffer<u8>& out);
|
||||
Result GetThreadContext3(Svc::ThreadContext* out);
|
||||
|
||||
KThread* RemoveUserWaiterByKey(bool* out_has_waiters, KProcessAddress key) {
|
||||
return this->RemoveWaiterByKey(out_has_waiters, key, false);
|
||||
|
@ -734,8 +722,7 @@ private:
|
|||
std::function<void()>&& init_func);
|
||||
|
||||
// For core KThread implementation
|
||||
ThreadContext32 m_thread_context_32{};
|
||||
ThreadContext64 m_thread_context_64{};
|
||||
Svc::ThreadContext m_thread_context{};
|
||||
Common::IntrusiveListNode m_process_list_node;
|
||||
Common::IntrusiveRedBlackTreeNode m_condvar_arbiter_tree_node{};
|
||||
s32 m_priority{};
|
||||
|
|
|
@ -99,13 +99,6 @@ struct KernelCore::Impl {
|
|||
RegisterHostThread(nullptr);
|
||||
}
|
||||
|
||||
void InitializeCores() {
|
||||
for (u32 core_id = 0; core_id < Core::Hardware::NUM_CPU_CORES; core_id++) {
|
||||
cores[core_id]->Initialize((*application_process).Is64Bit());
|
||||
system.ApplicationMemory().SetCurrentPageTable(*application_process, core_id);
|
||||
}
|
||||
}
|
||||
|
||||
void TerminateApplicationProcess() {
|
||||
application_process.load()->Terminate();
|
||||
}
|
||||
|
@ -205,7 +198,7 @@ struct KernelCore::Impl {
|
|||
const s32 core{static_cast<s32>(i)};
|
||||
|
||||
schedulers[i] = std::make_unique<Kernel::KScheduler>(system.Kernel());
|
||||
cores[i] = std::make_unique<Kernel::PhysicalCore>(i, system, *schedulers[i]);
|
||||
cores[i] = std::make_unique<Kernel::PhysicalCore>(system.Kernel(), i);
|
||||
|
||||
auto* main_thread{Kernel::KThread::Create(system.Kernel())};
|
||||
main_thread->SetCurrentCore(core);
|
||||
|
@ -880,10 +873,6 @@ void KernelCore::Initialize() {
|
|||
impl->Initialize(*this);
|
||||
}
|
||||
|
||||
void KernelCore::InitializeCores() {
|
||||
impl->InitializeCores();
|
||||
}
|
||||
|
||||
void KernelCore::Shutdown() {
|
||||
impl->Shutdown();
|
||||
}
|
||||
|
@ -993,21 +982,6 @@ const KAutoObjectWithListContainer& KernelCore::ObjectListContainer() const {
|
|||
return *impl->global_object_list_container;
|
||||
}
|
||||
|
||||
void KernelCore::InvalidateAllInstructionCaches() {
|
||||
for (auto& physical_core : impl->cores) {
|
||||
physical_core->ArmInterface().ClearInstructionCache();
|
||||
}
|
||||
}
|
||||
|
||||
void KernelCore::InvalidateCpuInstructionCacheRange(KProcessAddress addr, std::size_t size) {
|
||||
for (auto& physical_core : impl->cores) {
|
||||
if (!physical_core->IsInitialized()) {
|
||||
continue;
|
||||
}
|
||||
physical_core->ArmInterface().InvalidateCacheRange(GetInteger(addr), size);
|
||||
}
|
||||
}
|
||||
|
||||
void KernelCore::PrepareReschedule(std::size_t id) {
|
||||
// TODO: Reimplement, this
|
||||
}
|
||||
|
|
|
@ -104,9 +104,6 @@ public:
|
|||
/// Resets the kernel to a clean slate for use.
|
||||
void Initialize();
|
||||
|
||||
/// Initializes the CPU cores.
|
||||
void InitializeCores();
|
||||
|
||||
/// Clears all resources in use by the kernel instance.
|
||||
void Shutdown();
|
||||
|
||||
|
@ -181,10 +178,6 @@ public:
|
|||
|
||||
const KAutoObjectWithListContainer& ObjectListContainer() const;
|
||||
|
||||
void InvalidateAllInstructionCaches();
|
||||
|
||||
void InvalidateCpuInstructionCacheRange(KProcessAddress addr, std::size_t size);
|
||||
|
||||
/// Registers all kernel objects with the global emulation state, this is purely for tracking
|
||||
/// leaks after emulation has been shutdown.
|
||||
void RegisterKernelObject(KAutoObject* object);
|
||||
|
|
|
@ -1,62 +1,206 @@
|
|||
// SPDX-FileCopyrightText: Copyright 2020 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
#include "common/scope_exit.h"
|
||||
#include "common/settings.h"
|
||||
#include "core/arm/dynarmic/arm_dynarmic_32.h"
|
||||
#include "core/arm/dynarmic/arm_dynarmic_64.h"
|
||||
#ifdef HAS_NCE
|
||||
#include "core/arm/nce/arm_nce.h"
|
||||
#endif
|
||||
#include "core/core.h"
|
||||
#include "core/hle/kernel/k_scheduler.h"
|
||||
#include "core/debugger/debugger.h"
|
||||
#include "core/hle/kernel/k_process.h"
|
||||
#include "core/hle/kernel/k_thread.h"
|
||||
#include "core/hle/kernel/kernel.h"
|
||||
#include "core/hle/kernel/physical_core.h"
|
||||
#include "core/hle/kernel/svc.h"
|
||||
|
||||
namespace Kernel {
|
||||
|
||||
PhysicalCore::PhysicalCore(std::size_t core_index, Core::System& system, KScheduler& scheduler)
|
||||
: m_core_index{core_index}, m_system{system}, m_scheduler{scheduler} {
|
||||
#if defined(ARCHITECTURE_x86_64) || defined(ARCHITECTURE_arm64)
|
||||
// TODO(bunnei): Initialization relies on a core being available. We may later replace this with
|
||||
// an NCE interface or a 32-bit instance of Dynarmic. This should be abstracted out to a CPU
|
||||
// manager.
|
||||
auto& kernel = system.Kernel();
|
||||
m_arm_interface = std::make_unique<Core::ARM_Dynarmic_64>(
|
||||
system, kernel.IsMulticore(),
|
||||
reinterpret_cast<Core::DynarmicExclusiveMonitor&>(kernel.GetExclusiveMonitor()),
|
||||
m_core_index);
|
||||
#else
|
||||
#error Platform not supported yet.
|
||||
#endif
|
||||
PhysicalCore::PhysicalCore(KernelCore& kernel, std::size_t core_index)
|
||||
: m_kernel{kernel}, m_core_index{core_index} {
|
||||
m_is_single_core = !kernel.IsMulticore();
|
||||
}
|
||||
|
||||
PhysicalCore::~PhysicalCore() = default;
|
||||
|
||||
void PhysicalCore::Initialize(bool is_64_bit) {
|
||||
#if defined(HAS_NCE)
|
||||
if (Settings::IsNceEnabled()) {
|
||||
m_arm_interface = std::make_unique<Core::ARM_NCE>(m_system, m_system.Kernel().IsMulticore(),
|
||||
m_core_index);
|
||||
void PhysicalCore::RunThread(Kernel::KThread* thread) {
|
||||
auto* process = thread->GetOwnerProcess();
|
||||
auto& system = m_kernel.System();
|
||||
auto* interface = process->GetArmInterface(m_core_index);
|
||||
|
||||
interface->Initialize();
|
||||
|
||||
const auto EnterContext = [&]() {
|
||||
system.EnterCPUProfile();
|
||||
|
||||
// Lock the core context.
|
||||
std::scoped_lock lk{m_guard};
|
||||
|
||||
// Check if we are already interrupted. If we are, we can just stop immediately.
|
||||
if (m_is_interrupted) {
|
||||
return false;
|
||||
}
|
||||
|
||||
// Mark that we are running.
|
||||
m_arm_interface = interface;
|
||||
m_current_thread = thread;
|
||||
|
||||
// Acquire the lock on the thread parameters.
|
||||
// This allows us to force synchronization with Interrupt.
|
||||
interface->LockThread(thread);
|
||||
|
||||
return true;
|
||||
};
|
||||
|
||||
const auto ExitContext = [&]() {
|
||||
// Unlock the thread.
|
||||
interface->UnlockThread(thread);
|
||||
|
||||
// Lock the core context.
|
||||
std::scoped_lock lk{m_guard};
|
||||
|
||||
// On exit, we no longer are running.
|
||||
m_arm_interface = nullptr;
|
||||
m_current_thread = nullptr;
|
||||
|
||||
system.ExitCPUProfile();
|
||||
};
|
||||
|
||||
while (true) {
|
||||
// If the thread is scheduled for termination, exit.
|
||||
if (thread->HasDpc() && thread->IsTerminationRequested()) {
|
||||
thread->Exit();
|
||||
}
|
||||
|
||||
// Notify the debugger and go to sleep if a step was performed
|
||||
// and this thread has been scheduled again.
|
||||
if (thread->GetStepState() == StepState::StepPerformed) {
|
||||
system.GetDebugger().NotifyThreadStopped(thread);
|
||||
thread->RequestSuspend(SuspendType::Debug);
|
||||
return;
|
||||
}
|
||||
|
||||
// Otherwise, run the thread.
|
||||
Core::HaltReason hr{};
|
||||
{
|
||||
// If we were interrupted, exit immediately.
|
||||
if (!EnterContext()) {
|
||||
return;
|
||||
}
|
||||
|
||||
if (thread->GetStepState() == StepState::StepPending) {
|
||||
hr = interface->StepThread(thread);
|
||||
|
||||
if (True(hr & Core::HaltReason::StepThread)) {
|
||||
thread->SetStepState(StepState::StepPerformed);
|
||||
}
|
||||
} else {
|
||||
hr = interface->RunThread(thread);
|
||||
}
|
||||
|
||||
ExitContext();
|
||||
}
|
||||
|
||||
// Determine why we stopped.
|
||||
const bool supervisor_call = True(hr & Core::HaltReason::SupervisorCall);
|
||||
const bool prefetch_abort = True(hr & Core::HaltReason::PrefetchAbort);
|
||||
const bool breakpoint = True(hr & Core::HaltReason::InstructionBreakpoint);
|
||||
const bool data_abort = True(hr & Core::HaltReason::DataAbort);
|
||||
const bool interrupt = True(hr & Core::HaltReason::BreakLoop);
|
||||
|
||||
// Since scheduling may occur here, we cannot use any cached
|
||||
// state after returning from calls we make.
|
||||
|
||||
// Notify the debugger and go to sleep if a breakpoint was hit,
|
||||
// or if the thread is unable to continue for any reason.
|
||||
if (breakpoint || prefetch_abort) {
|
||||
if (breakpoint) {
|
||||
interface->RewindBreakpointInstruction();
|
||||
}
|
||||
if (system.DebuggerEnabled()) {
|
||||
system.GetDebugger().NotifyThreadStopped(thread);
|
||||
} else {
|
||||
interface->LogBacktrace(process);
|
||||
}
|
||||
thread->RequestSuspend(SuspendType::Debug);
|
||||
return;
|
||||
}
|
||||
|
||||
// Notify the debugger and go to sleep on data abort.
|
||||
if (data_abort) {
|
||||
if (system.DebuggerEnabled()) {
|
||||
system.GetDebugger().NotifyThreadWatchpoint(thread, *interface->HaltedWatchpoint());
|
||||
}
|
||||
thread->RequestSuspend(SuspendType::Debug);
|
||||
return;
|
||||
}
|
||||
|
||||
// Handle system calls.
|
||||
if (supervisor_call) {
|
||||
// Perform call.
|
||||
Svc::Call(system, interface->GetSvcNumber());
|
||||
return;
|
||||
}
|
||||
|
||||
// Handle external interrupt sources.
|
||||
if (interrupt || !m_is_single_core) {
|
||||
return;
|
||||
}
|
||||
#endif
|
||||
#if defined(ARCHITECTURE_x86_64) || defined(ARCHITECTURE_arm64)
|
||||
auto& kernel = m_system.Kernel();
|
||||
if (!is_64_bit) {
|
||||
// We already initialized a 64-bit core, replace with a 32-bit one.
|
||||
m_arm_interface = std::make_unique<Core::ARM_Dynarmic_32>(
|
||||
m_system, kernel.IsMulticore(),
|
||||
reinterpret_cast<Core::DynarmicExclusiveMonitor&>(kernel.GetExclusiveMonitor()),
|
||||
m_core_index);
|
||||
}
|
||||
#else
|
||||
#error Platform not supported yet.
|
||||
#endif
|
||||
}
|
||||
|
||||
void PhysicalCore::Run() {
|
||||
m_arm_interface->Run();
|
||||
m_arm_interface->ClearExclusiveState();
|
||||
void PhysicalCore::LoadContext(const KThread* thread) {
|
||||
auto* const process = thread->GetOwnerProcess();
|
||||
if (!process) {
|
||||
// Kernel threads do not run on emulated CPU cores.
|
||||
return;
|
||||
}
|
||||
|
||||
auto* interface = process->GetArmInterface(m_core_index);
|
||||
if (interface) {
|
||||
interface->SetContext(thread->GetContext());
|
||||
interface->SetTpidrroEl0(GetInteger(thread->GetTlsAddress()));
|
||||
interface->SetWatchpointArray(&process->GetWatchpoints());
|
||||
}
|
||||
}
|
||||
|
||||
void PhysicalCore::LoadSvcArguments(const KProcess& process, std::span<const uint64_t, 8> args) {
|
||||
process.GetArmInterface(m_core_index)->SetSvcArguments(args);
|
||||
}
|
||||
|
||||
void PhysicalCore::SaveContext(KThread* thread) const {
|
||||
auto* const process = thread->GetOwnerProcess();
|
||||
if (!process) {
|
||||
// Kernel threads do not run on emulated CPU cores.
|
||||
return;
|
||||
}
|
||||
|
||||
auto* interface = process->GetArmInterface(m_core_index);
|
||||
if (interface) {
|
||||
interface->GetContext(thread->GetContext());
|
||||
}
|
||||
}
|
||||
|
||||
void PhysicalCore::SaveSvcArguments(KProcess& process, std::span<uint64_t, 8> args) const {
|
||||
process.GetArmInterface(m_core_index)->GetSvcArguments(args);
|
||||
}
|
||||
|
||||
void PhysicalCore::CloneFpuStatus(KThread* dst) const {
|
||||
auto* process = dst->GetOwnerProcess();
|
||||
|
||||
Svc::ThreadContext ctx{};
|
||||
process->GetArmInterface(m_core_index)->GetContext(ctx);
|
||||
|
||||
dst->GetContext().fpcr = ctx.fpcr;
|
||||
dst->GetContext().fpsr = ctx.fpsr;
|
||||
}
|
||||
|
||||
void PhysicalCore::LogBacktrace() {
|
||||
auto* process = GetCurrentProcessPointer(m_kernel);
|
||||
if (!process) {
|
||||
return;
|
||||
}
|
||||
|
||||
auto* interface = process->GetArmInterface(m_core_index);
|
||||
if (interface) {
|
||||
interface->LogBacktrace(process);
|
||||
}
|
||||
}
|
||||
|
||||
void PhysicalCore::Idle() {
|
||||
|
@ -69,16 +213,31 @@ bool PhysicalCore::IsInterrupted() const {
|
|||
}
|
||||
|
||||
void PhysicalCore::Interrupt() {
|
||||
std::unique_lock lk{m_guard};
|
||||
// Lock core context.
|
||||
std::scoped_lock lk{m_guard};
|
||||
|
||||
// Load members.
|
||||
auto* arm_interface = m_arm_interface;
|
||||
auto* thread = m_current_thread;
|
||||
|
||||
// Add interrupt flag.
|
||||
m_is_interrupted = true;
|
||||
m_arm_interface->SignalInterrupt();
|
||||
m_on_interrupt.notify_all();
|
||||
|
||||
// Interrupt ourselves.
|
||||
m_on_interrupt.notify_one();
|
||||
|
||||
// If there is no thread running, we are done.
|
||||
if (arm_interface == nullptr) {
|
||||
return;
|
||||
}
|
||||
|
||||
// Interrupt the CPU.
|
||||
arm_interface->SignalInterrupt(thread);
|
||||
}
|
||||
|
||||
void PhysicalCore::ClearInterrupt() {
|
||||
std::unique_lock lk{m_guard};
|
||||
std::scoped_lock lk{m_guard};
|
||||
m_is_interrupted = false;
|
||||
m_arm_interface->ClearInterrupt();
|
||||
}
|
||||
|
||||
} // namespace Kernel
|
||||
|
|
|
@ -11,7 +11,7 @@
|
|||
#include "core/arm/arm_interface.h"
|
||||
|
||||
namespace Kernel {
|
||||
class KScheduler;
|
||||
class KernelCore;
|
||||
} // namespace Kernel
|
||||
|
||||
namespace Core {
|
||||
|
@ -23,62 +23,55 @@ namespace Kernel {
|
|||
|
||||
class PhysicalCore {
|
||||
public:
|
||||
PhysicalCore(std::size_t core_index_, Core::System& system_, KScheduler& scheduler_);
|
||||
PhysicalCore(KernelCore& kernel, std::size_t core_index);
|
||||
~PhysicalCore();
|
||||
|
||||
YUZU_NON_COPYABLE(PhysicalCore);
|
||||
YUZU_NON_MOVEABLE(PhysicalCore);
|
||||
|
||||
/// Initialize the core for the specified parameters.
|
||||
void Initialize(bool is_64_bit);
|
||||
// Execute guest code running on the given thread.
|
||||
void RunThread(KThread* thread);
|
||||
|
||||
/// Execute current jit state
|
||||
void Run();
|
||||
// Copy context from thread to current core.
|
||||
void LoadContext(const KThread* thread);
|
||||
void LoadSvcArguments(const KProcess& process, std::span<const uint64_t, 8> args);
|
||||
|
||||
// Copy context from current core to thread.
|
||||
void SaveContext(KThread* thread) const;
|
||||
void SaveSvcArguments(KProcess& process, std::span<uint64_t, 8> args) const;
|
||||
|
||||
// Copy floating point status registers to the target thread.
|
||||
void CloneFpuStatus(KThread* dst) const;
|
||||
|
||||
// Log backtrace of current processor state.
|
||||
void LogBacktrace();
|
||||
|
||||
// Wait for an interrupt.
|
||||
void Idle();
|
||||
|
||||
/// Interrupt this physical core.
|
||||
// Interrupt this core.
|
||||
void Interrupt();
|
||||
|
||||
/// Clear this core's interrupt
|
||||
// Clear this core's interrupt.
|
||||
void ClearInterrupt();
|
||||
|
||||
/// Check if this core is interrupted
|
||||
// Check if this core is interrupted.
|
||||
bool IsInterrupted() const;
|
||||
|
||||
bool IsInitialized() const {
|
||||
return m_arm_interface != nullptr;
|
||||
}
|
||||
|
||||
Core::ARM_Interface& ArmInterface() {
|
||||
return *m_arm_interface;
|
||||
}
|
||||
|
||||
const Core::ARM_Interface& ArmInterface() const {
|
||||
return *m_arm_interface;
|
||||
}
|
||||
|
||||
std::size_t CoreIndex() const {
|
||||
return m_core_index;
|
||||
}
|
||||
|
||||
Kernel::KScheduler& Scheduler() {
|
||||
return m_scheduler;
|
||||
}
|
||||
|
||||
const Kernel::KScheduler& Scheduler() const {
|
||||
return m_scheduler;
|
||||
}
|
||||
|
||||
private:
|
||||
KernelCore& m_kernel;
|
||||
const std::size_t m_core_index;
|
||||
Core::System& m_system;
|
||||
Kernel::KScheduler& m_scheduler;
|
||||
|
||||
std::mutex m_guard;
|
||||
std::condition_variable m_on_interrupt;
|
||||
std::unique_ptr<Core::ARM_Interface> m_arm_interface;
|
||||
Core::ArmInterface* m_arm_interface{};
|
||||
KThread* m_current_thread{};
|
||||
bool m_is_interrupted{};
|
||||
bool m_is_single_core{};
|
||||
};
|
||||
|
||||
} // namespace Kernel
|
||||
|
|
File diff suppressed because it is too large
Load Diff
|
@ -9,6 +9,8 @@ namespace Core {
|
|||
class System;
|
||||
}
|
||||
|
||||
#include <span>
|
||||
|
||||
#include "common/common_types.h"
|
||||
#include "core/hle/kernel/svc_types.h"
|
||||
#include "core/hle/result.h"
|
||||
|
@ -520,15 +522,15 @@ void CallSecureMonitor64From32(Core::System& system, ilp32::SecureMonitorArgumen
|
|||
void CallSecureMonitor64(Core::System& system, lp64::SecureMonitorArguments* args);
|
||||
|
||||
// Defined in svc_light_ipc.cpp.
|
||||
void SvcWrap_ReplyAndReceiveLight64From32(Core::System& system);
|
||||
void SvcWrap_ReplyAndReceiveLight64(Core::System& system);
|
||||
void SvcWrap_ReplyAndReceiveLight64From32(Core::System& system, std::span<uint64_t, 8> args);
|
||||
void SvcWrap_ReplyAndReceiveLight64(Core::System& system, std::span<uint64_t, 8> args);
|
||||
|
||||
void SvcWrap_SendSyncRequestLight64From32(Core::System& system);
|
||||
void SvcWrap_SendSyncRequestLight64(Core::System& system);
|
||||
void SvcWrap_SendSyncRequestLight64From32(Core::System& system, std::span<uint64_t, 8> args);
|
||||
void SvcWrap_SendSyncRequestLight64(Core::System& system, std::span<uint64_t, 8> args);
|
||||
|
||||
// Defined in svc_secure_monitor_call.cpp.
|
||||
void SvcWrap_CallSecureMonitor64From32(Core::System& system);
|
||||
void SvcWrap_CallSecureMonitor64(Core::System& system);
|
||||
void SvcWrap_CallSecureMonitor64From32(Core::System& system, std::span<uint64_t, 8> args);
|
||||
void SvcWrap_CallSecureMonitor64(Core::System& system, std::span<uint64_t, 8> args);
|
||||
|
||||
// Perform a supervisor call by index.
|
||||
void Call(Core::System& system, u32 imm);
|
||||
|
|
|
@ -103,9 +103,7 @@ void Break(Core::System& system, BreakReason reason, u64 info1, u64 info2) {
|
|||
|
||||
handle_debug_buffer(info1, info2);
|
||||
|
||||
auto* const current_thread = GetCurrentThreadPointer(system.Kernel());
|
||||
const auto thread_processor_id = current_thread->GetActiveCore();
|
||||
system.ArmInterface(static_cast<std::size_t>(thread_processor_id)).LogBacktrace();
|
||||
system.CurrentPhysicalCore().LogBacktrace();
|
||||
}
|
||||
|
||||
const bool is_hbl = GetCurrentProcess(system.Kernel()).IsHbl();
|
||||
|
|
|
@ -37,37 +37,36 @@ Result ReplyAndReceiveLight64From32(Core::System& system, Handle session_handle,
|
|||
// Custom ABI implementation for light IPC.
|
||||
|
||||
template <typename F>
|
||||
static void SvcWrap_LightIpc(Core::System& system, F&& cb) {
|
||||
auto& core = system.CurrentArmInterface();
|
||||
std::array<u32, 7> arguments{};
|
||||
static void SvcWrap_LightIpc(Core::System& system, std::span<uint64_t, 8> args, F&& cb) {
|
||||
std::array<u32, 7> ipc_args{};
|
||||
|
||||
Handle session_handle = static_cast<Handle>(core.GetReg(0));
|
||||
Handle session_handle = static_cast<Handle>(args[0]);
|
||||
for (int i = 0; i < 7; i++) {
|
||||
arguments[i] = static_cast<u32>(core.GetReg(i + 1));
|
||||
ipc_args[i] = static_cast<u32>(args[i + 1]);
|
||||
}
|
||||
|
||||
Result ret = cb(system, session_handle, arguments.data());
|
||||
Result ret = cb(system, session_handle, ipc_args.data());
|
||||
|
||||
core.SetReg(0, ret.raw);
|
||||
args[0] = ret.raw;
|
||||
for (int i = 0; i < 7; i++) {
|
||||
core.SetReg(i + 1, arguments[i]);
|
||||
args[i + 1] = ipc_args[i];
|
||||
}
|
||||
}
|
||||
|
||||
void SvcWrap_SendSyncRequestLight64(Core::System& system) {
|
||||
SvcWrap_LightIpc(system, SendSyncRequestLight64);
|
||||
void SvcWrap_SendSyncRequestLight64(Core::System& system, std::span<uint64_t, 8> args) {
|
||||
SvcWrap_LightIpc(system, args, SendSyncRequestLight64);
|
||||
}
|
||||
|
||||
void SvcWrap_ReplyAndReceiveLight64(Core::System& system) {
|
||||
SvcWrap_LightIpc(system, ReplyAndReceiveLight64);
|
||||
void SvcWrap_ReplyAndReceiveLight64(Core::System& system, std::span<uint64_t, 8> args) {
|
||||
SvcWrap_LightIpc(system, args, ReplyAndReceiveLight64);
|
||||
}
|
||||
|
||||
void SvcWrap_SendSyncRequestLight64From32(Core::System& system) {
|
||||
SvcWrap_LightIpc(system, SendSyncRequestLight64From32);
|
||||
void SvcWrap_SendSyncRequestLight64From32(Core::System& system, std::span<uint64_t, 8> args) {
|
||||
SvcWrap_LightIpc(system, args, SendSyncRequestLight64From32);
|
||||
}
|
||||
|
||||
void SvcWrap_ReplyAndReceiveLight64From32(Core::System& system) {
|
||||
SvcWrap_LightIpc(system, ReplyAndReceiveLight64From32);
|
||||
void SvcWrap_ReplyAndReceiveLight64From32(Core::System& system, std::span<uint64_t, 8> args) {
|
||||
SvcWrap_LightIpc(system, args, ReplyAndReceiveLight64From32);
|
||||
}
|
||||
|
||||
} // namespace Kernel::Svc
|
||||
|
|
|
@ -22,31 +22,29 @@ void CallSecureMonitor64From32(Core::System& system, ilp32::SecureMonitorArgumen
|
|||
|
||||
// Custom ABI for CallSecureMonitor.
|
||||
|
||||
void SvcWrap_CallSecureMonitor64(Core::System& system) {
|
||||
auto& core = system.CurrentPhysicalCore().ArmInterface();
|
||||
lp64::SecureMonitorArguments args{};
|
||||
void SvcWrap_CallSecureMonitor64(Core::System& system, std::span<uint64_t, 8> args) {
|
||||
lp64::SecureMonitorArguments smc_args{};
|
||||
for (int i = 0; i < 8; i++) {
|
||||
args.r[i] = core.GetReg(i);
|
||||
smc_args.r[i] = args[i];
|
||||
}
|
||||
|
||||
CallSecureMonitor64(system, std::addressof(args));
|
||||
CallSecureMonitor64(system, std::addressof(smc_args));
|
||||
|
||||
for (int i = 0; i < 8; i++) {
|
||||
core.SetReg(i, args.r[i]);
|
||||
args[i] = smc_args.r[i];
|
||||
}
|
||||
}
|
||||
|
||||
void SvcWrap_CallSecureMonitor64From32(Core::System& system) {
|
||||
auto& core = system.CurrentPhysicalCore().ArmInterface();
|
||||
ilp32::SecureMonitorArguments args{};
|
||||
void SvcWrap_CallSecureMonitor64From32(Core::System& system, std::span<uint64_t, 8> args) {
|
||||
ilp32::SecureMonitorArguments smc_args{};
|
||||
for (int i = 0; i < 8; i++) {
|
||||
args.r[i] = static_cast<u32>(core.GetReg(i));
|
||||
smc_args.r[i] = static_cast<u32>(args[i]);
|
||||
}
|
||||
|
||||
CallSecureMonitor64From32(system, std::addressof(args));
|
||||
CallSecureMonitor64From32(system, std::addressof(smc_args));
|
||||
|
||||
for (int i = 0; i < 8; i++) {
|
||||
core.SetReg(i, args.r[i]);
|
||||
args[i] = smc_args.r[i];
|
||||
}
|
||||
}
|
||||
|
||||
|
|
|
@ -90,8 +90,6 @@ Result StartThread(Core::System& system, Handle thread_handle) {
|
|||
|
||||
/// Called when a thread exits
|
||||
void ExitThread(Core::System& system) {
|
||||
LOG_DEBUG(Kernel_SVC, "called, pc=0x{:08X}", system.CurrentArmInterface().GetPC());
|
||||
|
||||
auto* const current_thread = GetCurrentThreadPointer(system.Kernel());
|
||||
system.GlobalSchedulerContext().RemoveThread(current_thread);
|
||||
current_thread->Exit();
|
||||
|
@ -147,47 +145,19 @@ Result GetThreadContext3(Core::System& system, u64 out_context, Handle thread_ha
|
|||
R_UNLESS(thread.IsNotNull(), ResultInvalidHandle);
|
||||
|
||||
// Require the handle be to a non-current thread in the current process.
|
||||
const auto* current_process = GetCurrentProcessPointer(kernel);
|
||||
R_UNLESS(current_process == thread->GetOwnerProcess(), ResultInvalidId);
|
||||
|
||||
// Verify that the thread isn't terminated.
|
||||
R_UNLESS(thread->GetState() != ThreadState::Terminated, ResultTerminationRequested);
|
||||
|
||||
/// Check that the thread is not the current one.
|
||||
/// NOTE: Nintendo does not check this, and thus the following loop will deadlock.
|
||||
R_UNLESS(thread.GetPointerUnsafe() != GetCurrentThreadPointer(kernel), ResultInvalidId);
|
||||
|
||||
// Try to get the thread context until the thread isn't current on any core.
|
||||
while (true) {
|
||||
KScopedSchedulerLock sl{kernel};
|
||||
|
||||
// TODO(bunnei): Enforce that thread is suspended for debug here.
|
||||
|
||||
// If the thread's raw state isn't runnable, check if it's current on some core.
|
||||
if (thread->GetRawState() != ThreadState::Runnable) {
|
||||
bool current = false;
|
||||
for (auto i = 0; i < static_cast<s32>(Core::Hardware::NUM_CPU_CORES); ++i) {
|
||||
if (thread.GetPointerUnsafe() == kernel.Scheduler(i).GetSchedulerCurrentThread()) {
|
||||
current = true;
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
// If the thread is current, retry until it isn't.
|
||||
if (current) {
|
||||
continue;
|
||||
}
|
||||
}
|
||||
R_UNLESS(thread->GetOwnerProcess() == GetCurrentProcessPointer(kernel), ResultInvalidHandle);
|
||||
R_UNLESS(thread.GetPointerUnsafe() != GetCurrentThreadPointer(kernel), ResultBusy);
|
||||
|
||||
// Get the thread context.
|
||||
static thread_local Common::ScratchBuffer<u8> context;
|
||||
R_TRY(thread->GetThreadContext3(context));
|
||||
Svc::ThreadContext context{};
|
||||
R_TRY(thread->GetThreadContext3(std::addressof(context)));
|
||||
|
||||
// Copy the thread context to user space.
|
||||
GetCurrentMemory(kernel).WriteBlock(out_context, context.data(), context.size());
|
||||
R_UNLESS(
|
||||
GetCurrentMemory(kernel).WriteBlock(out_context, std::addressof(context), sizeof(context)),
|
||||
ResultInvalidPointer);
|
||||
|
||||
R_SUCCEED();
|
||||
}
|
||||
}
|
||||
|
||||
/// Gets the priority for the specified thread
|
||||
|
|
|
@ -374,11 +374,11 @@ def get_registers(parse_result, bitness):
|
|||
|
||||
# Collects possibly multiple source registers into the named C++ value.
|
||||
def emit_gather(sources, name, type_name, reg_size):
|
||||
get_fn = f"GetReg{reg_size*8}"
|
||||
get_fn = f"GetArg{reg_size*8}"
|
||||
|
||||
if len(sources) == 1:
|
||||
s, = sources
|
||||
line = f"{name} = Convert<{type_name}>({get_fn}(system, {s}));"
|
||||
line = f"{name} = Convert<{type_name}>({get_fn}(args, {s}));"
|
||||
return [line]
|
||||
|
||||
var_type = f"std::array<uint{reg_size*8}_t, {len(sources)}>"
|
||||
|
@ -387,7 +387,7 @@ def emit_gather(sources, name, type_name, reg_size):
|
|||
]
|
||||
for i in range(0, len(sources)):
|
||||
lines.append(
|
||||
f"{name}_gather[{i}] = {get_fn}(system, {sources[i]});")
|
||||
f"{name}_gather[{i}] = {get_fn}(args, {sources[i]});")
|
||||
|
||||
lines.append(f"{name} = Convert<{type_name}>({name}_gather);")
|
||||
return lines
|
||||
|
@ -396,12 +396,12 @@ def emit_gather(sources, name, type_name, reg_size):
|
|||
# Produces one or more statements which assign the named C++ value
|
||||
# into possibly multiple registers.
|
||||
def emit_scatter(destinations, name, reg_size):
|
||||
set_fn = f"SetReg{reg_size*8}"
|
||||
set_fn = f"SetArg{reg_size*8}"
|
||||
reg_type = f"uint{reg_size*8}_t"
|
||||
|
||||
if len(destinations) == 1:
|
||||
d, = destinations
|
||||
line = f"{set_fn}(system, {d}, Convert<{reg_type}>({name}));"
|
||||
line = f"{set_fn}(args, {d}, Convert<{reg_type}>({name}));"
|
||||
return [line]
|
||||
|
||||
var_type = f"std::array<{reg_type}, {len(destinations)}>"
|
||||
|
@ -411,7 +411,7 @@ def emit_scatter(destinations, name, reg_size):
|
|||
|
||||
for i in range(0, len(destinations)):
|
||||
lines.append(
|
||||
f"{set_fn}(system, {destinations[i]}, {name}_scatter[{i}]);")
|
||||
f"{set_fn}(args, {destinations[i]}, {name}_scatter[{i}]);")
|
||||
|
||||
return lines
|
||||
|
||||
|
@ -433,7 +433,7 @@ def emit_lines(lines, indent=' '):
|
|||
def emit_wrapper(wrapped_fn, suffix, register_info, arguments, byte_size):
|
||||
return_write, output_writes, input_reads = register_info
|
||||
lines = [
|
||||
f"static void SvcWrap_{wrapped_fn}{suffix}(Core::System& system) {{"
|
||||
f"static void SvcWrap_{wrapped_fn}{suffix}(Core::System& system, std::span<uint64_t, 8> args) {{"
|
||||
]
|
||||
|
||||
# Get everything ready.
|
||||
|
@ -498,6 +498,8 @@ namespace Core {
|
|||
class System;
|
||||
}
|
||||
|
||||
#include <span>
|
||||
|
||||
#include "common/common_types.h"
|
||||
#include "core/hle/kernel/svc_types.h"
|
||||
#include "core/hle/result.h"
|
||||
|
@ -524,15 +526,15 @@ void CallSecureMonitor64From32(Core::System& system, ilp32::SecureMonitorArgumen
|
|||
void CallSecureMonitor64(Core::System& system, lp64::SecureMonitorArguments* args);
|
||||
|
||||
// Defined in svc_light_ipc.cpp.
|
||||
void SvcWrap_ReplyAndReceiveLight64From32(Core::System& system);
|
||||
void SvcWrap_ReplyAndReceiveLight64(Core::System& system);
|
||||
void SvcWrap_ReplyAndReceiveLight64From32(Core::System& system, std::span<uint64_t, 8> args);
|
||||
void SvcWrap_ReplyAndReceiveLight64(Core::System& system, std::span<uint64_t, 8> args);
|
||||
|
||||
void SvcWrap_SendSyncRequestLight64From32(Core::System& system);
|
||||
void SvcWrap_SendSyncRequestLight64(Core::System& system);
|
||||
void SvcWrap_SendSyncRequestLight64From32(Core::System& system, std::span<uint64_t, 8> args);
|
||||
void SvcWrap_SendSyncRequestLight64(Core::System& system, std::span<uint64_t, 8> args);
|
||||
|
||||
// Defined in svc_secure_monitor_call.cpp.
|
||||
void SvcWrap_CallSecureMonitor64From32(Core::System& system);
|
||||
void SvcWrap_CallSecureMonitor64(Core::System& system);
|
||||
void SvcWrap_CallSecureMonitor64From32(Core::System& system, std::span<uint64_t, 8> args);
|
||||
void SvcWrap_CallSecureMonitor64(Core::System& system, std::span<uint64_t, 8> args);
|
||||
|
||||
// Perform a supervisor call by index.
|
||||
void Call(Core::System& system, u32 imm);
|
||||
|
@ -550,20 +552,20 @@ PROLOGUE_CPP = """
|
|||
|
||||
namespace Kernel::Svc {
|
||||
|
||||
static uint32_t GetReg32(Core::System& system, int n) {
|
||||
return static_cast<uint32_t>(system.CurrentArmInterface().GetReg(n));
|
||||
static uint32_t GetArg32(std::span<uint64_t, 8> args, int n) {
|
||||
return static_cast<uint32_t>(args[n]);
|
||||
}
|
||||
|
||||
static void SetReg32(Core::System& system, int n, uint32_t result) {
|
||||
system.CurrentArmInterface().SetReg(n, static_cast<uint64_t>(result));
|
||||
static void SetArg32(std::span<uint64_t, 8> args, int n, uint32_t result) {
|
||||
args[n] = result;
|
||||
}
|
||||
|
||||
static uint64_t GetReg64(Core::System& system, int n) {
|
||||
return system.CurrentArmInterface().GetReg(n);
|
||||
static uint64_t GetArg64(std::span<uint64_t, 8> args, int n) {
|
||||
return args[n];
|
||||
}
|
||||
|
||||
static void SetReg64(Core::System& system, int n, uint64_t result) {
|
||||
system.CurrentArmInterface().SetReg(n, result);
|
||||
static void SetArg64(std::span<uint64_t, 8> args, int n, uint64_t result) {
|
||||
args[n] = result;
|
||||
}
|
||||
|
||||
// Like bit_cast, but handles the case when the source and dest
|
||||
|
@ -590,15 +592,20 @@ EPILOGUE_CPP = """
|
|||
|
||||
void Call(Core::System& system, u32 imm) {
|
||||
auto& kernel = system.Kernel();
|
||||
auto& process = GetCurrentProcess(kernel);
|
||||
|
||||
std::array<uint64_t, 8> args;
|
||||
kernel.CurrentPhysicalCore().SaveSvcArguments(process, args);
|
||||
kernel.EnterSVCProfile();
|
||||
|
||||
if (GetCurrentProcess(system.Kernel()).Is64Bit()) {
|
||||
Call64(system, imm);
|
||||
if (process.Is64Bit()) {
|
||||
Call64(system, imm, args);
|
||||
} else {
|
||||
Call32(system, imm);
|
||||
Call32(system, imm, args);
|
||||
}
|
||||
|
||||
kernel.ExitSVCProfile();
|
||||
kernel.CurrentPhysicalCore().LoadSvcArguments(process, args);
|
||||
}
|
||||
|
||||
} // namespace Kernel::Svc
|
||||
|
@ -609,13 +616,13 @@ def emit_call(bitness, names, suffix):
|
|||
bit_size = REG_SIZES[bitness]*8
|
||||
indent = " "
|
||||
lines = [
|
||||
f"static void Call{bit_size}(Core::System& system, u32 imm) {{",
|
||||
f"static void Call{bit_size}(Core::System& system, u32 imm, std::span<uint64_t, 8> args) {{",
|
||||
f"{indent}switch (static_cast<SvcId>(imm)) {{"
|
||||
]
|
||||
|
||||
for _, name in names:
|
||||
lines.append(f"{indent}case SvcId::{name}:")
|
||||
lines.append(f"{indent*2}return SvcWrap_{name}{suffix}(system);")
|
||||
lines.append(f"{indent*2}return SvcWrap_{name}{suffix}(system, args);")
|
||||
|
||||
lines.append(f"{indent}default:")
|
||||
lines.append(
|
||||
|
|
|
@ -1,6 +1,7 @@
|
|||
// SPDX-FileCopyrightText: Copyright 2022 yuzu Emulator Project
|
||||
// SPDX-License-Identifier: GPL-2.0-or-later
|
||||
|
||||
#include "core/arm/debug.h"
|
||||
#include "core/arm/symbols.h"
|
||||
#include "core/core.h"
|
||||
#include "core/hle/kernel/k_code_memory.h"
|
||||
|
@ -98,7 +99,8 @@ public:
|
|||
if (return_value == 0) {
|
||||
// The callback has written to the output executable code range,
|
||||
// requiring an instruction cache invalidation
|
||||
system.InvalidateCpuInstructionCacheRange(configuration.user_rx_memory.offset,
|
||||
Core::InvalidateInstructionCacheRange(process.GetPointerUnsafe(),
|
||||
configuration.user_rx_memory.offset,
|
||||
configuration.user_rx_memory.size);
|
||||
|
||||
// Write back to the IPC output buffer, if provided
|
||||
|
|
|
@ -43,13 +43,9 @@ bool AddressSpaceContains(const Common::PageTable& table, const Common::ProcessA
|
|||
struct Memory::Impl {
|
||||
explicit Impl(Core::System& system_) : system{system_} {}
|
||||
|
||||
void SetCurrentPageTable(Kernel::KProcess& process, u32 core_id) {
|
||||
void SetCurrentPageTable(Kernel::KProcess& process) {
|
||||
current_page_table = &process.GetPageTable().GetImpl();
|
||||
current_page_table->fastmem_arena = system.DeviceMemory().buffer.VirtualBasePointer();
|
||||
|
||||
const std::size_t address_space_width = process.GetPageTable().GetAddressSpaceWidth();
|
||||
|
||||
system.ArmInterface(core_id).PageTableChanged(*current_page_table, address_space_width);
|
||||
}
|
||||
|
||||
void MapMemoryRegion(Common::PageTable& page_table, Common::ProcessAddress base, u64 size,
|
||||
|
@ -871,8 +867,8 @@ void Memory::Reset() {
|
|||
impl = std::make_unique<Impl>(system);
|
||||
}
|
||||
|
||||
void Memory::SetCurrentPageTable(Kernel::KProcess& process, u32 core_id) {
|
||||
impl->SetCurrentPageTable(process, core_id);
|
||||
void Memory::SetCurrentPageTable(Kernel::KProcess& process) {
|
||||
impl->SetCurrentPageTable(process);
|
||||
}
|
||||
|
||||
void Memory::MapMemoryRegion(Common::PageTable& page_table, Common::ProcessAddress base, u64 size,
|
||||
|
|
|
@ -73,7 +73,7 @@ public:
|
|||
*
|
||||
* @param process The process to use the page table of.
|
||||
*/
|
||||
void SetCurrentPageTable(Kernel::KProcess& process, u32 core_id);
|
||||
void SetCurrentPageTable(Kernel::KProcess& process);
|
||||
|
||||
/**
|
||||
* Maps an allocated buffer onto a region of the emulated process address space.
|
||||
|
|
|
@ -109,41 +109,11 @@ json GetProcessorStateData(const std::string& architecture, u64 entry_point, u64
|
|||
return out;
|
||||
}
|
||||
|
||||
json GetProcessorStateDataAuto(Core::System& system) {
|
||||
const auto* process{system.ApplicationProcess()};
|
||||
auto& arm{system.CurrentArmInterface()};
|
||||
|
||||
Core::ARM_Interface::ThreadContext64 context{};
|
||||
arm.SaveContext(context);
|
||||
|
||||
return GetProcessorStateData(process->Is64Bit() ? "AArch64" : "AArch32",
|
||||
GetInteger(process->GetEntryPoint()), context.sp, context.pc,
|
||||
context.pstate, context.cpu_registers);
|
||||
}
|
||||
|
||||
json GetBacktraceData(Core::System& system) {
|
||||
auto out = json::array();
|
||||
const auto& backtrace{system.CurrentArmInterface().GetBacktrace()};
|
||||
for (const auto& entry : backtrace) {
|
||||
out.push_back({
|
||||
{"module", entry.module},
|
||||
{"address", fmt::format("{:016X}", entry.address)},
|
||||
{"original_address", fmt::format("{:016X}", entry.original_address)},
|
||||
{"offset", fmt::format("{:016X}", entry.offset)},
|
||||
{"symbol_name", entry.name},
|
||||
});
|
||||
}
|
||||
|
||||
return out;
|
||||
}
|
||||
|
||||
json GetFullDataAuto(const std::string& timestamp, u64 title_id, Core::System& system) {
|
||||
json out;
|
||||
|
||||
out["yuzu_version"] = GetYuzuVersionData();
|
||||
out["report_common"] = GetReportCommonData(title_id, ResultSuccess, timestamp);
|
||||
out["processor_state"] = GetProcessorStateDataAuto(system);
|
||||
out["backtrace"] = GetBacktraceData(system);
|
||||
|
||||
return out;
|
||||
}
|
||||
|
@ -351,8 +321,6 @@ void Reporter::SaveErrorReport(u64 title_id, Result result,
|
|||
|
||||
out["yuzu_version"] = GetYuzuVersionData();
|
||||
out["report_common"] = GetReportCommonData(title_id, result, timestamp);
|
||||
out["processor_state"] = GetProcessorStateDataAuto(system);
|
||||
out["backtrace"] = GetBacktraceData(system);
|
||||
|
||||
out["error_custom_text"] = {
|
||||
{"main", custom_text_main.value_or("")},
|
||||
|
|
|
@ -7,7 +7,7 @@
|
|||
#include "yuzu/debugger/wait_tree.h"
|
||||
#include "yuzu/uisettings.h"
|
||||
|
||||
#include "core/arm/arm_interface.h"
|
||||
#include "core/arm/debug.h"
|
||||
#include "core/core.h"
|
||||
#include "core/hle/kernel/k_class_token.h"
|
||||
#include "core/hle/kernel/k_handle_table.h"
|
||||
|
@ -129,7 +129,7 @@ std::vector<std::unique_ptr<WaitTreeItem>> WaitTreeCallstack::GetChildren() cons
|
|||
return list;
|
||||
}
|
||||
|
||||
auto backtrace = Core::ARM_Interface::GetBacktraceFromContext(system, thread.GetContext64());
|
||||
auto backtrace = Core::GetBacktraceFromContext(thread.GetOwnerProcess(), thread.GetContext());
|
||||
|
||||
for (auto& entry : backtrace) {
|
||||
std::string s = fmt::format("{:20}{:016X} {:016X} {:016X} {}", entry.module, entry.address,
|
||||
|
@ -238,10 +238,10 @@ QString WaitTreeThread::GetText() const {
|
|||
break;
|
||||
}
|
||||
|
||||
const auto& context = thread.GetContext64();
|
||||
const auto& context = thread.GetContext();
|
||||
const QString pc_info = tr(" PC = 0x%1 LR = 0x%2")
|
||||
.arg(context.pc, 8, 16, QLatin1Char{'0'})
|
||||
.arg(context.cpu_registers[30], 8, 16, QLatin1Char{'0'});
|
||||
.arg(context.lr, 8, 16, QLatin1Char{'0'});
|
||||
return QStringLiteral("%1%2 (%3) ")
|
||||
.arg(WaitTreeSynchronizationObject::GetText(), pc_info, status);
|
||||
}
|
||||
|
|
Reference in New Issue